Revision as of 18:55, 29 March 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (changes to watched fields - updated 'UNII_Ref') per Chem/Drugbox validation (report errors or bugs)← Previous edit | Latest revision as of 22:00, 1 June 2023 edit undoGraeme Bartlett (talk | contribs)Administrators250,258 edits added Category:Lactones using HotCat | ||
(16 intermediate revisions by 15 users not shown) | |||
Line 1: | Line 1: | ||
{{Chembox | {{Chembox | ||
| Verifiedfields = changed | |||
| Watchedfields = changed | | Watchedfields = changed | ||
| verifiedrevid = |
| verifiedrevid = 470632227 | ||
|ImageFile=Wedelolactone.png | | ImageFile = Wedelolactone.png | ||
|ImageSize=200px | | ImageSize = 200px | ||
| |
| PIN = 1,8,9-Trihydroxy-3-methoxy-6''H''-benzofurobenzopyran-6-one | ||
|OtherNames= | | OtherNames = | ||
|Section1= |
|Section1={{Chembox Identifiers | ||
| IUPHAR_ligand = 5551 | |||
| |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ||
| ChemSpiderID = 4445124 | | ChemSpiderID = 4445124 | ||
| KEGG_Ref = {{keggcite|correct|kegg}} | | KEGG_Ref = {{keggcite|correct|kegg}} | ||
| KEGG = C10541 | | KEGG = C10541 | ||
| InChI = 1/C16H10O7/c1-21-6-2-10(19)14-12(3-6)23-16(20)13-7-4-8(17)9(18)5-11(7)22-15(13)14/h2-5,17-19H,1H3 | |||
| InChIKey = XQDCKJKKMFWXGB-UHFFFAOYAT | |||
| ChEMBL_Ref = {{ebicite|correct|EBI}} | | ChEMBL_Ref = {{ebicite|correct|EBI}} | ||
| ChEMBL = 97453 | | ChEMBL = 97453 | ||
| ChEBI_Ref = {{ebicite|changed|EBI}} | |||
| ChEBI = 10037 | |||
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | ||
| StdInChI = 1S/C16H10O7/c1-21-6-2-10(19)14-12(3-6)23-16(20)13-7-4-8(17)9(18)5-11(7)22-15(13)14/h2-5,17-19H,1H3 | | StdInChI = 1S/C16H10O7/c1-21-6-2-10(19)14-12(3-6)23-16(20)13-7-4-8(17)9(18)5-11(7)22-15(13)14/h2-5,17-19H,1H3 | ||
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | ||
| StdInChIKey = XQDCKJKKMFWXGB-UHFFFAOYSA-N | | StdInChIKey = XQDCKJKKMFWXGB-UHFFFAOYSA-N | ||
| CASNo_Ref = {{cascite|correct|CAS}} | |||
| CASNo = 524-12-9 | | CASNo = 524-12-9 | ||
| UNII_Ref = {{fdacite|correct|FDA}} | |||
⚫ | | |
||
| UNII = 0K6L725GNS | |||
⚫ | | |
||
⚫ | | PubChem = 5281813 | ||
⚫ | }} | ||
⚫ | | SMILES = O=C3Oc4cc(OC)cc(O)c4c2oc1c(cc(O)c(O)c1)c23 | ||
|Section2= {{Chembox Properties | |||
| Formula = C<sub>16</sub>H<sub>10</sub>O<sub>7</sub> | |||
| MolarMass= 314.24 g/mol | |||
| ExactMass = 314.042653 u | |||
| Appearance= | |||
⚫ | | |
||
⚫ | | |
||
⚫ | | |
||
⚫ | | |
||
}} | }} | ||
| |
|Section2={{Chembox Properties | ||
| C=16 | H=10 | O=7 | |||
⚫ | | |
||
| |
| Appearance= | ||
⚫ | | Density= | ||
| Autoignition= | |||
⚫ | | MeltingPt= | ||
⚫ | | BoilingPt= | ||
⚫ | | Solubility= | ||
⚫ | }} | ||
|Section3={{Chembox Hazards | |||
⚫ | | MainHazards= | ||
| FlashPt= | |||
| AutoignitionPt = | |||
}} | }} | ||
}} | }} | ||
'''Wedelolactone''' is an organic chemical compound classified as a ] that occurs in '']'' (false daisy) and in '']''<ref> |
'''Wedelolactone''' is an organic chemical compound classified as a ] that occurs in '']'' (false daisy) and in '']''.<ref>{{Cite journal | pmid = 18603418 | doi = 10.1016/j.phymed.2008.05.005| year = 2008| last1 = Prakash| first1 = T.| title = Neuropharmacological studies on Wedelia calendulacea Less stem extract| journal = Phytomedicine| volume = 15| issue = 11| pages = 959–70| last2 = Rao| first2 = N. R.| last3 = Swamy| first3 = A. H.}}</ref> | ||
==References== | ==References== | ||
{{reflist}} | {{reflist}} | ||
] | ] | ||
] | ] | ||
] | |||
] | |||
] | |||
{{ |
{{aromatic-stub}} |
Latest revision as of 22:00, 1 June 2023
Names | |
---|---|
Preferred IUPAC name 1,8,9-Trihydroxy-3-methoxy-6H-benzofurobenzopyran-6-one | |
Identifiers | |
CAS Number | |
3D model (JSmol) | |
ChEBI | |
ChEMBL | |
ChemSpider | |
ECHA InfoCard | 100.164.794 |
IUPHAR/BPS | |
KEGG | |
PubChem CID | |
UNII | |
CompTox Dashboard (EPA) | |
InChI
| |
SMILES
| |
Properties | |
Chemical formula | C16H10O7 |
Molar mass | 314.249 g·mol |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C , 100 kPa). N verify (what is ?) Infobox references |
Wedelolactone is an organic chemical compound classified as a coumestan that occurs in Eclipta alba (false daisy) and in Wedelia calendulacea.
References
- Prakash, T.; Rao, N. R.; Swamy, A. H. (2008). "Neuropharmacological studies on Wedelia calendulacea Less stem extract". Phytomedicine. 15 (11): 959–70. doi:10.1016/j.phymed.2008.05.005. PMID 18603418.
This article about an aromatic compound is a stub. You can help Misplaced Pages by expanding it. |