Revision as of 12:17, 21 October 2011 editCitation bot 1 (talk | contribs)Bots130,044 editsm Add: issue, chapter, title, series, isbn, volume, pages. Tweak: title, pages, volume. Formatted dashes. You can use this bot yourself. Report bugs here.← Previous edit |
Latest revision as of 05:16, 11 February 2024 edit undoMaxim Masiutin (talk | contribs)Extended confirmed users, IP block exemptions, Pending changes reviewers31,087 edits Added bibcode. | Use this bot. | #UCB_Other |
(26 intermediate revisions by 21 users not shown) |
Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
⚫ |
| verifiedrevid = 400360350 |
|
|
|
| Watchedfields = changed |
|
⚫ |
| verifiedrevid = 470606125 |
|
| Name = Theogallin |
|
| Name = Theogallin |
|
| ImageFile = Theogallin.PNG |
|
| ImageFile = Theogallin.svg |
|
| ImageSize = 200px |
|
|
| ImageName = Chemical structure of theogallin |
|
| ImageName = Chemical structure of theogallin |
|
| ImageAlt = Chemical structure of theogallin |
|
| ImageAlt = Chemical structure of theogallin |
|
| IUPACName = (1''S'',3''R'',4''R'',5''R'')-1,3,4-trihydroxy-5-(3,4,5-trihydroxybenzoyl)oxycyclohexane-1-carboxylic acid |
|
| PIN = (1''S'',3''R'',4''R'',5''R'')-1,3,4-Trihydroxy-5-cyclohexane-1-carboxylic acid |
|
| OtherNames = 3-''O''-]]<!-- <br> --> |
|
| OtherNames = 3-''O''-]]<!-- <br> --> |
|
|Section1= {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|changed|??}} |
|
| CASNo = 17365-11-6 |
|
| CASNo = 17365-11-6 |
|
| CASNo_Ref = |
|
| CASNoOther = |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| CASOther = |
|
|
| PubChem = 442988 |
|
| UNII = N8GTS57R32 |
|
|
| PubChem = 442988 |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 391291 |
|
| ChemSpiderID = 391291 |
|
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| ChEBI = 9522 |
|
| ChEBI = 9522 |
|
| SMILES = O=C(O)2(O)C(O)(O)(OC(=O)c1cc(O)c(O)c(O)c1)C2 |
|
| SMILES = O=C(O)2(O)C(O)(O)(OC(=O)c1cc(O)c(O)c(O)c1)C2 |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C14H16O10/c15-6-1-5(2-7(16)10(6)18)12(20)24-9-4-14(23,13(21)22)3-8(17)11(9)19/h1-2,8-9,11,15-19,23H,3-4H2,(H,21,22)/t8-,9-,11-,14+/m1/s1 |
|
| StdInChI = 1S/C14H16O10/c15-6-1-5(2-7(16)10(6)18)12(20)24-9-4-14(23,13(21)22)3-8(17)11(9)19/h1-2,8-9,11,15-19,23H,3-4H2,(H,21,22)/t8-,9-,11-,14+/m1/s1 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = LDPLFHGGZNSKDS-FTBFGRRBSA-N |
|
| StdInChIKey = LDPLFHGGZNSKDS-FTBFGRRBSA-N |
|
| MeSHName = |
|
| MeSHName = |
|
}} |
|
}} |
|
|Section2= {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula = C<sub>14</sub>H<sub>16</sub>O<sub>10</sub> |
|
| Formula = C<sub>14</sub>H<sub>16</sub>O<sub>10</sub> |
|
| MolarMass = 344.27 g/mol |
|
| MolarMass = 344.27 g/mol |
|
| ExactMass = 344.074347 u |
|
|
| Appearance = |
|
| Appearance = |
|
| Density = |
|
| Density = |
|
| MeltingPt = <!-- °C --> |
|
| MeltingPt = |
|
| BoilingPt = <!-- °C --> |
|
| BoilingPt = |
|
| Solubility = |
|
| Solubility = |
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Theogallin''' is a ] ], a type of polyphenolic compound found in tea<ref>{{cite journal | last1 = Cartwright | first1 = R. A. | last2 = Roberts | first2 = E. A. H. | title = Theogallin, a polyphenol occurring in tea | journal = Journal of the Science of Food and Agriculture | volume = 5 | pages = 593 | year = 1954 | doi = 10.1002/jsfa.2740051207 | issue = 12}}</ref> where it has been characterised as an ] enhancing compound.<ref>{{cite journal | last1 = Kaneko | first1 = S | last2 = Kumazawa | first2 = K | last3 = Masuda | first3 = H | last4 = Henze | first4 = A | last5 = Hofmann | first5 = T | title = Flavour Science - Recent Advances and Trends | url = http://www.sciencedirect.com/science?_ob=ArticleURL&_udi=B8G60-4NTHF8G-1H&_user=10&_coverDate=12%2F31%2F2006&_rdoc=1&_fmt=high&_orig=search&_origin=search&_sort=d&_docanchor=&view=c&_acct=C000050221&_version=1&_urlVersion=0&_userid=10&md5=cf813e5aaeb56a06c0f4828eac21dd0f&searchtype=a | volume = 43 | pages = 181 | year = 2006 | doi = 10.1016/S0167-4501(06)80043-9 | chapter = Sensory and structural characterisation of an umami enhancing compound in green tea (mat-cha) | series = Developments in Food Science | isbn = 9780444527424}}</ref> The compound can also be found in '']'' fruits.<ref>{{cite journal | url = http://www.wikigenes.org/e/ref/e/17177565.html | title = Phenolics of Arbutus unedo L. (Ericaceae) fruits: identification of anthocyanins and gallic acid derivatives | author = Pawlowska, A.M., De Leo, M., Braca, A. | journal = J. Agric. Food Chem. | year = 2006 | doi = 10.1021/jf062230o | pmid=17177565 | volume = 54 | issue = 26 | pages = 10234–8}}</ref> |
|
'''Theogallin''' is a ] ], a type of polyphenolic compound found in tea<ref>{{cite journal | last1 = Cartwright | first1 = R. A. | last2 = Roberts | first2 = E. A. H. | title = Theogallin, a polyphenol occurring in tea | journal = Journal of the Science of Food and Agriculture | volume = 5 | pages = 593 | year = 1954 | doi = 10.1002/jsfa.2740051207 | issue = 12| bibcode = 1954JSFA....5..593C }}</ref> where it has been characterised as an ] enhancing compound.<ref>{{cite book | last1 = Kaneko | first1 = S | last2 = Kumazawa | first2 = K | last3 = Masuda | first3 = H | last4 = Henze | first4 = A | last5 = Hofmann | first5 = T | title = Flavour Science - Recent Advances and Trends | url-status = | volume = 43 | pages = 181 | year = 2006 | doi = 10.1016/S0167-4501(06)80043-9 | chapter = Sensory and structural characterisation of an umami enhancing compound in green tea (mat-cha) | series = Developments in Food Science | isbn = 978-0-444-52742-4}}{{deadlink|date=September 2023}}</ref> The compound can also be found in '']'' fruits.<ref>{{cite journal | url = http://www.wikigenes.org/e/ref/e/17177565.html | title = Phenolics of Arbutus unedo L. (Ericaceae) fruits: identification of anthocyanins and gallic acid derivatives | author = Pawlowska, A.M., De Leo, M., Braca, A. | journal = J. Agric. Food Chem. | year = 2006 | doi = 10.1021/jf062230o | pmid=17177565 | volume = 54 | issue = 26 | pages = 10234–8}}</ref> |
|
|
|
|
|
In rats, theogallin, or its metabolite ], can move through the blood-brain barrier and can have cognition enhancing activities.<ref>{{cite journal | last1 = Dimpfel | first1 = Wilfried | last2 = Kler | first2 = Adolf | last3 = Kriesl | first3 = Erwin | last4 = Lehnfeld | first4 = Romanus | title = Theogallin and l-theanine as active ingredients in decaffeinated green tea extract: II. Characterization in the freely moving rat by means of quantitative field potential analysis | journal = Journal of Pharmacy and Pharmacology | volume = 59 | issue = 10 | pages = 1397–403 | year = 2007 | pmid = 17910815 | doi = 10.1211/jpp.59.10.0010}}</ref> |
|
In rats, theogallin, or its metabolite ], can move through the ] and can have cognition enhancing activities.<ref>{{cite journal | last1 = Dimpfel | first1 = Wilfried | last2 = Kler | first2 = Adolf | last3 = Kriesl | first3 = Erwin | last4 = Lehnfeld | first4 = Romanus | title = Theogallin and l-theanine as active ingredients in decaffeinated green tea extract: II. Characterization in the freely moving rat by means of quantitative field potential analysis | journal = Journal of Pharmacy and Pharmacology | volume = 59 | issue = 10 | pages = 1397–403 | year = 2007 | pmid = 17910815 | doi = 10.1211/jpp.59.10.0010| s2cid = 33938157 | doi-access = free }}</ref> |
|
|
|
|
|
==References== |
|
== References == |
|
{{reflist}} |
|
{{reflist}} |
|
|
|
|
|
{{Phenolic acid}} |
|
{{Phenolic acid}} |
|
|
|
|
|
] |
|
] |
|
|
] |
|
|
|
|
|
|
{{aromatic-stub}} |
|
|
|
|
{{Natural-phenol-stub}} |
|