| Revision as of 11:47, 3 September 2011 editBogBot (talk | contribs)Bots53,132 edits populated new fields in {{drugbox}} and reordered per bot approval. Report errors and suggestions to User_talk:BogBot← Previous edit | Latest revision as of 23:14, 29 January 2023 edit undoEntranced98 (talk | contribs)Extended confirmed users, Pending changes reviewers, Rollbackers174,387 edits Importing Wikidata short description: "Chemical compound"Tag: Shortdesc helper | ||
| (19 intermediate revisions by 16 users not shown) | |||
| Line 1: | Line 1: | ||
| {{Short description|Chemical compound}} | |||
| {{unreferenced|date=June 2011}} | |||
| {{Drugbox | {{Drugbox | ||
| | Verifiedfields = changed | |||
| ⚫ | | verifiedrevid = |
||
| | Watchedfields = changed | |||
| ⚫ | | verifiedrevid = 444222259 | ||
| | IUPAC_name = 6--3,3-dimethyl-7-oxo-4-thia-1-azabicycloheptane-2-carboxylic acid | | IUPAC_name = 6--3,3-dimethyl-7-oxo-4-thia-1-azabicycloheptane-2-carboxylic acid | ||
| | image = Azidocillin. |
| image = Azidocillin.svg | ||
| <!--Clinical data--> | <!--Clinical data--> | ||
| Line 15: | Line 17: | ||
| | legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> | | legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> | ||
| | legal_status = | | legal_status = | ||
| | routes_of_administration = | | routes_of_administration = Oral, ], ] | ||
| <!--Pharmacokinetic data--> | <!--Pharmacokinetic data--> | ||
| | bioavailability = |
| bioavailability = 57–64% | ||
| | protein_bound = |
| protein_bound = | ||
| | metabolism = |
| metabolism = | ||
| | elimination_half-life = | | elimination_half-life = 0.6-1.1 hrs | ||
| | excretion = | | excretion = 37–50% active substance in urine | ||
| <!--Identifiers--> | <!--Identifiers--> | ||
| | CAS_number_Ref = {{cascite|correct|??}} | |||
| | CAS_number = 17243-38-8 | | CAS_number = 17243-38-8 | ||
| | ATC_prefix = J01 | | ATC_prefix = J01 | ||
| Line 31: | Line 34: | ||
| | DrugBank_Ref = {{drugbankcite|correct|drugbank}} | | DrugBank_Ref = {{drugbankcite|correct|drugbank}} | ||
| | DrugBank = DB08795 | | DrugBank = DB08795 | ||
| | ChEMBL_Ref = {{ebicite|changed|EBI}} | |||
| | ChEMBL = 2105907 | |||
| | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ||
| | ChemSpiderID = 16735689 | | ChemSpiderID = 16735689 | ||
| Line 41: | Line 46: | ||
| <!--Chemical data--> | <!--Chemical data--> | ||
| | C=16 | H=17 | N=5 | O=4 | S=1 |
| C=16 | H=17 | N=5 | O=4 | S=1 | ||
| | molecular_weight = 375.40228 | |||
| | smiles = O=C(O)2N3C(=O)(NC(=O)(\N==)c1ccccc1)3SC2(C)C | | smiles = O=C(O)2N3C(=O)(NC(=O)(\N==)c1ccccc1)3SC2(C)C | ||
| | InChI = 1/C16H17N5O4S/c1-16(2)11(15(24)25)21-13(23)10(14(21)26-16)18-12(22)9(19-20-17)8-6-4-3-5-7-8/h3-7,9-11,14H,1-2H3,(H,18,22)(H,24,25)/t9-,10-,11+,14-/m1/s1 | |||
| | InChIKey = ODFHGIPNGIAMDK-NJBDSQKTBL | |||
| | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | ||
| | StdInChI = 1S/C16H17N5O4S/c1-16(2)11(15(24)25)21-13(23)10(14(21)26-16)18-12(22)9(19-20-17)8-6-4-3-5-7-8/h3-7,9-11,14H,1-2H3,(H,18,22)(H,24,25)/t9-,10-,11+,14-/m1/s1 | | StdInChI = 1S/C16H17N5O4S/c1-16(2)11(15(24)25)21-13(23)10(14(21)26-16)18-12(22)9(19-20-17)8-6-4-3-5-7-8/h3-7,9-11,14H,1-2H3,(H,18,22)(H,24,25)/t9-,10-,11+,14-/m1/s1 | ||
| Line 51: | Line 53: | ||
| | StdInChIKey = ODFHGIPNGIAMDK-NJBDSQKTSA-N | | StdInChIKey = ODFHGIPNGIAMDK-NJBDSQKTSA-N | ||
| }} | }} | ||
| '''Azidocillin''' is a type of ].<ref>{{cite journal | vauthors = Axelsson A, Jensen C, Melin O, Singer F, von Sydow C | title = Treatment of acute maxillary sinusitis. V. Amoxicillin azidocillin, phenylpropanolamine and pivampicillin | journal = Acta Oto-Laryngologica | volume = 91 | issue = 3–4 | pages = 313–8 | year = 1981 | pmid = 6894819 | doi = 10.3109/00016488109138513 }}</ref><ref>{{cite journal | vauthors = Bergan T, Sørensen G | title = Pharmacokinetics of azidocillin in healthy adults | journal = Arzneimittel-Forschung | volume = 30 | issue = 12 | pages = 2185–91 | year = 1980 | pmid = 6894241 }}</ref> | |||
| '''Azidocillin''' is a type of ]. | |||
| == References == | |||
| {{reflist}} | |||
| {{Cell wall disruptive antibiotics}} | {{Cell wall disruptive antibiotics}} | ||
| ⚫ | ] | ||
| ] | |||
| {{antibiotic-stub}} | |||
| ] | |||
| ⚫ | ] | ||
Latest revision as of 23:14, 29 January 2023
Chemical compound Pharmaceutical compound | |
| Clinical data | |
|---|---|
| Routes of administration | Oral, IV, IM |
| ATC code | |
| Pharmacokinetic data | |
| Bioavailability | 57–64% |
| Elimination half-life | 0.6-1.1 hrs |
| Excretion | 37–50% active substance in urine |
| Identifiers | |
IUPAC name
| |
| CAS Number | |
| PubChem CID | |
| DrugBank | |
| ChemSpider | |
| UNII | |
| KEGG | |
| ChEBI | |
| ChEMBL | |
| CompTox Dashboard (EPA) | |
| ECHA InfoCard | 100.037.510  |
| Chemical and physical data | |
| Formula | C16H17N5O4S |
| Molar mass | 375.40 g·mol |
| 3D model (JSmol) | |
SMILES
| |
InChI
| |
| (what is this?) (verify) | |
Azidocillin is a type of penicillin.
References
- Axelsson A, Jensen C, Melin O, Singer F, von Sydow C (1981). "Treatment of acute maxillary sinusitis. V. Amoxicillin azidocillin, phenylpropanolamine and pivampicillin". Acta Oto-Laryngologica. 91 (3–4): 313–8. doi:10.3109/00016488109138513. PMID 6894819.
- Bergan T, Sørensen G (1980). "Pharmacokinetics of azidocillin in healthy adults". Arzneimittel-Forschung. 30 (12): 2185–91. PMID 6894241.