Misplaced Pages:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions

< Misplaced Pages:WikiProject Chemicals | Chembox validation Browse history interactively ← Previous editContent deleted Content addedVisual WikitextInline

Revision as of 11:03, 6 December 2011 editBeetstra (talk \| contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 464327279 of page Methane for the Chem/Drugbox validation project (updated: 'KEGG').← Previous edit		Latest revision as of 14:25, 29 January 2022 edit undo119.246.116.98 (talk)No edit summary
Line 1:		Line 1:
	{{ambox \| text = This page contains a copy of the infobox ({{tl\|~~chembox~~}}) taken from revid of page ] with values updated to verified values.}}		{{ambox \| text = This page contains a copy of the infobox ({{tl\|drugbox}}) taken from revid of page ] with values updated to verified values.}}
	{{~~Chembox~~		{{drugbox
			\| verifiedrevid = 477001424
	\| Verifiedfields = changed
			\| IUPAC_name = 2-Oxo-<small>L</small>-threo-hexono-1,4-lactone-2,3-enediol<br />''or''<br />(''R'')-3,4-dihydroxy-5-((''S'')- 1,2-dihydroxyethyl)furan-2(5''H'')-one
	\| Watchedfields = changed
			\| image = L-Ascorbic_acid.svg
	\| verifiedrevid = 455379140
			\| width = 200px
	\| ImageFile = Methane-2D-dimensions.svg
			\| image2 = Ascorbic-acid-from-xtal-1997-3D-balls.png
	\| ImageFile_Ref = {{chemboximage\|correct\|??}}
	\| ~~ImageSize~~ = ~~160~~		\| width2 = 200px

	\| ImageName = Stereo, skeletal formula of methane with some measurements added
			<!--Clinical data-->
	\| ImageFileL1 = Methane-CRC-MW-3D-balls.png
	\| ~~ImageFileL1_Ref~~ = {{~~chemboximage~~\|~~correct~~\|??}}		\| Drugs.com = {{drugs.com\|MTM\|vitamin_c}}
			\| licence_EU = <!-- EMEA requires brand name -->
	\| ImageNameL1 = Ball and stick model of methane
			\| licence_US = <!-- FDA may use generic name -->
	\| ImageFileR1 = Methane-3D-space-filling.svg
			\| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
	\| ImageFileR1_Ref = {{chemboximage\|correct\|??}}
			\| pregnancy_US = <!-- A / B / C / D / X -->
	\| ImageNameR1 = Spacefill model of methane
			\| pregnancy_category = A
	\| IUPACName = {{Unbulleted list\|Methane<ref name="methane (CHEBI:16183)">{{Cite web\|title=methane (CHEBI:16183)\|url=https://www.ebi.ac.uk/chebi/searchId.do?chebiId=16183\|work=Chemical Entities of Biological Interest\|publisher=European Bioinformatics Institute\|accessdate=10 October 2011\|location=UK\|date=17 October 2009\|at=Main}}</ref> ''(substitutive)''\|Tetrahydridocarbon<ref name="methane (CHEBI:16183)" /> ''(additive)''}}
			\| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
	\| OtherNames = {{Unbulleted list\|Carbon Tetrahydride{{Citation needed\|date=November 2011}}\|Marsh gas<ref name=webbook>{{cite web\|editor1-last=Linstrom\|editor1-first=P.J.\|editor2-last=Mallard\|editor2-first=W.G.\| title=Methane\|url=http://webbook.nist.gov/cgi/inchi/InChI%3D1S/CH4/h1H4\|work=NIST Chemistry WebBook, NIST Standard Reference Database Number 69\|publisher=National Institute of Standards and Technology\|accessdate=4 December 2011\|year=2011}}</ref>\|Methyl hydride<ref name=webbook/>}}
			\| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII -->
	\| Section1 = {{Chembox Identifiers
			\| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C -->
	\| CASNo = 74-82-8
			\| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
	\| CASNo_Ref = {{cascite\|correct\|CAS}}
			\| legal_status = general public availability
	\| PubChem = 297
			\| routes_of_administration = oral
	\| PubChem_Ref = {{Pubchemcite\|correct\|Pubchem}}

	\| ChemSpiderID = 291
			<!--Pharmacokinetic data-->
	\| ChemSpiderID_Ref = {{chemspidercite\|correct\|chemspider}}
			\| bioavailability = rapid & complete
	\| EINECS = 200-812-7
			\| protein_bound = negligible
	\| UNNumber = 1971
			\| elimination_half-life = varies according to plasma concentration <!-- can be 30 min to weeks, depending on body stores -->
	\| KEGG = <!-- blanked - oldvalue: C01438 -->
			\| excretion = renal
	\| KEGG_Ref = {{keggcite\|correct\|kegg}}

	\| MeSHName = Methane
			<!--Identifiers-->
	\| ChEBI = 16183
	\| ~~ChEBI_Ref~~ = {{~~ebicite~~\|correct\|~~EBI~~}}		\| CASNo_Ref = {{cascite\|correct\|CAS}}
			\| CAS_number_Ref = {{cascite\|correct\|??}}
	\| ChEMBL = 17564
			\| CAS_number = 50-81-7
	\| ChEMBL_Ref = {{ebicite\|changed\|EBI}}
	\| ~~RTECS~~ = ~~PA1490000~~		\| ATC_prefix = A
	\| ~~Beilstein~~ = ~~1718732~~		\| ATC_suffix = 11G
			\| ChEBI_Ref = {{ebicite\|correct\|EBI}}
	\| Gmelin = 59
	\| ~~3DMet~~ = ~~B01450~~		\| ChEBI = 29073
	\| ~~SMILES~~ = C		\| PubChem = 5785
			\| DrugBank_Ref = {{drugbankcite\|correct\|drugbank}}
	\| StdInChI = 1S/CH4/h1H4
			\| DrugBank = DB00126
	\| StdInChI_Ref = {{stdinchicite\|correct\|chemspider}}
			\| ChemSpiderID_Ref = {{chemspidercite\|correct\|chemspider}}
	\| StdInChIKey = VNWKTOKETHGBQD-UHFFFAOYSA-N
			\| ChemSpiderID = 10189562
	\| StdInChIKey_Ref = {{stdinchicite\|correct\|chemspider}}
			\| NIAID_ChemDB = 002072
	}}
			\| UNII_Ref = {{fdacite\|correct\|FDA}}
	\| Section2 = {{Chembox Properties
	\| C = 1		\| UNII = PQ6CK8PD0R
			\| KEGG_Ref = {{keggcite\|correct\|kegg}}
	\| H = 4
			\| KEGG = D00018
	\| ExactMass = 16.031300128 g mol<sup>−1</sup>
			\| ChEMBL_Ref = {{ebicite\|correct\|EBI}}
	\| Appearance = Colorless gas
	\| ~~Odor~~ = ~~Odorless~~		\| ChEMBL = 196

	\| Density = 655.6 μg cm<sup>−3</sup>
			<!--Chemical data-->
	\| MeltingPtK = 86
	\| ~~BoilingPtK~~ = ~~111~~		\| chemical_formula =
			\| C=6 \| H=7 \| O=6
	\| Solubility = 35 mg dm<sup>−3</sup> (at 17 °C)
			\| molecular_weight = 176.12 g/]
	\| LogP = 1.09
			\| smiles = C((1C(=C(C(=O)O1)O)O)O)O
	}}
			\| InChI = 1/C6H8O6/c7-1-2(8)5-3(9)4(10)6(11)12-5/h2,5,7-10H,1H2/t2-,5+/m0/s1
	\| Section3 = {{Chembox Thermochemistry
			\| StdInChI_Ref = {{stdinchicite\|correct\|chemspider}}
	\| DeltaHf = −74.87 kJ mol<sup>−1</sup>
			\| StdInChI = 1S/C6H8O6/c7-1-2(8)5-3(9)4(10)6(11)12-5/h2,5,7-10H,1H2/t2-,5+/m0/s1
	\| DeltaHc = −891.1–−890.3 kJ mol<sup>−1</sup>
			\| StdInChIKey_Ref = {{stdinchicite\|correct\|chemspider}}
	\| Entropy = 186.25 J K<sup>−1</sup> mol<sup>−1</sup>
			\| StdInChIKey = CIWBSHSKHKDKBQ-JLAZNSOCSA-N
	\| HeatCapacity = 35.69 J K<sup>−1</sup> mol<sup>−1</sup>
			\| synonyms = <small>L</small>-ascorbic acid
	}}
			\| density = 1.694
	\| Section4 = {{Chembox Hazards
			\| melting_point = 190
	\| GHSPictograms = {{GHS flame}}
			\| boiling_point = 553
	\| GHSSignalWord = '''DANGER'''
	\| HPhrases = {{H-phrases\|220\|280}}
	\| PPhrases = {{P-phrases\|210\|410+403}}
	\| EUIndex = 601-001-00-4
	\| EUClass = {{Hazchem F+}}
	\| RPhrases = {{R12}}
	\| SPhrases = {{S2}}, {{S9}}, {{S16}}, {{S33}}
	\| NFPA-H = 1
	\| NFPA-F = 4
	\| NFPA-R = 0
	\| FlashPt = −188 °C
	\| Autoignition = 537 °C
	\| ExploLimits = 5–15% <ref name=msds>{{cite web\|title=Safety Data Sheet: Methane\|url=http://www.chemadvisor.com/Matheson/database/msds/00244226000800003.PDF\|publisher=Matheson Tri-Gas\|accessdate=4 December 2011\|author=Matheson Tri-Gas\|authorlink=Matheson (compressed gas & equipment)\|date=Dec 4, 2009}}</ref>
	}}
	\| Section5 = {{Chembox Related
	\| Function = ]s
	\| OtherFunctn = ]<br />
	]
	\| OtherCpds = ]<br />
	]<br />
	]<br />
	]<br />
	]
	}}
	}}		}}

Latest revision as of 14:25, 29 January 2022

This page contains a copy of the infobox ({{drugbox}}) taken from revid 477243833 of page Vitamin_C with values updated to verified values.

WikiProject Chemicals/Chembox validation/VerifiedDataSandbox
Clinical data


Other names	L-ascorbic acid
AHFS/Drugs.com	Multum Consumer Information
Pregnancy category	A
Routes of administration	oral
ATC code	A11G (WHO)
Legal status
Legal status	general public availability
Pharmacokinetic data
Bioavailability	rapid & complete
Protein binding	negligible
Elimination half-life	varies according to plasma concentration
Excretion	renal
Identifiers
IUPAC name 2-Oxo-L-threo-hexono-1,4-lactone-2,3-enediol or (R)-3,4-dihydroxy-5-((S)- 1,2-dihydroxyethyl)furan-2(5H)-one
CAS Number	50-81-7
PubChem CID	5785
DrugBank	DB00126
ChemSpider	10189562
UNII	PQ6CK8PD0R
KEGG	D00018
ChEBI	CHEBI:29073
ChEMBL	ChEMBL196
NIAID ChemDB	002072
Chemical and physical data
Formula	C₆H₇O₆
Molar mass	176.12 g/mole g·mol
3D model (JSmol)	Interactive image
Density	1.694 g/cm
Melting point	190 °C (374 °F)
Boiling point	553 °C (1,027 °F)
SMILES C((1C(=C(C(=O)O1)O)O)O)O
InChI InChI=1S/C6H8O6/c7-1-2(8)5-3(9)4(10)6(11)12-5/h2,5,7-10H,1H2/t2-,5+/m0/s1 Key:CIWBSHSKHKDKBQ-JLAZNSOCSA-N
(verify)