Revision as of 04:56, 2 September 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{drugbox}} (changes to watched fields - added verified revid - updated 'ChemSpiderID_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEBI_Ref') per Chem/Drugbox validation (report [[Misplaced Pages talk:Wiki← Previous edit | Latest revision as of 22:13, 10 January 2025 edit undoArthurfragoso (talk | contribs)Extended confirmed users, Template editors4,591 edits dark mode fix | ||
(13 intermediate revisions by 11 users not shown) | |||
Line 1: | Line 1: | ||
{{Short description|Chemical compound}} | |||
{{Drugbox | {{Drugbox | ||
| Verifiedfields = changed | |||
| Watchedfields = changed | | Watchedfields = changed | ||
| verifiedrevid = |
| verifiedrevid = 447986412 | ||
| IUPAC_name = acetic acid | | IUPAC_name = acetic acid | ||
| image = lonazolac.png | | image = lonazolac.png | ||
| image_class = skin-invert-image | |||
<!--Clinical data--> | <!--Clinical data--> | ||
Line 25: | Line 28: | ||
<!--Identifiers--> | <!--Identifiers--> | ||
| CAS_number_Ref = {{cascite|correct|CAS}} | |||
| CAS_number = |
| CAS_number = 53808-88-1 | ||
| ATC_prefix = M01 | | ATC_prefix = M01 | ||
| ATC_suffix = AB09 | | ATC_suffix = AB09 | ||
Line 35: | Line 39: | ||
| KEGG_Ref = {{keggcite|correct|kegg}} | | KEGG_Ref = {{keggcite|correct|kegg}} | ||
| KEGG = D07265 | | KEGG = D07265 | ||
| ChEBI_Ref = {{ebicite|changed|EBI}} | |||
| ChEBI = 76164 | |||
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} | |||
| ChemSpiderID = 61957 | |||
<!--Chemical data--> | <!--Chemical data--> | ||
| C=17 | H=13 | Cl=1 | N=2 | O=2 | | C=17 | H=13 | Cl=1 | N=2 | O=2 | ||
| smiles = c1ccc(cc1)n2cc(c(n2)c3ccc(cc3)Cl)CC(=O)O | |||
| molecular_weight = 312.75032 g/mol | |||
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} | |||
| StdInChI = 1S/C17H13ClN2O2/c18-14-8-6-12(7-9-14)17-13(10-16(21)22)11-20(19-17)15-4-2-1-3-5-15/h1-9,11H,10H2,(H,21,22) | |||
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} | |||
| StdInChIKey = XVUQHFRQHBLHQD-UHFFFAOYSA-N | |||
}} | }} | ||
'''Lonazolac''' is a ]. | '''Lonazolac''' is a ] (NSAID). | ||
==References== | |||
{{Reflist|2}} | |||
{{Anti-inflammatory and antirheumatic products}} | {{Anti-inflammatory and antirheumatic products}} | ||
{{Prostanoidergics}} | |||
{{NSAIDs}} | |||
] | ] | ||
] | ] | ||
] | ] | ||
Latest revision as of 22:13, 10 January 2025
Chemical compound Pharmaceutical compoundClinical data | |
---|---|
ATC code | |
Identifiers | |
IUPAC name
| |
CAS Number | |
PubChem CID | |
ChemSpider | |
UNII | |
KEGG | |
ChEBI | |
CompTox Dashboard (EPA) | |
ECHA InfoCard | 100.053.428 |
Chemical and physical data | |
Formula | C17H13ClN2O2 |
Molar mass | 312.75 g·mol |
3D model (JSmol) | |
SMILES
| |
InChI
| |
(what is this?) (verify) |
Lonazolac is a nonsteroidal anti-inflammatory drug (NSAID).
References
Non-steroidal anti-inflammatory drugs (NSAIDs) (primarily M01A and M02A, also N02BA) | |
---|---|
pyrazolones / pyrazolidines | |
salicylates | |
acetic acid derivatives and related substances | |
oxicams | |
propionic acid derivatives (profens) |
|
n-arylanthranilic acids (fenamates) | |
COX-2 inhibitors (coxibs) | |
other | |
NSAID combinations | |
Key: underline indicates initially developed first-in-class compound of specific group; WHO-Essential Medicines; withdrawn drugs; veterinary use. | |
This drug article relating to the musculoskeletal system is a stub. You can help Misplaced Pages by expanding it. |