Revision as of 07:50, 9 September 2012 editPamD (talk | contribs)Autopatrolled, Extended confirmed users, New page reviewers, Pending changes reviewers, Rollbackers206,518 edits stub-sort← Previous edit |
Latest revision as of 08:44, 4 September 2021 edit undoHtmlzycq (talk | contribs)Extended confirmed users, IP block exemptions3,935 editsm →References |
(13 intermediate revisions by 12 users not shown) |
Line 1: |
Line 1: |
|
|
{{Chembox |
⚫ |
'''Promecarb''' (]: C<sub>12</sub>H<sub>17</sub>NO</sub>2</sub>) is a ] used in ].<ref> at www.alanwood.net.</ref> |
|
|
|
| ImageFile = Promecarb.svg |
|
|
| ImageSize = 200px |
|
|
| PIN = 3-Methyl-5-(propan-2-yl)phenyl methylcarbamate |
|
|
| OtherNames = 5-Methyl-''m''-cumenyl methylcarbamate |
|
|
|Section1={{Chembox Identifiers |
|
|
| CASNo = 2631-37-0 |
|
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = 1QRP20775S |
|
|
| PubChem = 17516 |
|
|
| ChemSpiderID = 16563 |
|
|
| SMILES = O=C(Oc1cc(cc(c1)C(C)C)C)NC |
|
|
| InChI = 1/C12H17NO2/c1-8(2)10-5-9(3)6-11(7-10)15-12(14)13-4/h5-8H,1-4H3,(H,13,14) |
|
|
| InChIKey = DTAPQAJKAFRNJB-UHFFFAOYAG |
|
|
| StdInChI = 1S/C12H17NO2/c1-8(2)10-5-9(3)6-11(7-10)15-12(14)13-4/h5-8H,1-4H3,(H,13,14) |
|
|
| StdInChIKey = DTAPQAJKAFRNJB-UHFFFAOYSA-N |
|
|
}} |
|
|
|Section2={{Chembox Properties |
|
|
| C=12 | H=17 | N=1 | O=2 |
|
|
| Appearance = |
|
|
| Density = |
|
|
| MeltingPt = |
|
|
| BoilingPt = |
|
|
| Solubility = |
|
|
}} |
|
|
|Section3={{Chembox Hazards |
|
|
| MainHazards = |
|
|
| FlashPt = |
|
|
| AutoignitionPt = |
|
|
}} |
|
|
}} |
|
|
|
|
⚫ |
'''Promecarb''' (]: C<sub>12</sub>H<sub>17</sub>NO<sub>2</sub>) is a ] previously used as an ].<ref>{{PPDB|540}}</ref> |
|
|
|
|
|
==References== |
|
==References== |
|
{{reflist}} |
|
{{reflist}} |
|
|
{{Insecticides}} |
|
⚫ |
] |
|
|
] |
|
|
] |
|
|
] |
|
|
|
|
|
⚫ |
{{organic-compound-stub}} |
⚫ |
] |
|
|
|
|
|
|
|
⚫ |
{{org-compound-stub}} |
|