Revision as of 03:49, 19 April 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEMBL_Ref', 'KEGG_Ref') per Chem/Drugbox validation (← Previous edit |
Latest revision as of 15:56, 7 September 2024 edit undoJWBE (talk | contribs)Extended confirmed users10,127 edits removed Category:Iodobenzene derivatives; added Category:4-Iodophenyl compounds using HotCat |
(20 intermediate revisions by 17 users not shown) |
Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
|
|
| Watchedfields = changed |
|
| verifiedrevid = 400753856 |
|
| verifiedrevid = 400753856 |
|
|ImageFile=Iodophenpropit.png |
|
| ImageFile = Iodophenpropit.svg |
|
|ImageSize=220px |
|
| ImageSize = 240 |
|
|IUPACName=3-(1''H''-imidazol-5-yl)propyl ''N'''-imidothiocarbamate |
|
| IUPACName = 3-(1''H''-imidazol-5-yl)propyl ''N'''-imidothiocarbamate |
|
|OtherNames=1--N'-formamidine |
|
| OtherNames = 1--''N'''-formamidine |
|
|
|
|
|Section1={{Chembox Identifiers |
|
| Section1 = {{Chembox Identifiers |
⚫ |
| CASNo=143407-29-8 |
|
|
|
| CASNo_Ref = {{cascite|correct|??}} |
⚫ |
| PubChem=3035746 |
|
|
⚫ |
| CASNo=145196-88-9 |
⚫ |
| SMILES=C1=CC(=CC=C1CCN=C(N)SCCCC2=CN=CN2)I |
|
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
⚫ |
| MeSHName=Iodophenpropit |
|
|
|
| UNII = 3SH45L9H3Z |
|
⚫ |
| PubChem=3035746 |
|
|
| ChemSpiderID=2299913 |
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEMBL = 498770 |
|
⚫ |
| SMILES=C1=CC(=CC=C1CCN=C(N)SCCCC2=CN=CN2)I |
|
⚫ |
| MeSHName=Iodophenpropit |
|
}} |
|
}} |
|
|
|
|
|Section2={{Chembox Properties |
|
| Section2 = {{Chembox Properties |
|
| Formula=C<sub>15</sub>H<sub>19</sub>IN<sub>4</sub>S |
|
| Formula = C<sub>15</sub>H<sub>19</sub>IN<sub>4</sub>S |
|
| MolarMass=414.30763 |
|
| MolarMass = 414.30763 g/mol |
|
| Appearance= |
|
|
|
| Appearance = |
|
| Density= |
|
|
|
| Density = |
|
| MeltingPt= |
|
|
|
| MeltingPt = |
|
| BoilingPt= |
|
|
|
| BoilingPt = |
|
| Solubility= |
|
|
|
| Solubility = |
|
}} |
|
}} |
|
|
|
|
|Section3={{Chembox Hazards |
|
| Section3 = {{Chembox Hazards |
|
| MainHazards= |
|
|
|
| MainHazards = |
|
| FlashPt= |
|
|
|
| FlashPt = |
|
| Autoignition= |
|
|
|
| AutoignitionPt = |
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
'''Iodophenpropit''' is a ] which binds selectively to the ] subtype. Its <sup>125</sup>I ] form is used for mapping the distribution of H<sub>3</sub> receptors in the body.<ref>{{cite journal | last1 = Jansen | first1 = FP | last2 = Wu | first2 = TS | last3 = Voss | first3 = HP | last4 = Steinbusch | first4 = HW | last5 = Vollinga | first5 = RC | last6 = Rademaker | first6 = B | last7 = Bast | first7 = A | last8 = Timmerman | first8 = H | title = Characterization of the binding of the first selective radiolabelled histamine H3-receptor antagonist, 125I-iodophenpropit, to rat brain | journal = British journal of pharmacology | volume = 113 | issue = 2 | pages = 355–62 | year = 1994 | pmid = 7834183 | pmc = 1510107 }}</ref><ref>{{cite journal | last1 = Jansen | first1 = FP | last2 = Mochizuki | first2 = T | last3 = Maeyama | first3 = K | last4 = Leurs | first4 = R | last5 = Timmerman | first5 = H | title = Characterization of histamine H3 receptors in mouse brain using the H3 antagonist 125Iiodophenpropit | journal = Naunyn-Schmiedeberg's archives of pharmacology | volume = 362 | issue = 1 | pages = 60–7 | year = 2000 | pmid = 10935534 }}</ref> |
|
'''Iodophenpropit''' is a ] which binds selectively to the ]. Its <sup>125</sup>I ] form has been used for mapping the distribution of H<sub>3</sub> receptors in animal studies.<ref>{{cite journal | last1 = Jansen | first1 = FP | last2 = Wu | first2 = TS | last3 = Voss | first3 = HP | last4 = Steinbusch | first4 = HW | last5 = Vollinga | first5 = RC | last6 = Rademaker | first6 = B | last7 = Bast | first7 = A | last8 = Timmerman | first8 = H | title = Characterization of the binding of the first selective radiolabelled histamine H3-receptor antagonist, 125I-iodophenpropit, to rat brain | journal = ] | volume = 113 | issue = 2 | pages = 355–62 | year = 1994 | pmid = 7834183 | pmc = 1510107 | doi=10.1111/j.1476-5381.1994.tb16995.x}}</ref><ref>{{cite journal | last1 = Jansen | first1 = FP | last2 = Mochizuki | first2 = T | last3 = Maeyama | first3 = K | last4 = Leurs | first4 = R | last5 = Timmerman | first5 = H | title = Characterization of histamine H3 receptors in mouse brain using the H3 antagonist 125Iiodophenpropit | journal = Naunyn-Schmiedeberg's Archives of Pharmacology | volume = 362 | issue = 1 | pages = 60–7 | year = 2000 | pmid = 10935534 | doi = 10.1007/s002100000227 | s2cid = 21293180 }}</ref> |
|
|
|
|
|
==References== |
|
==References== |
Line 35: |
Line 47: |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
|
|
|
|
|
|
{{pharm-stub}} |
|
{{pharm-stub}} |