Revision as of 20:06, 21 September 2014 edit66.61.92.158 (talk)No edit summary← Previous edit |
Latest revision as of 13:24, 21 March 2024 edit undoMarbletan (talk | contribs)Extended confirmed users5,530 edits External links last |
(8 intermediate revisions by 7 users not shown) |
Line 2: |
Line 2: |
|
| ImageFile = Formetanate.svg |
|
| ImageFile = Formetanate.svg |
|
| ImageSize = 200px |
|
| ImageSize = 200px |
|
| IUPACName = 3-{(''E'')-amino}phenyl methylcarbamate |
|
| IUPACName = 3-<nowiki/>{(''E'')-amino}phenyl methylcarbamate |
|
| OtherNames = Carzol |
|
| OtherNames = Carzol |
|
| Section1 = {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| CASNo = 22259-30-9 |
|
| CASNo = 22259-30-9 |
|
| CASNo_Ref = {{cascite|correct|}} |
|
| CASNo_Ref = {{cascite|correct|}} |
|
| CASNo1 = 23422-53-9 |
|
| CASNo1 = 23422-53-9 |
|
| CASNo1_Ref = {{cascite|correct|}} |
|
| CASNo1_Ref = {{cascite|correct|}} |
|
| CASNo1_Comment = (]) |
|
| CASNo1_Comment = (]) |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
⚫ |
| PubChem = 31099 |
|
|
|
| UNII = 532HEC1KKM |
⚫ |
| ChemSpiderID = 28856 |
|
|
|
| UNII1_Ref = {{fdacite|correct|FDA}} |
⚫ |
| SMILES = O=C(Oc1cccc(\N=C\N(C)C)c1)NC |
|
|
|
| UNII1 = W0Y3OP0N2Z |
⚫ |
| InChI = 1/C11H15N3O2/c1-12-11(15)16-10-6-4-5-9(7-10)13-8-14(2)3/h4-8H,1-3H3,(H,12,15)/b13-8+ |
|
|
|
| UNII1_Comment = (]) |
⚫ |
| InChIKey = RMFNNCGOSPBBAD-MDWZMJQEBJ |
|
|
⚫ |
| PubChem = 31099 |
⚫ |
| StdInChI = 1S/C11H15N3O2/c1-12-11(15)16-10-6-4-5-9(7-10)13-8-14(2)3/h4-8H,1-3H3,(H,12,15)/b13-8+ |
|
|
⚫ |
| ChemSpiderID = 28856 |
⚫ |
| StdInChIKey = RMFNNCGOSPBBAD-MDWZMJQESA-N |
|
|
⚫ |
| SMILES = O=C(Oc1cccc(\N=C\N(C)C)c1)NC |
|
⚫ |
| InChI = 1/C11H15N3O2/c1-12-11(15)16-10-6-4-5-9(7-10)13-8-14(2)3/h4-8H,1-3H3,(H,12,15)/b13-8+ |
|
⚫ |
| InChIKey = RMFNNCGOSPBBAD-MDWZMJQEBJ |
|
⚫ |
| StdInChI = 1S/C11H15N3O2/c1-12-11(15)16-10-6-4-5-9(7-10)13-8-14(2)3/h4-8H,1-3H3,(H,12,15)/b13-8+ |
|
⚫ |
| StdInChIKey = RMFNNCGOSPBBAD-MDWZMJQESA-N |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| C=11|H=15|N=3|O=2 |
|
| C=11 | H=15 | N=3 | O=2 |
|
| Appearance = |
|
| Appearance = |
|
| Density = |
|
| Density = |
|
| MeltingPt = |
|
| MeltingPt = 102 °C |
|
| BoilingPt = |
|
| BoilingPt = |
|
| Solubility = |
|
| Solubility = |
|
}} |
|
}} |
|
| Section3 = {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
| Autoignition = |
|
| AutoignitionPt = |
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Formetanate''' is an ] and ].<ref>, alanwood.net</ref> It is used on ] grown for seed and on some fruits, including ], ], and ]s.<ref>, Pesticide Management Education Program</ref> |
|
'''Formetanate''' is an ] and ]. It is used on ] grown for seed and on some fruits, including ], ], and ]s.<ref>, Pesticide Management Education Program</ref> |
|
|
|
|
|
==See also== |
|
==See also== |
|
* ] |
|
* ] |
|
|
|
⚫ |
==External links== |
|
|
* |
|
|
|
|
|
|
==References== |
|
==References== |
|
{{Reflist}} |
|
{{Reflist}} |
|
|
|
|
|
⚫ |
==External links== |
|
{{Cholinergics}} |
|
|
|
* {{PPDB|360}} |
|
|
|
|
|
|
{{Insecticides}} |
|
|
{{Acetylcholine metabolism and transport modulators}} |
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
|
|
|
|
|
|
|
{{organic-compound-stub}} |
|
{{organic-compound-stub}} |