| Revision as of 12:52, 16 November 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 460916781 of page Warfarin for the Chem/Drugbox validation project (updated: 'DrugBank', 'ChEMBL').← Previous edit |
Latest revision as of 14:25, 29 January 2022 edit undo119.246.116.98 (talk)No edit summary |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{drugbox | Verifiedfields = changed |
|
{{drugbox |
|
| verifiedrevid = 413746125 |
|
| verifiedrevid = 477001424 |
|
| IUPAC_name = (''RS'')-4-hydroxy- 3-(3- oxo- 1-phenylbutyl)- 2''H''- chromen- 2-one |
|
| IUPAC_name = 2-Oxo-<small>L</small>-threo-hexono-1,4-lactone-2,3-enediol<br />''or''<br />(''R'')-3,4-dihydroxy-5-((''S'')- 1,2-dihydroxyethyl)furan-2(5''H'')-one |
|
| image = Warfarin.svg |
|
| image = L-Ascorbic_acid.svg |
|
|
| width = 200px |
|
| image2 = Warfarin-from-xtal-3D-balls.png |
|
| image2 = Ascorbic-acid-from-xtal-1997-3D-balls.png |
|
|
| width2 = 200px |
|
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
⚫ |
| Drugs.com = {{drugs.com|MTM|vitamin_c}} |
|
| tradename = Coumadin |
|
|
|
| licence_EU = <!-- EMEA requires brand name --> |
| ⚫ |
| Drugs.com = {{drugs.com|monograph|coumadin}} |
|
|
|
| licence_US = <!-- FDA may use generic name --> |
|
| MedlinePlus = a682277 |
|
|
| pregnancy_AU = D |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| pregnancy_US = X |
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
|
| pregnancy_category = A |
|
| legal_AU = S4 |
|
|
|
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
| legal_UK = POM |
|
|
|
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| legal_US = Rx-only |
|
|
|
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> |
| ⚫ |
| routes_of_administration = Oral or ] |
|
|
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
|
| legal_status = general public availability |
|
⚫ |
| routes_of_administration = oral |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
<!--Pharmacokinetic data--> |
|
| bioavailability = 100% |
|
| bioavailability = rapid & complete |
|
| protein_bound = 99.5% |
|
| protein_bound = negligible |
|
|
| elimination_half-life = varies according to plasma concentration <!-- can be 30 min to weeks, depending on body stores --> |
|
| metabolism = Hepatic: ], ], 2C8, 2C18, ] and ] |
|
|
|
| excretion = renal |
|
| elimination_half-life = 40 hours |
|
|
| excretion = ] (92%) |
|
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number = 81-81-2 |
|
| CAS_number = 50-81-7 |
|
| ATC_prefix = B01 |
|
| ATC_prefix = A |
|
| ATC_suffix = AA03 |
|
| ATC_suffix = 11G |
|
⚫ |
| ChEBI_Ref = {{ebicite|correct|EBI}} |
| ⚫ |
| PubChem = 6691 |
|
|
⚫ |
| ChEBI = 29073 |
| ⚫ |
| DrugBank_Ref = {{drugbankcite|changed|drugbank}} |
|
|
⚫ |
| PubChem = 5785 |
|
| DrugBank = <!-- blanked - oldvalue: DB00682 --> |
|
|
⚫ |
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
|
| DrugBank = DB00126 |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 10442445 |
|
| ChemSpiderID = 10189562 |
|
|
| NIAID_ChemDB = 002072 |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = 5Q7ZVV76EI |
|
| UNII = PQ6CK8PD0R |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG = D08682 |
|
| KEGG = D00018 |
| ⚫ |
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
| ⚫ |
| ChEBI = 10033 |
|
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL = <!-- blanked - oldvalue: 1464 --> |
|
| ChEMBL = 196 |
|
|
|
| ⚫ |
| C=19 | H=16 | O=4 |
|
|
|
<!--Chemical data--> |
| ⚫ |
| molecular_weight = 308.33 g/mol |
|
|
|
| chemical_formula = |
|
| smiles = CC(=O)CC(C\1=C(/O)c2ccccc2OC/1=O)c3ccccc3 |
|
|
⚫ |
| C=6 | H=7 | O=6 |
|
| InChI = 1/C19H16O4/c1-12(20)11-15(13-7-3-2-4-8-13)17-18(21)14-9-5-6-10-16(14)23-19(17)22/h2-10,15,21H,11H2,1H3 |
|
|
⚫ |
| molecular_weight = 176.12 g/] |
|
|
| smiles = C((1C(=C(C(=O)O1)O)O)O)O |
|
|
| InChI = 1/C6H8O6/c7-1-2(8)5-3(9)4(10)6(11)12-5/h2,5,7-10H,1H2/t2-,5+/m0/s1 |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C19H16O4/c1-12(20)11-15(13-7-3-2-4-8-13)17-18(21)14-9-5-6-10-16(14)23-19(17)22/h2-10,15,21H,11H2,1H3 |
|
| StdInChI = 1S/C6H8O6/c7-1-2(8)5-3(9)4(10)6(11)12-5/h2,5,7-10H,1H2/t2-,5+/m0/s1 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = PJVWKTKQMONHTI-UHFFFAOYSA-N |
|
| StdInChIKey = CIWBSHSKHKDKBQ-JLAZNSOCSA-N |
|
|
| synonyms = <small>L</small>-ascorbic acid |
|
|
| density = 1.694 |
|
|
| melting_point = 190 |
|
|
| boiling_point = 553 |
|
}} |
|
}} |
