Revision as of 11:46, 11 August 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'ChemSpiderID_Ref', 'DrugBank_Ref', 'UNII_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'KEGG_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEBI_Ref') per [[Misplaced Pages:WikiProject Chemicals/Chem← Previous edit | Latest revision as of 16:50, 19 June 2024 edit undoCitation bot (talk | contribs)Bots5,427,484 edits Altered pmc. Add: authors 1-1. Removed parameters. Some additions/deletions were parameter name changes. | Use this bot. Report bugs. | Suggested by Headbomb (alt) | Category:CS1 maint: PMC format | #UCB_Category 4/9 | ||
(39 intermediate revisions by 27 users not shown) | |||
Line 1: | Line 1: | ||
{{Chembox | {{Chembox | ||
| Verifiedfields = changed | |||
| verifiedrevid = |
| verifiedrevid = 444248572 | ||
| ImageFile = Y-27632.svg | | ImageFile = Y-27632.svg | ||
| |
| ImageSize = 200px | ||
| |
| ImageAlt = | ||
| IUPACName = ( |
| IUPACName = (1''R'',4''r'')-4-((''R'')-1-Aminoethyl)-''N''-(pyridin-4-yl)cyclohexanecarboxamide | ||
| OtherNames = | | OtherNames = | ||
| |
|Section1={{Chembox Identifiers | ||
| IUPHAR_ligand = 5290 | |||
| CASNo = 146986-50-7 | |||
| CASNo_Ref = {{cascite|correct|CAS}} | | CASNo = 146986-50-7 | ||
| CASNo_Ref = {{cascite|correct|CAS}} | |||
| UNII_Ref = {{fdacite|correct|FDA}} | |||
⚫ | | |
||
| UNII = 0X370ROP6H | |||
⚫ | | |
||
⚫ | | PubChem = 448042 | ||
| ChEBI_Ref = {{ebicite|changed|EBI}} | |||
| ChEBI = 75393 | |||
| ChEMBL_Ref = {{ebicite|changed|EBI}} | |||
| ChEMBL = 2218937 | |||
⚫ | | DrugBank_Ref = {{drugbankcite|correct|drugbank}} | ||
| DrugBank = DB08756 | | DrugBank = DB08756 | ||
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | ||
| StdInChIKey = IYOZTVGMEWJPKR-IJLUTSLNSA-N | | StdInChIKey = IYOZTVGMEWJPKR-IJLUTSLNSA-N | ||
| SMILES = O=C(1CC((N)C)()CC1)NC2=CC=NC=C2 | | SMILES = O=C(1CC((N)C)()CC1)NC2=CC=NC=C2 | ||
| |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ||
| ChemSpiderID = 20016532 | | ChemSpiderID = 20016532 | ||
| |
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | ||
| StdInChI=1S/C14H21N3O/c1-10(15)11-2-4-12(5-3-11)14(18)17-13-6-8-16-9-7-13/h6-12H,2-5,15H2,1H3,(H,16,17,18)/t10-,11-,12-/m1/s1 | | StdInChI=1S/C14H21N3O/c1-10(15)11-2-4-12(5-3-11)14(18)17-13-6-8-16-9-7-13/h6-12H,2-5,15H2,1H3,(H,16,17,18)/t10-,11-,12-/m1/s1 | ||
| InChI = 1/C14H21N3O/c1-10(15)11-2-4-12(5-3-11)14(18)17-13-6-8-16-9-7-13/h6-12H,2-5,15H2,1H3,(H,16,17,18)/t10-,11-,12-/m1/s1 | | InChI = 1/C14H21N3O/c1-10(15)11-2-4-12(5-3-11)14(18)17-13-6-8-16-9-7-13/h6-12H,2-5,15H2,1H3,(H,16,17,18)/t10-,11-,12-/m1/s1 | ||
| InChIKey = IYOZTVGMEWJPKR-IJLUTSLNBP | | InChIKey = IYOZTVGMEWJPKR-IJLUTSLNBP | ||
}} | }} | ||
| |
|Section2={{Chembox Properties | ||
| |
| C=14 | H=21 | N=3 | O=1 | ||
| |
| Appearance = | ||
| |
| Density = | ||
| |
| MeltingPt = | ||
| |
| BoilingPt = | ||
| |
| Solubility = }} | ||
| |
|Section3={{Chembox Hazards | ||
| |
| MainHazards = | ||
| |
| FlashPt = | ||
| |
| AutoignitionPt = }} | ||
}} | }} | ||
'''Y-27632''' is a biochemical tool used in the study of the ] (ROCK) signaling pathways.<ref>{{cite journal | author = Uehata, Masayoshi | title = Y-27632. Selective probe of ROCK/Rho-kinase | journal = Jikken Igaku | year = 1999 | volume = 17 | issue = 7 | pages = 850–855}}</ref> Y-27632 selectively inhibits p160ROCK.<ref>{{cite journal | pmid = 9353125 | year = 1997 | last1 = Uehata | first1 = M | last2 = Ishizaki | first2 = T | last3 = Satoh | first3 = H | last4 = Ono | first4 = T | last5 = Kawahara | first5 = T | last6 = Morishita | first6 = T | last7 = Tamakawa | first7 = H | last8 = Yamagami | first8 = K | last9 = Inui | first9 = J | title = Calcium sensitization of smooth muscle mediated by a Rho-associated protein kinase in hypertension | volume = 389 | issue = 6654 | pages = 990–4 | doi = 10.1038/40187 | journal = Nature}}</ref> | '''Y-27632''' is a biochemical tool used in the study of the ] (ROCK) signaling pathways.<ref>{{cite journal | author = Uehata, Masayoshi | title = Y-27632. Selective probe of ROCK/Rho-kinase | journal = Jikken Igaku | year = 1999 | volume = 17 | issue = 7 | pages = 850–855}}</ref> Y-27632 selectively inhibits ], although it does inhibit other protein kinases such as ] at higher concentrations.<ref>{{cite journal | pmid = 9353125 | year = 1997 | last1 = Uehata | first1 = M | last2 = Ishizaki | first2 = T | last3 = Satoh | first3 = H | last4 = Ono | first4 = T | last5 = Kawahara | first5 = T | last6 = Morishita | first6 = T | last7 = Tamakawa | first7 = H | last8 = Yamagami | first8 = K | last9 = Inui | first9 = J | last10 = Inui | first10 = Jun | last11 = Maekawa | first11 = Midori | title = Calcium sensitization of smooth muscle mediated by a Rho-associated protein kinase in hypertension | volume = 389 | issue = 6654 | pages = 990–4 | doi = 10.1038/40187 | journal = Nature| bibcode = 1997Natur.389..990U | s2cid = 4419556 | display-authors = 8 }}</ref> | ||
It has been studied for its effects on corneal ]s (CECs) <ref>{{Cite journal|last1=Peh|first1=Gary S. L.|last2=Adnan|first2=Khadijah|last3=George|first3=Benjamin L.|last4=Ang|first4=Heng-Pei|last5=Seah|first5=Xin-Yi|last6=Tan|first6=Donald T.|last7=Mehta|first7=Jodhbir S.|date=2015-03-16|title=The effects of Rho-associated kinase inhibitor Y-27632 on primary human corneal endothelial cells propagated using a dual media approach|journal=Scientific Reports|volume=5|page=9167|doi=10.1038/srep09167|issn=2045-2322|pmc=4387913|pmid=25823914|bibcode=2015NatSR...5E9167P}}</ref> and cardiac ]s (CSCs).<ref>{{Cite journal|last1=Kan|first1=Lijuan|last2=Smith|first2=Aubrie|last3=Chen|first3=Miao|last4=Ledford|first4=Benjamin T.|last5=Fan|first5=Huimin|last6=Liu|first6=Zhongmin|last7=He|first7=Jia-Qiang|date=2015-12-08|title=Rho-Associated Kinase Inhibitor (Y-27632) Attenuates Doxorubicin-Induced Apoptosis of Human Cardiac Stem Cells|journal=PLOS ONE|volume=10|issue=12|pages=e0144513|doi=10.1371/journal.pone.0144513|issn=1932-6203|pmc=4672899|pmid=26645568|bibcode=2015PLoSO..1044513K|doi-access=free}}</ref> | |||
⚫ | ==References== | ||
⚫ | {{reflist}} | ||
The substance has been used as part of a chemical cocktail to turn old and ] human cells back into young ones (as measured by transcriptomic age), without turning them all the way back into undifferentiated ].<ref>{{Cite journal |last1=Yang |first1=Jae-Hyun |last2=Petty |first2=Christopher A. |last3=Dixon-McDougall |first3=Thomas |last4=Lopez |first4=Maria Vina |last5=Tyshkovskiy |first5=Alexander |last6=Maybury-Lewis |first6=Sun |last7=Tian |first7=Xiao |last8=Ibrahim |first8=Nabilah |last9=Chen |first9=Zhili |last10=Griffin |first10=Patrick T. |last11=Arnold |first11=Matthew |last12=Li |first12=Jien |last13=Martinez |first13=Oswaldo A. |last14=Behn |first14=Alexander |last15=Rogers-Hammond |first15=Ryan |date=2023-07-12 |title=Chemically induced reprogramming to reverse cellular aging |url=https://www.aging-us.com/article/204896/text |journal=Aging |language=en |volume=15 |issue=13 |pages=5966–5989 |doi=10.18632/aging.204896 |issn=1945-4589 |pmc=10373966 |pmid=37437248}}</ref> | |||
A mixture of ] (1%), ] (10%), ] (10%), and Y-27632 (10 μM), termed MEDY, has been shown to be an effective ] reagent for brain tissue, enabling tissue to resume growth and function after freezing using liquid nitrogen.<ref>{{Cite journal | doi=10.1016/j.crmeth.2024.100777 | title=Effective cryopreservation of human brain tissue and neural organoids | date=2024 | last1=Xue | first1=Weiwei | last2=Li | first2=Huijuan | last3=Xu | first3=Jinhong | last4=Yu | first4=Xiao | last5=Liu | first5=Linlin | last6=Liu | first6=Huihui | last7=Zhao | first7=Rui | last8=Shao | first8=Zhicheng | journal=Cell Reports Methods | volume=4 | issue=5 | pmid=38744289 | doi-access=free | pmc=11133841 }}</ref> | |||
{{organic-compound-stub}} | |||
⚫ | ==References== | ||
⚫ | {{reflist}} | ||
] | ] | ||
] | ] |
Latest revision as of 16:50, 19 June 2024
Names | |
---|---|
IUPAC name (1R,4r)-4-((R)-1-Aminoethyl)-N-(pyridin-4-yl)cyclohexanecarboxamide | |
Identifiers | |
CAS Number | |
3D model (JSmol) | |
ChEBI | |
ChEMBL | |
ChemSpider | |
DrugBank | |
ECHA InfoCard | 100.149.247 |
IUPHAR/BPS | |
PubChem CID | |
UNII | |
CompTox Dashboard (EPA) | |
InChI
| |
SMILES
| |
Properties | |
Chemical formula | C14H21N3O |
Molar mass | 247.342 g·mol |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C , 100 kPa). N verify (what is ?) Infobox references |
Y-27632 is a biochemical tool used in the study of the rho-associated protein kinase (ROCK) signaling pathways. Y-27632 selectively inhibits p160ROCK, although it does inhibit other protein kinases such as PKCs at higher concentrations.
It has been studied for its effects on corneal endothelial cells (CECs) and cardiac stem cells (CSCs).
The substance has been used as part of a chemical cocktail to turn old and senescent human cells back into young ones (as measured by transcriptomic age), without turning them all the way back into undifferentiated stem cells.
A mixture of methylcellulose (1%), ethylene glycol (10%), dimethyl sulfoxide (10%), and Y-27632 (10 μM), termed MEDY, has been shown to be an effective cryopreservation reagent for brain tissue, enabling tissue to resume growth and function after freezing using liquid nitrogen.
References
- Uehata, Masayoshi (1999). "Y-27632. Selective probe of ROCK/Rho-kinase". Jikken Igaku. 17 (7): 850–855.
- Uehata, M; Ishizaki, T; Satoh, H; Ono, T; Kawahara, T; Morishita, T; Tamakawa, H; Yamagami, K; et al. (1997). "Calcium sensitization of smooth muscle mediated by a Rho-associated protein kinase in hypertension". Nature. 389 (6654): 990–4. Bibcode:1997Natur.389..990U. doi:10.1038/40187. PMID 9353125. S2CID 4419556.
- Peh, Gary S. L.; Adnan, Khadijah; George, Benjamin L.; Ang, Heng-Pei; Seah, Xin-Yi; Tan, Donald T.; Mehta, Jodhbir S. (2015-03-16). "The effects of Rho-associated kinase inhibitor Y-27632 on primary human corneal endothelial cells propagated using a dual media approach". Scientific Reports. 5: 9167. Bibcode:2015NatSR...5E9167P. doi:10.1038/srep09167. ISSN 2045-2322. PMC 4387913. PMID 25823914.
- Kan, Lijuan; Smith, Aubrie; Chen, Miao; Ledford, Benjamin T.; Fan, Huimin; Liu, Zhongmin; He, Jia-Qiang (2015-12-08). "Rho-Associated Kinase Inhibitor (Y-27632) Attenuates Doxorubicin-Induced Apoptosis of Human Cardiac Stem Cells". PLOS ONE. 10 (12): e0144513. Bibcode:2015PLoSO..1044513K. doi:10.1371/journal.pone.0144513. ISSN 1932-6203. PMC 4672899. PMID 26645568.
- Yang, Jae-Hyun; Petty, Christopher A.; Dixon-McDougall, Thomas; Lopez, Maria Vina; Tyshkovskiy, Alexander; Maybury-Lewis, Sun; Tian, Xiao; Ibrahim, Nabilah; Chen, Zhili; Griffin, Patrick T.; Arnold, Matthew; Li, Jien; Martinez, Oswaldo A.; Behn, Alexander; Rogers-Hammond, Ryan (2023-07-12). "Chemically induced reprogramming to reverse cellular aging". Aging. 15 (13): 5966–5989. doi:10.18632/aging.204896. ISSN 1945-4589. PMC 10373966. PMID 37437248.
- Xue, Weiwei; Li, Huijuan; Xu, Jinhong; Yu, Xiao; Liu, Linlin; Liu, Huihui; Zhao, Rui; Shao, Zhicheng (2024). "Effective cryopreservation of human brain tissue and neural organoids". Cell Reports Methods. 4 (5). doi:10.1016/j.crmeth.2024.100777. PMC 11133841. PMID 38744289.