Revision as of 18:41, 4 December 2010 editNono64 (talk | contribs)Autopatrolled, Pending changes reviewers, Rollbackers96,246 editsm Category:Isoflavone glycosides← Previous edit |
Latest revision as of 10:19, 24 May 2024 edit undoCitation bot (talk | contribs)Bots5,436,030 edits Add: bibcode, authors 1-1. Removed parameters. Some additions/deletions were parameter name changes. | Use this bot. Report bugs. | Suggested by Superegz | Category:O-methylated isoflavones | #UCB_Category 7/16 |
(38 intermediate revisions by 27 users not shown) |
Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
|
|
| Watchedfields = changed |
|
|
| verifiedrevid = 414762471 |
|
| Name = Iridin |
|
| Name = Iridin |
|
| ImageFile = Iridin2.svg |
|
| ImageFile = Iridin2.svg |
|
| ImageSize = 300px |
|
| ImageSize = 300px |
|
|
| IUPACName = 7-(β-<small>D</small>-Glucopyranosyloxy)-3′,5-dihydroxy-4′,5′,6-trimethoxyisoflavone |
|
| IUPACName = <nowiki>5-hydroxy-3-(3-hydroxy-4,5-dimethoxyphenyl)-6-methoxy-7-oxychromen-4-one</nowiki> |
|
| SystematicName = 5-Hydroxy-3-(3-hydroxy-4,5-dimethoxyphenyl)-6-methoxy-7-{oxy}-4''H''-1-benzopyran-4-one |
|
| OtherNames = Irisin<ref></ref><!-- <br> --> |
|
| OtherNames = Irisin<ref></ref><!-- <br> --> |
|
| Section1 = {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo = 491-74-7 |
|
| CASNo = 491-74-7 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = 6NTS007OHQ |
|
| PubChem = 5281777 |
|
| PubChem = 5281777 |
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEMBL = 487014 |
|
| Beilstein = |
|
| Beilstein = |
|
| SMILES = COC1=CC(=CC(=C1OC)O)C2=COC3=CC(=C(C(=C3C2=O)O)OC)OC4C(C(C(C(O4)CO)O)O)O |
|
| SMILES = COC1=CC(=CC(=C1OC)O)C2=COC3=CC(=C(C(=C3C2=O)O)OC)OC4C(C(C(C(O4)CO)O)O)O |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 4445090 |
|
|
| InChI = 1/C24H26O13/c1-32-13-5-9(4-11(26)22(13)33-2)10-8-35-12-6-14(23(34-3)19(29)16(12)17(10)27)36-24-21(31)20(30)18(28)15(7-25)37-24/h4-6,8,15,18,20-21,24-26,28-31H,7H2,1-3H3/t15-,18-,20+,21-,24-/m1/s1 |
|
|
| InChIKey = LNQCUTNLHUQZLR-OZJWLQQPBX |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C24H26O13/c1-32-13-5-9(4-11(26)22(13)33-2)10-8-35-12-6-14(23(34-3)19(29)16(12)17(10)27)36-24-21(31)20(30)18(28)15(7-25)37-24/h4-6,8,15,18,20-21,24-26,28-31H,7H2,1-3H3/t15-,18-,20+,21-,24-/m1/s1 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = LNQCUTNLHUQZLR-OZJWLQQPSA-N |
|
|
| RTECS = |
|
|
| MeSHName = |
|
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEBI = 5963 |
|
|
| KEGG_Ref = {{keggcite|changed|kegg}} |
|
|
| KEGG = C10465 |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula = C<sub>24</sub>H<sub>26</sub>O<sub>13</sub> |
|
| Formula = C<sub>24</sub>H<sub>26</sub>O<sub>13</sub> |
|
| MolarMass = 522.45 g/mol |
|
| MolarMass = 522.45 g/mol |
|
| ExactMass = 522.137341 |
|
|
| Appearance = |
|
| Appearance = |
|
| Density = |
|
| Density = |
|
| MeltingPt = 208 °C |
|
| MeltingPtC = 208 |
|
| BoilingPt = |
|
| BoilingPt = |
|
| Solubility = }} |
|
| Solubility = }} |
|
| Section3 = {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
| Autoignition = }} |
|
| AutoignitionPt = |
|
|
}} |
|
}} |
|
}} |
|
'''Iridin''' is an ], a type of flavonoid. It is the 7-] of ] and can be isolated from several species of ] like orris root, '']''<ref></ref> or '']'', also commonly known as the larger blue flag. |
|
'''Iridin''' is an ], a type of flavonoid. It is the 7-] of ] and can be isolated from several species of ] like orris root, '']''<ref></ref> or '']'', also commonly known as the larger blue flag. It can also be found in '']''.<ref>{{cite journal |last1=Agarwal |first1=V.K. |last2=Thappa |first2=R.K. |last3=Agarwal |first3=S.G. |last4=Mehraa |first4=M.S. |last5= Dhar |first5=K.L. |date=1984 |title=Isoflavones of two Iris species |journal= Phytochemistry|volume=23 |issue=11 |pages=2703–2704 |doi=10.1016/S0031-9422(00)84141-2 |bibcode=1984PChem..23.2703A }}</ref><ref> J. B. Harborne {{Google books|snL1BwAAQBAJ|The Flavonoids: Advances in Research since 1980|page=133}}</ref> |
|
|
|
|
|
The compound is toxic and these plants have been mentioned as causing poisoning in humans and animals<ref></ref>. |
|
The compound is toxic and these plants have been mentioned as causing poisoning in humans and animals.<ref> {{webarchive|url=https://web.archive.org/web/20110610084858/http://www.cbif.gc.ca/pls/pp/ppack.info?p_psn=228&p_type=all&p_sci=comm |date=2011-06-10 }}</ref> |
|
|
|
|
|
==References== |
|
== References == |
|
{{reflist}} |
|
{{reflist}} |
|
|
|
|
|
{{isoflavone}} |
|
{{isoflavone}} |
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
⚫ |
{{Aromatic-stub}} |
|
|
|
⚫ |
{{Polyphenol-stub}} |
|
|
|
|
|
] |
|
The compound is toxic and these plants have been mentioned as causing poisoning in humans and animals.