Misplaced Pages

:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions - Misplaced Pages

Article snapshot taken from[REDACTED] with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
< Misplaced Pages:WikiProject Chemicals | Chembox validation Browse history interactively← Previous editContent deleted Content addedVisualWikitext
Revision as of 12:36, 10 January 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,084 edits Saving copy of the {{chembox}} taken from revid 469799758 of page Tetraethyllead for the Chem/Drugbox validation project (updated: '').← Previous edit Latest revision as of 14:25, 29 January 2022 edit undo119.246.116.98 (talk)No edit summary 
Line 1: Line 1:
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} {{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}}
{{Chembox {{drugbox
| verifiedrevid = 451265760 | verifiedrevid = 477001424
| IUPAC_name = 2-Oxo-<small>L</small>-threo-hexono-1,4-lactone-2,3-enediol<br />''or''<br />(''R'')-3,4-dihydroxy-5-((''S'')- 1,2-dihydroxyethyl)furan-2(5''H'')-one
| ImageFile = Tetraethylblei.png
| image = L-Ascorbic_acid.svg
| ImageFile_Ref = {{Chemboximage|correct|??}}
| ImageSize = 200 | width = 200px
| image2 = Ascorbic-acid-from-xtal-1997-3D-balls.png
| ImageAlt = Skeletal formula
| width2 = 200px
| ImageFile1 = Tetraethyllead-3D-balls.png

| ImageSize1 = 180
<!--Clinical data-->
| ImageAlt1 = Ball-and-stick model
| Drugs.com = {{drugs.com|MTM|vitamin_c}}
| IUPACName = Tetraethylplumbane
| licence_EU = <!-- EMEA requires brand name -->
| SystematicName = <!-- Tetraethylplumbane (substitutive) OR Tetraethyllead (additive) -->
| licence_US = <!-- FDA may use generic name -->
| OtherNames = Lead tetraethyl<br />
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
Tetraethyl lead<br />
| pregnancy_US = <!-- A / B / C / D / X -->
Tetra-ethyl lead
| pregnancy_category = A
| Section1 = {{Chembox Identifiers
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
| Abbreviations = TEL
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII -->
| CASNo = 78-00-2
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C -->
| CASNo_Ref = {{cascite|correct|CAS}}
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
| PubChem = 6511
| legal_status = general public availability
| PubChem_Ref = {{Pubchemcite|correct|PubChem}}
| routes_of_administration = oral
| ChemSpiderID = 6265

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
<!--Pharmacokinetic data-->
| EINECS = 201-075-4
| bioavailability = rapid & complete
| UNNumber = 1649
| protein_bound = negligible
| MeSHName = Tetraethyl+lead
| elimination_half-life = varies according to plasma concentration <!-- can be 30 min to weeks, depending on body stores -->
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 30182 | excretion = renal

| RTECS = TP4550000
<!--Identifiers-->
| Beilstein = 3903146
| CASNo_Ref = {{cascite|correct|CAS}}
| Gmelin = 68951
| UNII_Ref = {{fdacite|correct|FDA}} | CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 50-81-7
| UNII = 13426ZWT6A
| ATC_prefix = A
| SMILES = CC(CC)(CC)CC
| ATC_suffix = 11G
| StdInChI = 1S/4C2H5.Pb/c4*1-2;/h4*1H2,2H3;
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 29073
| StdInChIKey = MRMOZBOQVYRSEM-UHFFFAOYSA-N
| PubChem = 5785
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
}}
| DrugBank = DB00126
| Section2 = {{Chembox Properties
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| C = 8
| ChemSpiderID = 10189562
| H = 20
| Pb = 1 | NIAID_ChemDB = 002072
| UNII_Ref = {{fdacite|correct|FDA}}
| ExactMass = 324.133136490 g mol<sup>-1</sup>
| UNII = PQ6CK8PD0R
| Appearance = Colorless liquid
| KEGG_Ref = {{keggcite|correct|kegg}}
| Density = 1.653 g cm<sup>-3</sup>
| MeltingPtC = −136 | KEGG = D00018
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| BoilingPtCL = 84
| BoilingPtCH = 85 | ChEMBL = 196

| Boiling_notes = 15 mmHg
<!--Chemical data-->
| RefractIndex = 1.5198}}
| chemical_formula =
| Section3 = {{Chembox Structure
| C=6 | H=7 | O=6
| MolShape = Tetrahedral
| molecular_weight = 176.12 g/]
| Dipole = 0 D}}
| smiles = C((1C(=C(C(=O)O1)O)O)O)O
| Section4 = {{Chembox Hazards
| InChI = 1/C6H8O6/c7-1-2(8)5-3(9)4(10)6(11)12-5/h2,5,7-10H,1H2/t2-,5+/m0/s1
| EUClass = {{Hazchem T+}}{{Hazchem N}}
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| RPhrases = {{R61}}, {{R26/27/28}}, {{R33}}, {{R50/53}}, {{R62}}
| StdInChI = 1S/C6H8O6/c7-1-2(8)5-3(9)4(10)6(11)12-5/h2,5,7-10H,1H2/t2-,5+/m0/s1
| SPhrases = {{S53}}, {{S45}}, {{S60}}, {{S61}}
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| NFPA-H = 3
| StdInChIKey = CIWBSHSKHKDKBQ-JLAZNSOCSA-N
| NFPA-F = 2
| synonyms = <small>L</small>-ascorbic acid
| NFPA-R = 3
| FlashPt = 73 °C}} | density = 1.694
| melting_point = 190
| Section8 = {{Chembox Related
| boiling_point = 553
| OtherCpds = ]<br />
]}}
}} }}

Latest revision as of 14:25, 29 January 2022

This page contains a copy of the infobox ({{drugbox}}) taken from revid 477243833 of page Vitamin_C with values updated to verified values.
WikiProject Chemicals/Chembox validation/VerifiedDataSandbox
Clinical data
Other namesL-ascorbic acid
AHFS/Drugs.comMultum Consumer Information
Pregnancy
category
  • A
Routes of
administration
oral
ATC code
Legal status
Legal status
  • general public availability
Pharmacokinetic data
Bioavailabilityrapid & complete
Protein bindingnegligible
Elimination half-lifevaries according to plasma concentration
Excretionrenal
Identifiers
IUPAC name
  • 2-Oxo-L-threo-hexono-1,4-lactone-2,3-enediol
    or
    (R)-3,4-dihydroxy-5-((S)- 1,2-dihydroxyethyl)furan-2(5H)-one
CAS Number
PubChem CID
DrugBank
ChemSpider
UNII
KEGG
ChEBI
ChEMBL
NIAID ChemDB
Chemical and physical data
FormulaC6H7O6
Molar mass176.12 g/mole g·mol
3D model (JSmol)
Density1.694 g/cm
Melting point190 °C (374 °F)
Boiling point553 °C (1,027 °F)
SMILES
  • C((1C(=C(C(=O)O1)O)O)O)O
InChI
  • InChI=1S/C6H8O6/c7-1-2(8)5-3(9)4(10)6(11)12-5/h2,5,7-10H,1H2/t2-,5+/m0/s1
  • Key:CIWBSHSKHKDKBQ-JLAZNSOCSA-N
  (verify)
Misplaced Pages:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions Add topic