Revision as of 19:33, 8 January 2007 editStepa (talk | contribs)1,402 editsm +pl:← Previous edit | Latest revision as of 11:50, 17 March 2021 edit undoLegionMammal978 (talk | contribs)Extended confirmed users7,894 editsm moved PIN | ||
(26 intermediate revisions by 18 users not shown) | |||
Line 1: | Line 1: | ||
{{chembox | |||
'''Methazole''' (C<sub>9</sub>H<sub>6</sub>Cl<sub>2</sub>N<sub>2</sub>O<sub>3</sub>) is a ]. | |||
| Verifiedfields = changed | |||
==Names== | |||
| Watchedfields = changed | |||
*Oxydiazol | |||
| verifiedrevid = 432143455 | |||
*VCS 438 | |||
| ImageFile = Methazole.png | |||
*Paxilon | |||
| ImageSize = 200 | |||
*Probe | |||
| ImageAlt = Skeletal formula of methazole | |||
| ImageFile1 = Methazole-3D-spacefill.png | |||
| ImageSize1 = 200 | |||
| ImageAlt1 = Space-filling model of methazole | |||
| PIN = 2-(3,4-Dichlorophenyl)-4-methyl-1,2,4-oxadiazolidine-3,5-dione | |||
| OtherNames = Metazole; Oxydiazol; VCS 438; Paxilon; Probe; Metazol; Mezopur; Oxydiazol; Bioxone; Chlormethazole | |||
|Section1={{Chembox Identifiers | |||
| CASNo_Ref = {{cascite|correct|??}} | |||
| CASNo = 20354-26-1 | |||
| UNII_Ref = {{fdacite|changed|FDA}} | |||
| UNII = E35M7EMD3V | |||
| PubChem = 4690 | |||
| KEGG_Ref = {{keggcite|correct|kegg}} | |||
| KEGG = C19123 | |||
| SMILES = CN1C(=O)N(OC1=O)C2=CC(=C(C=C2)Cl)Cl | |||
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} | |||
| ChemSpiderID = 4528 | |||
| InChI = 1/C9H6Cl2N2O3/c1-12-8(14)13(16-9(12)15)5-2-3-6(10)7(11)4-5/h2-4H,1H3 | |||
| InChIKey = LRUUNMYPIBZBQH-UHFFFAOYAP | |||
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} | |||
| StdInChI = 1S/C9H6Cl2N2O3/c1-12-8(14)13(16-9(12)15)5-2-3-6(10)7(11)4-5/h2-4H,1H3 | |||
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} | |||
| StdInChIKey = LRUUNMYPIBZBQH-UHFFFAOYSA-N | |||
}} | |||
|Section2={{Chembox Properties | |||
| C=9|H=6|Cl=2|N=2|O=3 | |||
| Appearance = | |||
| Density = | |||
| MeltingPt = | |||
| BoilingPt = | |||
| Solubility = | |||
}} | |||
|Section3={{Chembox Hazards | |||
| MainHazards = | |||
| FlashPt = | |||
| AutoignitionPt = | |||
}} | |||
}} | |||
'''Methazole''' (C<sub>9</sub>H<sub>6</sub>Cl<sub>2</sub>N<sub>2</sub>O<sub>3</sub>) is an obsolete<ref name=Hertfordshire>{{cite web | url = https://sitem.herts.ac.uk/aeru/iupac/Reports/454.htm | title = Methazole | publisher = University of Hertfordshire}}</ref> ] in the family of herbicides known as ]s. It was used as a post-emergent treatment for controlling weeds.<ref name=Hertfordshire/> | |||
==References== | |||
{{reflist}} | |||
{{Herbicides}} | |||
==External links== | |||
{{ChemicalSources}} | |||
] | ] | ||
] | |||
] | |||
{{ |
{{heterocyclic-stub}} | ||
] |
Latest revision as of 11:50, 17 March 2021
Names | |
---|---|
Preferred IUPAC name 2-(3,4-Dichlorophenyl)-4-methyl-1,2,4-oxadiazolidine-3,5-dione | |
Other names Metazole; Oxydiazol; VCS 438; Paxilon; Probe; Metazol; Mezopur; Oxydiazol; Bioxone; Chlormethazole | |
Identifiers | |
CAS Number | |
3D model (JSmol) | |
ChemSpider | |
ECHA InfoCard | 100.039.767 |
KEGG | |
PubChem CID | |
UNII | |
CompTox Dashboard (EPA) | |
InChI
| |
SMILES
| |
Properties | |
Chemical formula | C9H6Cl2N2O3 |
Molar mass | 261.06 g·mol |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C , 100 kPa). N verify (what is ?) Infobox references |
Methazole (C9H6Cl2N2O3) is an obsolete herbicide in the family of herbicides known as oxadiazolones. It was used as a post-emergent treatment for controlling weeds.
References
- ^ "Methazole". University of Hertfordshire.
This article about a heterocyclic compound is a stub. You can help Misplaced Pages by expanding it. |