Revision as of 16:20, 20 November 2011 edit86.30.243.179 (talk) added original patent← Previous edit |
Latest revision as of 19:42, 20 December 2023 edit undoJJMC89 bot III (talk | contribs)Bots, Administrators3,752,663 editsm Moving Category:Hoffmann-La Roche brands to Category:Drugs developed by Hoffmann-La Roche per Misplaced Pages:Categories for discussion/Log/2023 December 9#Category:AstraZeneca brands |
(23 intermediate revisions by 18 users not shown) |
Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{Drugbox |
|
{{Drugbox |
|
| verifiedrevid = 449872408 |
|
| verifiedrevid = 451563038 |
|
| IUPAC_name = 5-phenyl-7-(trifluoromethyl)-1,3-dihydro-1,4-benzodiazepin-2-one |
|
| IUPAC_name = 5-phenyl-7-(trifluoromethyl)-1,3-dihydro-1,4-benzodiazepin-2-one |
|
| image = triflunordazepam.png |
|
| image = Triflunordazepam.svg |
|
| width = 180 |
|
| width = 222 |
|
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
| tradename = |
|
| tradename = |
|
| legal_status = |
|
| legal_CA = Schedule IV |
|
|
| legal_UK = PSA |
|
|
| legal_DE = NpSG |
|
|
| legal_status = |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
<!--Pharmacokinetic data--> |
Line 13: |
Line 17: |
|
| metabolism = |
|
| metabolism = |
|
| elimination_half-life = |
|
| elimination_half-life = |
|
| excretion = |
|
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number = 2285-16-7 |
|
| CAS_number = 2285-16-7 |
|
| ATC_prefix = none |
|
| ATC_prefix = none |
|
| PubChem = 16795 |
|
| PubChem = 16795 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = 8CS486VL3D |
|
|
| ChemSpiderID = 15920 |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
|
|
|
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=16 | H=11 | F=3 | N=2 | O=1 |
|
| C=16 | H=11 | F=3 | N=2 | O=1 |
|
| molecular_weight = 304.267 |
|
|
| smiles = C1C(=O)NC2=C(C=C(C=C2)C(F)(F)F)C(=N1)C3=CC=CC=C3 |
|
| smiles = C1C(=O)NC2=C(C=C(C=C2)C(F)(F)F)C(=N1)C3=CC=CC=C3 |
|
|
| StdInChI = 1S/C16H11F3N2O/c17-16(18,19)11-6-7-13-12(8-11)15(20-9-14(22)21-13)10-4-2-1-3-5-10/h1-8H,9H2,(H,21,22) |
|
|
| StdInChIKey = UUBMOUNXQFMBQF-UHFFFAOYSA-N |
|
}} |
|
}} |
|
|
|
|
|
'''Ro5-2904'''<ref>DE Patent 1136709</ref> ('''Triflunordazepam''') is a drug which is a ] derivative with high ] affinity, and has ] effects.<ref>''Archives Internationales de Pharmacodynamie et de Therapie''. (1965). Vol 154, p 131.</ref><ref name="pmid8978853">{{cite journal |author=So SS, Karplus M |title=Genetic neural networks for quantitative structure-activity relationships: improvements and application of benzodiazepine affinity for benzodiazepine/GABAA receptors |journal=Journal of Medicinal Chemistry |volume=39 |issue=26 |pages=5246–56 |year=1996 |month=December |pmid=8978853 |doi=10.1021/jm960536o |url=}}</ref> |
|
'''Triflunordazepam''' (also known as '''Ro5-2904''')<ref>{{cite patent | country = DE | number = 1136709 }}</ref> is a drug which is a ] derivative with high ] affinity, and has ] effects.<ref>{{cite journal | title = Ro5-2904 | journal = Archives Internationales de Pharmacodynamie et de Thérapie | date = 1965 | volume = 154 | pages = 131 }}</ref><ref name="pmid8978853">{{cite journal | vauthors = So SS, Karplus M | title = Genetic neural networks for quantitative structure-activity relationships: improvements and application of benzodiazepine affinity for benzodiazepine/GABAA receptors | journal = Journal of Medicinal Chemistry | volume = 39 | issue = 26 | pages = 5246–56 | date = December 1996 | pmid = 8978853 | doi = 10.1021/jm960536o }}</ref> |
|
|
|
|
|
==See also== |
|
== See also == |
|
*] |
|
|
*] |
|
*] |
|
|
*] |
|
|
|
|
|
==References== |
|
== References == |
|
|
{{reflist}} |
|
<references/> |
|
|
|
|
|
|
{{Benzodiazepines}} |
|
{{Benzodiazepines}} |
|
|
{{GABAAR PAMs}} |
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
] |
|
|
] |
|
|
|
|
|
|
|
|
{{sedative-stub}} |
|
{{sedative-stub}} |