Revision as of 15:19, 1 April 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (changes to verified fields - updated 'UNII_Ref', 'ChEMBL_Ref', 'KEGG_Ref') per Chem/Drugbox validation (report errors or [[user talk← Previous edit |
Latest revision as of 08:22, 23 December 2022 edit undoCyrej (talk | contribs)Extended confirmed users1,718 editsm →top: commaTags: Mobile edit Mobile app edit Android app edit |
(44 intermediate revisions by 30 users not shown) |
Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
| Verifiedfields = changed |
|
| Verifiedfields = changed |
|
|
| Watchedfields = changed |
|
| verifiedrevid = 399529379 |
|
| verifiedrevid = 441877939 |
|
|ImageFile=Aphidicolin structure.png |
|
| ImageFile=Aphidicolin structure.png |
|
|ImageSize=200px |
|
| ImageSize=200px |
|
|IUPACName= (3''R'',4''R'',4a''R'',6a''S'',8''R'',9''R'',11a''S'',11b''S'')-4,9-bis(hydroxymethyl)-4,11b-dimethyltetradecahydro-8,11a-methanocycloheptanaphthalene-3,9-diol |
|
| IUPACName= (3''R'',4''R'',4a''R'',6a''S'',8''R'',9''R'',11a''S'',11b''S'')-4,9-bis(hydroxymethyl)-4,11b-dimethyltetradecahydro-8,11a-methanocycloheptanaphthalene-3,9-diol |
|
|OtherNames= |
|
| OtherNames= |
|
|Section1={{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 10280269 |
|
| ChemSpiderID = 10280269 |
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEBI = 2766 |
|
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL = 29711 |
|
| ChEMBL = 29711 |
|
| InChI = 1/C20H34O4/c1-17(11-21)15-4-3-13-9-14-10-19(13,7-8-20(14,24)12-22)18(15,2)6-5-16(17)23/h13-16,21-24H,3-12H2,1-2H3/t13-,14+,15-,16+,17-,18-,19-,20-/m0/s1 |
|
| InChI = 1/C20H34O4/c1-17(11-21)15-4-3-13-9-14-10-19(13,7-8-20(14,24)12-22)18(15,2)6-5-16(17)23/h13-16,21-24H,3-12H2,1-2H3/t13-,14+,15-,16+,17-,18-,19-,20-/m0/s1 |
Line 17: |
Line 20: |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = NOFOAYPPHIUXJR-APNQCZIXSA-N |
|
| StdInChIKey = NOFOAYPPHIUXJR-APNQCZIXSA-N |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo=38966-21-1 |
|
| CASNo=38966-21-1 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
⚫ |
| PubChem=457964 |
|
|
|
| UNII = 192TJ6PP19 |
⚫ |
| SMILES = OC4(O)CC31C4C3CC2(C)(CO)(O)CC12C |
|
|
⚫ |
| PubChem=457964 |
|
⚫ |
| SMILES = OC4(O)CC31C4C3CC2(C)(CO)(O)CC12C |
|
}} |
|
}} |
|
|Section2={{Chembox Properties |
|
|Section2={{Chembox Properties |
|
|C=20|H=34|O=4 |
|
| C=20 | H=34 | O=4 |
|
| MolarMass=338.48 g/mol |
|
| MolarMass=338.48 g/mol |
|
| Appearance= |
|
| Appearance= |
|
| Density= |
|
| Density= |
|
| MeltingPt= |
|
| MeltingPt= |
|
| BoilingPt= |
|
| BoilingPt= |
|
| Solubility= |
|
| Solubility= |
|
}} |
|
}} |
|
|Section3={{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Aphidicolin''' is defined as a tetracyclic ] ] with antiviral and antimitotical properties. Aphidicolin is a reversible ] of ] nuclear ] replication. It blocks the cell cycle at early ]. It is a specific inhibitor of ] A,D in eukaryotic cells and in some viruses and an ] inducer in ] cells. |
|
'''Aphidicolin''' is a tetracyclic ] ] isolated from the fungus '']'' with antiviral and antimitotic properties. Aphidicolin is a reversible ] of ] nuclear ] replication. It blocks the cell cycle at early ]. It is a specific inhibitor of ] and ] in eukaryotic cells and in some viruses (]<ref>{{cite journal|last1=DeFilippes|first1=FM|title=Effect of aphidicolin on vaccinia virus: isolation of an aphidicolin-resistant mutant.|journal=Journal of Virology|date=Nov 1984|volume=52|issue=2|pages=474–82|doi=10.1128/JVI.52.2.474-482.1984|pmid=6436508|pmc=254548}}</ref><ref>{{cite journal|last1=Bucknall|first1=R. A.|last2=Moores|first2=H.|last3=Simms|first3=R.|last4=Hesp|first4=B.|title=Antiviral Effects of Aphidicolin, a New Antibiotic Produced by Cephalosporium aphidicola|journal=Antimicrobial Agents and Chemotherapy|date=1 September 1973|volume=4|issue=3|pages=294–298|doi=10.1128/AAC.4.3.294|pmc=444544|pmid=4357181}}</ref> and ]) and an ] inducer in ] cells. Natural aphidicolin is a secondary metabolite of the fungus '']''.<ref> {{webarchive |url=https://web.archive.org/web/20060626051436/http://www.fermentek.co.il/aphidicolin.htm |date=June 26, 2006 }} from ]</ref> |
|
<br>Natural aphidicolin is a secondary metabolite of the fungus '']''<ref> from ]</ref>. |
|
|
|
|
|
|
==References== |
|
== Bibliography == |
|
* {{cite journal |author=Dhillon VS, Husain SA, Ray GN |title=Expression of aphidicolin-induced fragile sites and their relationship between genetic susceptibility in breast cancer, ovarian cancer, and non-small-cell lung cancer patients |journal=Teratog., Carcinog. Mutagen. |volume=Suppl 1 |issue= |pages=35–45 |year=2003 |pmid=12616595 |doi=10.1002/tcm.10068 |url=}} |
|
* {{cite journal |vauthors=Dhillon VS, Husain SA, Ray GN |title=Expression of aphidicolin-induced fragile sites and their relationship between genetic susceptibility in breast cancer, ovarian cancer, and non-small-cell lung cancer patients |journal=Teratogenesis, Carcinogenesis, and Mutagenesis |volume=Suppl 1 |pages=35–45 |year=2003 |pmid=12616595 |doi=10.1002/tcm.10068 }} |
|
|
* {{cite book|last1=Mahy|first1=Brian W J|title=A dictionary of virology|url=https://archive.org/details/dictionaryofviro0000mahy|url-access=registration|date=2001|publisher=Academic Press|location=San Diego, Calif. |isbn=978-0-12-465327-6|page=|edition=3.}} |
|
|
|
|
|
|
== References == |
|
<references/> |
|
|
|
{{reflist|2}} |
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
|
|
|
|
|
|
|
{{organic-compound-stub}} |
|
{{organic-compound-stub}} |
|
|
|
|
] |
|
|
] |
|
|
] |
|