Revision as of 07:39, 29 March 2011 editNono64 (talk | contribs)Autopatrolled, Pending changes reviewers, Rollbackers96,246 editsm Natural phenol-stub← Previous edit |
Latest revision as of 19:16, 29 May 2020 edit undoFswitzer4 (talk | contribs)Extended confirmed users10,578 editsm Added FDA UNII |
(10 intermediate revisions by 9 users not shown) |
Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
⚫ |
| verifiedrevid = 399503677 |
|
|
|
| Watchedfields = changed |
⚫ |
| ImageFile = Anthrapurpurin.png |
|
|
⚫ |
| verifiedrevid = 423265339 |
⚫ |
| ImageSize = 200px |
|
|
⚫ |
| ImageFile = Anthrapurpurin.png |
⚫ |
| ImageName = Skeletal formula |
|
|
⚫ |
| ImageSize = 200px |
⚫ |
| ImageFile1 = Anthrapurpurin-3D-balls.png |
|
|
⚫ |
| ImageName = Skeletal formula |
⚫ |
| ImageSize1 = 200px |
|
|
⚫ |
| ImageFile1 = Anthrapurpurin-3D-balls.png |
⚫ |
| ImageName1 = Ball-and-stick model |
|
|
⚫ |
| ImageSize1 = 200px |
⚫ |
| IUPACName = 1,2,7-Trihydroxyanthracene-9,10-dione |
|
|
⚫ |
| ImageName1 = Ball-and-stick model |
⚫ |
| OtherNames = 1,2,7-Trihydroxyanthraquinone |
|
|
⚫ |
| PIN = 1,2,7-Trihydroxyanthracene-9,10-dione |
⚫ |
|Section1 = {{Chembox Identifiers |
|
|
⚫ |
| OtherNames = 1,2,7-Trihydroxyanthraquinone |
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
⚫ |
|Section1={{Chembox Identifiers |
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 1280 |
|
| ChemSpiderID = 1280 |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo = 602-65-3 |
|
|
| PubChem = 1320 |
|
| CASNo = 602-65-3 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
⚫ |
| SMILES = C1=CC2=C(C=C1O)C(=O)C3=C(C2=O)C=CC(=C3O)O |
|
|
|
| UNII = 3DZB1V3N5H |
|
|
| PubChem = 1320 |
|
⚫ |
| SMILES = C1=CC2=C(C=C1O)C(=O)C3=C(C2=O)C=CC(=C3O)O |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C14H8O5/c15-6-1-2-7-9(5-6)13(18)11-8(12(7)17)3-4-10(16)14(11)19/h1-5,15-16,19H |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = WNHUAWNEKMITEW-UHFFFAOYSA-N |
|
}} |
|
}} |
|
|Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| C=14 | H=9 | O=5 |
|
| C=14 | H=8 | O=5 |
|
|
| Appearance = |
|
| ExactMass = 256.037173 u |
|
|
| Appearance = |
|
| Density = |
|
| Density = |
|
| MeltingPt = |
|
| MeltingPt = |
|
| BoilingPt = |
|
| BoilingPt = |
|
| Solubility = |
|
| Solubility = |
|
|
}} |
|
}} |
|
|Section3 = {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
| Autoignition = |
|
| AutoignitionPt = |
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Anthrapurpurin''', or 1,2,7-trihdroxyanthraquinone, is a purple dye used in ] for the detection of calcium.<ref></ref> |
|
'''Anthrapurpurin''', or 1,2,7-trihydroxyanthraquinone, is a purple dye used in ] for the detection of calcium.<ref> {{webarchive |url=https://web.archive.org/web/20110714065218/http://www.medicineword.com/anthrapurpurin.shtml |date=July 14, 2011 }}</ref> |
|
|
|
|
|
==See also== |
|
==See also== |
Line 47: |
Line 55: |
|
] |
|
] |
|
|
|
|
|
{{Natural phenol-stub}} |
|
{{aromatic-stub}} |