Misplaced Pages

:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions - Misplaced Pages

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
< Misplaced Pages:WikiProject Chemicals | Chembox validation Browse history interactively← Previous editContent deleted Content addedVisualWikitext
Revision as of 09:22, 21 November 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 461735601 of page Potassium_perchlorate for the Chem/Drugbox validation project (updated: 'ChEMBL').← Previous edit Latest revision as of 14:25, 29 January 2022 edit undo119.246.116.98 (talk)No edit summary 
Line 1: Line 1:
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} {{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}}
{{chembox {{drugbox
| verifiedrevid = 402558923 | verifiedrevid = 477001424
| IUPAC_name = 2-Oxo-<small>L</small>-threo-hexono-1,4-lactone-2,3-enediol<br />''or''<br />(''R'')-3,4-dihydroxy-5-((''S'')- 1,2-dihydroxyethyl)furan-2(5''H'')-one
| ImageFile = Potassium perchlorate.png
| image = L-Ascorbic_acid.svg
| ImageSize = 150px
| width = 200px
| ImageFile1 = Potassium-perchlorate-unit-cell-3D-balls-perspective.png
| image2 = Ascorbic-acid-from-xtal-1997-3D-balls.png
| ImageSize1 = 180px
| width2 = 200px
| ImageFile2 = Potassium-perchlorate-xtal-3D-SF.png

| ImageSize2 = 180px
<!--Clinical data-->
| ImageFile3 = Potassium perchlorate 200g.jpg
| Drugs.com = {{drugs.com|MTM|vitamin_c}}
| Name = Potassium perchlorate
| licence_EU = <!-- EMEA requires brand name -->
| OtherNames = Potassium chlorate(VII)<br /> Perchloric acid, potassium salt<br /> peroidin
| licence_US = <!-- FDA may use generic name -->
| Section1 = {{Chembox Identifiers
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| pregnancy_US = <!-- A / B / C / D / X -->
| ChemSpiderID = 22913
| pregnancy_category = A
| ChEMBL = <!-- blanked - oldvalue: 1200696 -->
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C -->
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
| legal_status = general public availability
| routes_of_administration = oral

<!--Pharmacokinetic data-->
| bioavailability = rapid & complete
| protein_bound = negligible
| elimination_half-life = varies according to plasma concentration <!-- can be 30 min to weeks, depending on body stores -->
| excretion = renal

<!--Identifiers-->
| CASNo_Ref = {{cascite|correct|CAS}}
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 50-81-7
| ATC_prefix = A
| ATC_suffix = 11G
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 29073
| PubChem = 5785
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB00126
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 10189562
| NIAID_ChemDB = 002072
| UNII_Ref = {{fdacite|correct|FDA}} | UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 42255P5X4D | UNII = PQ6CK8PD0R
| KEGG_Ref = {{keggcite|correct|kegg}}
| InChI = 1/ClHO4.K/c2-1(3,4)5;/h(H,2,3,4,5);/q;+1/p-1
| KEGG = D00018
| InChIKey = YLMGFJXSLBMXHK-REWHXWOFAB
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| SMILES = .Cl(=O)(=O)=O
| ChEMBL = 196

<!--Chemical data-->
| chemical_formula =
| C=6 | H=7 | O=6
| molecular_weight = 176.12 g/]
| smiles = C((1C(=C(C(=O)O1)O)O)O)O
| InChI = 1/C6H8O6/c7-1-2(8)5-3(9)4(10)6(11)12-5/h2,5,7-10H,1H2/t2-,5+/m0/s1
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/ClHO4.K/c2-1(3,4)5;/h(H,2,3,4,5);/q;+1/p-1 | StdInChI = 1S/C6H8O6/c7-1-2(8)5-3(9)4(10)6(11)12-5/h2,5,7-10H,1H2/t2-,5+/m0/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = YLMGFJXSLBMXHK-UHFFFAOYSA-M | StdInChIKey = CIWBSHSKHKDKBQ-JLAZNSOCSA-N
| synonyms = <small>L</small>-ascorbic acid
| CASNo = 7778-74-7
| density = 1.694
| CASNo_Ref = {{cascite|correct|CAS}}
| PubChem = 516900 | melting_point = 190
| boiling_point = 553
| EINECS = 231-912-9
| RTECS = SC9700000
| UNNumber = 1489
}}
| Section2 = {{Chembox Properties
| Formula = KClO<sub>4</sub>
| MolarMass = 138.55 g/mol
| Appearance = Colourless/white crystalline powder
| Density = 2.5239 g/cm<sup>3</sup>
| Solubility = 0.75 g/100 mL (0 °C)<br /> 1.5 g/100 mL (25 °C)<ref name = jtbaker>{{cite web | url = http://hazard.com/msds/mf/baker/baker/files/p5983.htm | publisher = ] | title = Potassium Perchlorate MSDS | date = 2007-02-16 | accessdate = 2007-12-10}}</ref><br /> 21.8 g/100 mL (100 °C)
| SolubleOther = negligible in ]<br /> insoluble in ]
| MeltingPt = 525 °C
| BoilingPt = 600 °C (decomp.)
}}
| Section3 = {{Chembox Structure
| Coordination =
| CrystalStruct = rhombohedral
}}
| Section7 = {{Chembox Hazards
| ExternalMSDS =
| EUClass = Oxidant ('''O''')<br />Harmful ('''Xn''')
| EUIndex = 017-008-00-5
| NFPA-H = 1
| NFPA-F = 0
| NFPA-R = 1
| NFPA-O = OX
| RPhrases = {{R9}}, {{R22}}
| SPhrases = {{S2}}, {{S13}}, {{S22}}, {{S27}}
| FlashPt =
}}
| Section8 = {{Chembox Related
| OtherAnions = ]<br />]<br />]
| OtherCations = ]<br />]
}}
}} }}

Latest revision as of 14:25, 29 January 2022

This page contains a copy of the infobox ({{drugbox}}) taken from revid 477243833 of page Vitamin_C with values updated to verified values.
WikiProject Chemicals/Chembox validation/VerifiedDataSandbox
Clinical data
Other namesL-ascorbic acid
AHFS/Drugs.comMultum Consumer Information
Pregnancy
category
  • A
Routes of
administration
oral
ATC code
Legal status
Legal status
  • general public availability
Pharmacokinetic data
Bioavailabilityrapid & complete
Protein bindingnegligible
Elimination half-lifevaries according to plasma concentration
Excretionrenal
Identifiers
IUPAC name
  • 2-Oxo-L-threo-hexono-1,4-lactone-2,3-enediol
    or
    (R)-3,4-dihydroxy-5-((S)- 1,2-dihydroxyethyl)furan-2(5H)-one
CAS Number
PubChem CID
DrugBank
ChemSpider
UNII
KEGG
ChEBI
ChEMBL
NIAID ChemDB
Chemical and physical data
FormulaC6H7O6
Molar mass176.12 g/mole g·mol
3D model (JSmol)
Density1.694 g/cm
Melting point190 °C (374 °F)
Boiling point553 °C (1,027 °F)
SMILES
  • C((1C(=C(C(=O)O1)O)O)O)O
InChI
  • InChI=1S/C6H8O6/c7-1-2(8)5-3(9)4(10)6(11)12-5/h2,5,7-10H,1H2/t2-,5+/m0/s1
  • Key:CIWBSHSKHKDKBQ-JLAZNSOCSA-N
  (verify)