Misplaced Pages

:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions - Misplaced Pages

Article snapshot taken from[REDACTED] with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
< Misplaced Pages:WikiProject Chemicals | Chembox validation Browse history interactively← Previous editContent deleted Content addedVisualWikitext
Revision as of 14:27, 5 December 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,084 edits Saving copy of the {{chembox}} taken from revid 462614815 of page Propadiene for the Chem/Drugbox validation project (updated: '').← Previous edit Latest revision as of 14:25, 29 January 2022 edit undo119.246.116.98 (talk)No edit summary 
Line 1: Line 1:
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} {{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}}
{{Chembox {{drugbox
| verifiedrevid = 406949009 | verifiedrevid = 477001424
| IUPAC_name = 2-Oxo-<small>L</small>-threo-hexono-1,4-lactone-2,3-enediol<br />''or''<br />(''R'')-3,4-dihydroxy-5-((''S'')- 1,2-dihydroxyethyl)furan-2(5''H'')-one
| ImageFileL1 = Allene.png
| image = L-Ascorbic_acid.svg
| ImageFileL1_Ref = {{chemboximage|correct|??}}
| ImageSizeL1 = 121 | width = 200px
| image2 = Ascorbic-acid-from-xtal-1997-3D-balls.png
| ImageNameL1 = Stereo structural formula of propadiene with explicit hydrogens
| width2 = 200px
| ImageFileR1 = Allene3D.png

| ImageFileR1_Ref = {{Chemboximage|correct|??}}
<!--Clinical data-->
| ImageSizeR1 = 121
| Drugs.com = {{drugs.com|MTM|vitamin_c}}
| ImageNameR1 = Spacefill model of propadiene
| licence_EU = <!-- EMEA requires brand name -->
| ImageFile2 = Allene-CRC-IR-3D-balls.png
| licence_US = <!-- FDA may use generic name -->
| ImageFile2_Ref = {{Chemboximage|correct|??}}
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| ImageSize2 = 160
| pregnancy_US = <!-- A / B / C / D / X -->
| ImageName2 = Ball and stick model of propadiene
| pregnancy_category = A
| IUPACName = Allene
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
| SystematicName = <!-- Propa-1,2-diene (substitutive) OR dimethylenecarbon (additive) -->
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII -->
| Section1 = {{Chembox Identifiers
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C -->
| CASNo = 463-49-0
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
| CASNo_Ref = {{cascite|correct|CAS}}
| legal_status = general public availability
| PubChem = 10037
| routes_of_administration = oral
| PubChem_Ref = {{Pubchemcite|correct|PubChem}}

| ChemSpiderID = 9642
<!--Pharmacokinetic data-->
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| bioavailability = rapid & complete
| EINECS = 207-335-3
| protein_bound = negligible
| UNNumber = 2200
| elimination_half-life = varies according to plasma concentration <!-- can be 30 min to weeks, depending on body stores -->
| MeSHName = Propadiene
| excretion = renal
| ChEBI_Ref = {{ebicite|correct|EBI}}

| ChEBI = 37601
<!--Identifiers-->
| ChEMBL = 116960
| ChEMBL_Ref = {{ebicite|correct|EBI}} | CASNo_Ref = {{cascite|correct|CAS}}
| CAS_number_Ref = {{cascite|correct|??}}
| Beilstein = 1730774
| Gmelin = 860 | CAS_number = 50-81-7
| SMILES = C=C=C | ATC_prefix = A
| SMILES1 = C(=C)=C | ATC_suffix = 11G
| ChEBI_Ref = {{ebicite|correct|EBI}}
| StdInChI = 1S/C3H4/c1-3-2/h1-2H2
| ChEBI = 29073
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| PubChem = 5785
| StdInChIKey = IYABWNGZIDDRAK-UHFFFAOYSA-N
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB00126
}}
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| Section2 = {{Chembox Properties
| ChemSpiderID = 10189562
| C = 3
| H = 4 | NIAID_ChemDB = 002072
| UNII_Ref = {{fdacite|correct|FDA}}
| ExactMass = 40.031300128 g mol<sup>-1</sup>
| UNII = PQ6CK8PD0R
| Appearance = Colorless gas
| KEGG_Ref = {{keggcite|correct|kegg}}
| MeltingPtC = -136
| BoilingPtC = -34 | KEGG = D00018
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| LogP = 1.45}}
| ChEMBL = 196
| Section3 = {{Chembox Hazards

| ExternalMSDS =
<!--Chemical data-->
| EUClass = {{Hazchem F+}}
| chemical_formula =
| RPhrases = {{R12}}
| C=6 | H=7 | O=6
| SPhrases = {{S9}}, {{S16}}, {{S33}}
| molecular_weight = 176.12 g/]
| NFPA-H = 0
| smiles = C((1C(=C(C(=O)O1)O)O)O)O
| NFPA-F = 4
| InChI = 1/C6H8O6/c7-1-2(8)5-3(9)4(10)6(11)12-5/h2,5,7-10H,1H2/t2-,5+/m0/s1
| NFPA-R = 3
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| ExploLimits = 13%}}
| StdInChI = 1S/C6H8O6/c7-1-2(8)5-3(9)4(10)6(11)12-5/h2,5,7-10H,1H2/t2-,5+/m0/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = CIWBSHSKHKDKBQ-JLAZNSOCSA-N
| synonyms = <small>L</small>-ascorbic acid
| density = 1.694
| melting_point = 190
| boiling_point = 553
}} }}

Latest revision as of 14:25, 29 January 2022

This page contains a copy of the infobox ({{drugbox}}) taken from revid 477243833 of page Vitamin_C with values updated to verified values.
WikiProject Chemicals/Chembox validation/VerifiedDataSandbox
Clinical data
Other namesL-ascorbic acid
AHFS/Drugs.comMultum Consumer Information
Pregnancy
category
  • A
Routes of
administration
oral
ATC code
Legal status
Legal status
  • general public availability
Pharmacokinetic data
Bioavailabilityrapid & complete
Protein bindingnegligible
Elimination half-lifevaries according to plasma concentration
Excretionrenal
Identifiers
IUPAC name
  • 2-Oxo-L-threo-hexono-1,4-lactone-2,3-enediol
    or
    (R)-3,4-dihydroxy-5-((S)- 1,2-dihydroxyethyl)furan-2(5H)-one
CAS Number
PubChem CID
DrugBank
ChemSpider
UNII
KEGG
ChEBI
ChEMBL
NIAID ChemDB
Chemical and physical data
FormulaC6H7O6
Molar mass176.12 g/mole g·mol
3D model (JSmol)
Density1.694 g/cm
Melting point190 °C (374 °F)
Boiling point553 °C (1,027 °F)
SMILES
  • C((1C(=C(C(=O)O1)O)O)O)O
InChI
  • InChI=1S/C6H8O6/c7-1-2(8)5-3(9)4(10)6(11)12-5/h2,5,7-10H,1H2/t2-,5+/m0/s1
  • Key:CIWBSHSKHKDKBQ-JLAZNSOCSA-N
  (verify)
Misplaced Pages:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions Add topic