Revision as of 08:58, 2 July 2011 editZéroBot (talk | contribs)704,777 editsm r2.7.1) (robot Adding: fr:N'-formylkynurénine← Previous edit |
Latest revision as of 20:42, 24 December 2024 edit undoCitation bot (talk | contribs)Bots5,428,609 edits Added bibcode. | Use this bot. Report bugs. | Suggested by Graeme Bartlett | #UCB_toolbar |
(27 intermediate revisions by 19 users not shown) |
Line 1: |
Line 1: |
|
{{DISPLAYTITLE:''N'''-Formylkynurenine}} |
|
{{DISPLAYTITLE:''N'''-Formylkynurenine}} |
|
{{chembox |
|
{{chembox |
|
|
| Watchedfields = changed |
|
| verifiedrevid = 392264679 |
|
| verifiedrevid = 437363582 |
|
|Name=''N′''-Formylkynurenine |
|
| Name=''{{prime|N}}''-Formylkynurenine |
⚫ |
|ImageFile=N-formylkynurenine.svg |
|
|
|
| ImageFile=N-formyl-L-kynurenine.svg |
|
|ImageSize= |
|
| ImageSize= |
|
|IUPACName= |
|
|
|
| SystematicName=(2''S'')-2-Amino-4-(2-formamidophenyl)-4-oxobutanoic acid |
|
|OtherNames= |
|
|
|
| OtherNames=''{{prime|N}}''-Formyl-<small>L</small>-kynurenine |
|
|Section1= {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
⚫ |
| CASNo=1022-31-7 |
|
|
|
| CASNo_Ref = {{cascite|correct|??}} |
⚫ |
| PubChem=910 |
|
|
⚫ |
| CASNo=3978-11-8 |
|
| SMILES= |
|
|
|
| ChEBI = 30249 |
|
| MeSHName=N'-formylkynurenine |
|
|
|
| ChEMBL = 3577708 |
|
|
| ChemSpiderID = 388843 |
|
|
| KEGG = C02700 |
|
⚫ |
| PubChem=439788 |
|
|
| UNII=PS20W0733S |
|
|
| StdInChI=1S/C11H12N2O4/c12-8(11(16)17)5-10(15)7-3-1-2-4-9(7)13-6-14/h1-4,6,8H,5,12H2,(H,13,14)(H,16,17)/t8-/m0/s1 |
|
|
| StdInChIKey = BYHJHXPTQMMKCA-QMMMGPOBSA-N |
|
|
| SMILES=C1=CC=C(C(=C1)C(=O)C(C(=O)O)N)NC=O |
|
⚫ |
| MeSHName=N'-formylkynurenine |
|
}} |
|
}} |
|
|Section2= {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
|
| C=11 | H=12| N=2| O=4 |
|
| Formula=C<sub>11</sub>H<sub>12</sub>N<sub>2</sub>O<sub>4</sub> |
|
|
|
| Appearance= |
|
| MolarMass=236.224 g/mol |
|
|
| Appearance= |
|
| Density= |
|
| Density= |
|
| MeltingPt= |
|
| MeltingPt= |
|
| BoilingPtC= |
|
| BoilingPt= |
|
| Solubility= |
|
| Solubility= |
|
|
}} |
|
}} |
|
|Section3= {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
|
'''''{{prime|N}}''-Formylkynurenine''' is an intermediate in the ] of ]. It is a ] derivative of ]. The formation of ''{{prime|N}}''-formylkynurenine is catalyzed by ].<ref>{{Cite journal | doi = 10.1021/ja207066z | pmid = 21892828 | title = The Mechanism of Formation of ''N''-Formylkynurenine by Heme Dioxygenases | journal = Journal of the American Chemical Society | volume = 133 | issue = 40 | pages = 16251–16257 | year = 2011 | last1 = Basran | first1 = Jaswir | last2 = Efimov | first2 = Igor | last3 = Chauhan | first3 = Nishma | last4 = Thackray | first4 = Sarah J | last5 = Krupa | first5 = James L | last6 = Eaton | first6 = Graham | last7 = Griffith | first7 = Gerry A | last8 = Mowat | first8 = Christopher G | last9 = Handa | first9 = Sandeep | last10 = Raven | first10 = Emma Lloyd | pmc = 3210546| bibcode = 2011JAChS.13316251B }}</ref> |
|
'''''N′''-Formylkynurenine''' is an intermediate in the ] of ]. It is a ] derivative of ]. |
|
|
|
|
|
|
==See also== |
|
==See also== |
|
* ] |
|
* ] |
|
|
|
|
* ] |
|
|
|
==References== |
|
|
{{Reflist}} |
|
|
|
|
|
{{Amino acid metabolism intermediates}} |
|
{{Amino acid metabolism intermediates}} |
|
|
|
|
|
{{DEFAULTSORT:Formylkynurenine, N'-}} |
|
{{DEFAULTSORT:Formylkynurenine, N'-}} |
|
] |
|
] |
|
|
] |
|
|
|
|
|
|
|
|
{{biochem-stub}} |
|
{{biochem-stub}} |
|
|
|
|
] |
|
|
] |
|
|
] |
|