Revision as of 23:45, 14 December 2011 editIantresman (talk | contribs)Extended confirmed users21,376 edits →References: Category:E numbers← Previous edit |
Latest revision as of 04:48, 7 June 2023 edit undo81.19.7.164 (talk) Repair Molar massTag: Visual edit |
(18 intermediate revisions by 15 users not shown) |
Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
⚫ |
| verifiedrevid = 265826165 |
|
|
|
| Watchedfields = changed |
⚫ |
| ImageFile = Dicalcium citrate.png |
|
|
⚫ |
| verifiedrevid = 428871785 |
|
| ImageSize = 200px |
|
|
⚫ |
| ImageFile = Dicalcium citrate.png |
⚫ |
| IUPACName = Calcium hydrogen 2-hydroxypropane-1,2,3-tricarboxylate |
|
|
| OtherNames = |
|
| ImageSize = 200px |
|
⚫ |
| IUPACName = Calcium dihydrogen 2-hydroxypropane-1,2,3-tricarboxylate |
⚫ |
| Section1 = {{Chembox Identifiers |
|
|
|
| OtherNames = |
⚫ |
| CASNo = 1185-56-4 |
|
|
⚫ |
| Section1 = {{Chembox Identifiers |
⚫ |
| PubChem = |
|
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
⚫ |
| CASNo = 1204587-66-5 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = LGH2B6RC26 |
|
| SMILES = C(CC(C(O)=O)(O)CC()=O)=O. |
|
| SMILES = C(CC(C(O)=O)(O)CC()=O)=O. |
|
⚫ |
| PubChem = 155804709 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 22778 |
|
|
| InChI = InChI=1S/C6H10O4.2Ca.3H2O/c7-3-1-6(10,5-9)2-4-8;;;;;/h1-5H2;;;3*1H2/q-4;2*+2;;; |
|
|
| InChIKey = NASRAZMFZQSAIG-UHFFFAOYSA-N |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C6H8O7.Ca/c7-3(8)1-6(13,5(11)12)2-4(9)10;/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);/q;+2/p-2 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = PFKGDYCESFRMAP-UHFFFAOYSA-L |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
| Section2 = {{Chembox Properties |
|
| Formula = C<sub>6</sub>H<sub>6</sub>CaO<sub>7</sub> |
|
| Formula = C<sub>6</sub>H<sub>6</sub>Ca<sub>2</sub>O<sub>7</sub> |
|
| MolarMass = 230.19 g/mol |
|
| MolarMass = 270.26 g/mol |
|
| Appearance = |
|
| Appearance = |
|
| Density = |
|
| Density = |
Line 18: |
Line 31: |
|
| BoilingPt = |
|
| BoilingPt = |
|
| Solubility = }} |
|
| Solubility = }} |
|
| Section3 = {{Chembox Hazards |
|
| Section3 = {{Chembox Hazards |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
| Autoignition = }} |
|
| AutoignitionPt = }} |
|
}} |
|
}} |
|
|
|
|
|
'''Dicalcium citrate''' is a ] with formula C<sub>6</sub>H<sub>6</sub>CaO<sub>7</sub>. It is a ] ] of ]. |
|
'''Dicalcium citrate''' is a ] with formula C<sub>6</sub>H<sub>6</sub>Ca<sub>2</sub>O<sub>7</sub>. It is a ] ] of ].<ref>{{Cite web |last=PubChem |title=Citric acid, calcium salt |url=https://pubchem.ncbi.nlm.nih.gov/compound/24363 |access-date=2022-10-24 |website=pubchem.ncbi.nlm.nih.gov |language=en}}</ref> |
|
|
|
|
|
==See also== |
|
==See also== |
Line 31: |
Line 44: |
|
|
|
|
|
==References== |
|
==References== |
|
|
*''Food Additives in Europe 2000'', pp. 322-324, Nordic Council of Ministers, 2002 {{ISBN|928930829X}}. |
|
{{Unreferenced|date =September 2007}} |
|
|
<references/> |
|
<references/> |
|
|
|
|
Line 37: |
Line 50: |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
|
|
|
|
{{organic-compound-stub}} |
|
{{organic-compound-stub}} |