Revision as of 18:59, 28 December 2011 editBenrr101 (talk | contribs)344 edits Replaced image with new vector version← Previous edit |
Latest revision as of 21:26, 1 October 2024 edit undo76.174.0.57 (talk)No edit summary |
(17 intermediate revisions by 13 users not shown) |
Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Watchedfields = changed |
|
⚫ |
| verifiedrevid = 444589978 |
|
⚫ |
| ImageFile = Imuracetam Structure.svg |
|
⚫ |
| ImageSize = 200px |
|
⚫ |
| PIN = ''N'',''N''′-Bisurea |
|
⚫ |
| OtherNames = UCB-G218 |
|
⚫ |
|Section1={{Chembox Identifiers |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = 972FNV35ZM |
|
| UNII = 972FNV35ZM |
⚫ |
| verifiedrevid = 437173420 |
|
⚫ |
| ImageFile = Imuracetam.svg |
|
⚫ |
| ImageSize = 140px |
|
⚫ |
| IUPACName = ''N'',''N'''-''bis''urea |
|
⚫ |
| OtherNames = |
|
⚫ |
| Section1 = {{Chembox Identifiers |
|
|
| PubChem = 163319 |
|
| PubChem = 163319 |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
Line 17: |
Line 18: |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = WMKONRFEZGAHTE-UHFFFAOYSA-N |
|
| StdInChIKey = WMKONRFEZGAHTE-UHFFFAOYSA-N |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo =67542-41-0 |
|
| CASNo = 67542-41-0 |
|
| ATCCode_prefix = |
|
|
|
| ChEMBL = 2106342 |
|
| ATCCode_suffix = |
|
|
| SMILES = O=C(NCN1C(=O)CCC1)NCN2C(=O)CCC2 |
|
| SMILES = O=C(NCN1C(=O)CCC1)NCN2C(=O)CCC2 |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula = | C=11 | H=18 | N=4 | O=3 |
|
| C=11 | H=18 | N=4 | O=3 |
|
| MolarMass = 254.286 g/mol |
|
|
| Appearance = |
|
| Appearance = |
|
| Density = |
|
| Density = |
|
| MeltingPt = |
|
| MeltingPtC = 184.5 |
|
|
| MeltingPt_ref= <ref name="GanellinTriggle1996" /> |
|
| BoilingPt = |
|
| BoilingPt = |
|
| Solubility = }} |
|
| Solubility = }} |
|
| Section5 = {{Chembox Pharmacology |
|
|Section5={{Chembox Pharmacology |
|
| AdminRoutes = |
|
| AdminRoutes = |
|
| Bioavail = |
|
| Bioavail = |
Line 42: |
Line 43: |
|
| Legal_AU = |
|
| Legal_AU = |
|
| Legal_CA = |
|
| Legal_CA = |
|
| PregCat = |
|
| Pregnancy_category = |
|
| PregCat_AU = |
|
| Pregnancy_AU = |
|
| PregCat_US = }} |
|
| Pregnancy_US = }} |
|
}} |
|
}} |
|
|
|
|
|
'''Imuracetam''' is a ] drug of the ] family.<ref>Avetisyan SA, Kocharov SL, Azaryan LV, Dzhagatspanyan IA, Melikyan GG. Synthesis and psychotropic activity of new 2-pyrrolidone derivatives. ''Pharmaceutical Chemistry Journal''. 1998; 32(2):55-58.</ref> |
|
'''Imuracetam''' ({{Abbrlink|INN|International Nonproprietary Name}}; developmental code name '''UCB-G218''') is a ] of the ] group described as a ] (cognitive enhancer).<ref name="Elks2014">{{cite book | last=Elks | first=J. | title=The Dictionary of Drugs: Chemical Data: Chemical Data, Structures and Bibliographies | publisher=Springer US | year=2014 | isbn=978-1-4757-2085-3 | url=https://books.google.com/books?id=0vXTBwAAQBAJ&pg=PA681 | access-date=1 October 2024 | page=681}}</ref><ref name="AvetisyanKocharovAzaryan1998">{{cite journal | vauthors = Avetisyan SA, Kocharov SL, Azaryan LV, Dzhagatspanyan IA, Melikyan GG | title = Synthesis and psychotropic activity of new 2-pyrrolidone derivatives. | journal = Pharmaceutical Chemistry Journal | date = February 1998 | volume = 32 | issue = 2 | pages = 55–58 | doi = 10.1007/BF02464161 | s2cid = 29810469 }}</ref> It was under development in the 1970s but was never marketed.<ref name="GanellinTriggle1996">{{cite book | title = Dictionary of Pharmacological Agents | volume = 3 | vauthors = Ganellin CR, Triggle DJ | publisher = CRC Press | date = 1996}}</ref> |
|
|
|
|
|
==References== |
|
==References== |
|
|
{{Reflist}} |
|
<references/> |
|
|
|
|
|
|
{{Racetams}} |
|
{{Racetams}} |
|
|
|
|
|
] |
|
] |
⚫ |
] |
|
|
] |
|
] |
|
⚫ |
] |
|
|
] |
|
] |
|
] |
|
|
|
|
|
|
|
|
|
{{nervous-system-drug-stub}} |
|
{{Nervous-system-drug-stub}} |