Revision as of 12:55, 10 January 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 466096932 of page Thenoyltrifluoroacetone for the Chem/Drugbox validation project (updated: '').← Previous edit |
Latest revision as of 14:25, 29 January 2022 edit undo119.246.116.98 (talk)No edit summary |
Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{chembox |
|
{{drugbox |
|
|
| verifiedrevid = 477001424 |
|
| Watchedfields = changed |
|
|
|
| IUPAC_name = 2-Oxo-<small>L</small>-threo-hexono-1,4-lactone-2,3-enediol<br />''or''<br />(''R'')-3,4-dihydroxy-5-((''S'')- 1,2-dihydroxyethyl)furan-2(5''H'')-one |
|
| verifiedrevid = 444224615 |
|
|
|
| image = L-Ascorbic_acid.svg |
|
| Name = Thenoyltrifluoroacetone<ref></ref> |
|
|
|
| width = 200px |
|
| ImageFile = Thenoyltrifluoroacetone-2D-skeletal.png |
|
|
|
| image2 = Ascorbic-acid-from-xtal-1997-3D-balls.png |
|
| ImageSize = |
|
|
|
| width2 = 200px |
|
| ImageFile1 = Thenoyltrifluoroacetone-3D-balls.png |
|
|
|
|
|
| ImageSize1 = |
|
|
|
<!--Clinical data--> |
|
| IUPACName = 4,4,4-trifluoro-1-(2-thienyl)-1,3-butanedione |
|
|
|
| Drugs.com = {{drugs.com|MTM|vitamin_c}} |
|
| SystematicName = |
|
|
|
| licence_EU = <!-- EMEA requires brand name --> |
|
| OtherNames = 2-thenoyltrifluoroacetone |
|
|
|
| licence_US = <!-- FDA may use generic name --> |
|
| Section1 = {{Chembox Identifiers |
|
|
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| Abbreviations = |
|
|
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
|
| pregnancy_category = A |
|
| ChemSpiderID = 5399 |
|
|
|
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
| InChI = 1/C8H5F3O2S/c9-8(10,11)7(13)4-5(12)6-2-1-3-14-6/h1-3H,4H2 |
|
|
|
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| InChIKey = TXBBUSUXYMIVOS-UHFFFAOYAR |
|
|
|
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
|
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| StdInChI = 1S/C8H5F3O2S/c9-8(10,11)7(13)4-5(12)6-2-1-3-14-6/h1-3H,4H2 |
|
|
|
| legal_status = general public availability |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
|
|
| routes_of_administration = oral |
|
| StdInChIKey = TXBBUSUXYMIVOS-UHFFFAOYSA-N |
|
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
|
| bioavailability = rapid & complete |
|
|
| protein_bound = negligible |
|
|
| elimination_half-life = varies according to plasma concentration <!-- can be 30 min to weeks, depending on body stores --> |
|
|
| excretion = renal |
|
|
|
|
|
<!--Identifiers--> |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CASNo = 326-91-0 |
|
|
| EINECS = |
|
| CAS_number = 50-81-7 |
|
| EINECSCASNO = |
|
| ATC_prefix = A |
|
| PubChem = 5601 |
|
| ATC_suffix = 11G |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
|
| DrugBank = DB04795 |
|
|
| SMILES = O=C(c1sccc1)CC(=O)C(F)(F)F |
|
|
| InChI = |
|
|
| RTECS = |
|
|
| MeSHName = |
|
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| ChEBI = |
|
| ChEBI = 29073 |
|
|
| PubChem = 5785 |
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
|
| DrugBank = DB00126 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
| ChemSpiderID = 10189562 |
|
|
| NIAID_ChemDB = 002072 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = PQ6CK8PD0R |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG = |
|
| KEGG = D00018 |
|
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ATCCode_prefix = |
|
|
| ATCCode_suffix = |
|
| ChEMBL = 196 |
|
|
|
|
| ATC_Supplemental =}} |
|
|
|
<!--Chemical data--> |
|
| Section2 = {{Chembox Properties |
|
|
|
| chemical_formula = |
|
| Formula = C<sub>8</sub>H<sub>5</sub>F<sub>3</sub>O<sub>2</sub>S |
|
|
|
| C=6 | H=7 | O=6 |
|
| MolarMass = 222.18 g mol<sup>−1</sup> |
|
|
|
| molecular_weight = 176.12 g/] |
|
| Appearance = fine, slightly yellow crystals |
|
|
|
| smiles = C((1C(=C(C(=O)O1)O)O)O)O |
|
| Density = |
|
|
|
| InChI = 1/C6H8O6/c7-1-2(8)5-3(9)4(10)6(11)12-5/h2,5,7-10H,1H2/t2-,5+/m0/s1 |
|
| MeltingPt = 40–44 °C |
|
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| Melting_notes = |
|
|
|
| StdInChI = 1S/C6H8O6/c7-1-2(8)5-3(9)4(10)6(11)12-5/h2,5,7-10H,1H2/t2-,5+/m0/s1 |
|
| BoilingPt = 96–98 °C |
|
|
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| Boiling_notes = 8 mmHg |
|
|
|
| StdInChIKey = CIWBSHSKHKDKBQ-JLAZNSOCSA-N |
|
| Solubility = |
|
|
|
| synonyms = <small>L</small>-ascorbic acid |
|
| SolubleOther = |
|
|
| Solvent = |
|
| density = 1.694 |
|
| LogP = |
|
| melting_point = 190 |
|
| VaporPressure = |
|
| boiling_point = 553 |
|
| HenryConstant = |
|
|
| AtmosphericOHRateConstant = |
|
|
| pKa = |
|
|
| pKb = }} |
|
|
| Section3 = {{Chembox Structure |
|
|
| CrystalStruct = |
|
|
| Coordination = |
|
|
| MolShape = }} |
|
|
| Section4 = {{Chembox Thermochemistry |
|
|
| DeltaHf = |
|
|
| DeltaHc = |
|
|
| Entropy = |
|
|
| HeatCapacity = }} |
|
|
| Section5 = {{Chembox Pharmacology |
|
|
| AdminRoutes = |
|
|
| Bioavail = |
|
|
| Metabolism = |
|
|
| HalfLife = |
|
|
| ProteinBound = |
|
|
| Excretion = |
|
|
| Legal_status = |
|
|
| Legal_US = |
|
|
| Legal_UK = |
|
|
| Legal_AU = |
|
|
| Legal_CA = |
|
|
| PregCat = |
|
|
| PregCat_AU = |
|
|
| PregCat_US = }} |
|
|
| Section6 = {{Chembox Explosive |
|
|
| ShockSens = |
|
|
| FrictionSens = |
|
|
| ExplosiveV = |
|
|
| REFactor = }} |
|
|
| Section7 = {{Chembox Hazards |
|
|
| ExternalMSDS = |
|
|
| EUClass = |
|
|
| EUIndex = |
|
|
| MainHazards = Xi |
|
|
| NFPA-H = |
|
|
| NFPA-F = |
|
|
| NFPA-R = |
|
|
| NFPA-O = |
|
|
| RPhrases = {{R36/37/38}} |
|
|
| SPhrases = {{S26}} {{S27}} {{S28}} {{S29}} {{S30}} {{S33}} {{S35}} {{S36}} |
|
|
| RSPhrases = |
|
|
| FlashPt = 112 °C (closed cup) |
|
|
| Autoignition = |
|
|
| ExploLimits = |
|
|
| LD50 = |
|
|
| PEL = }} |
|
|
| Section8 = {{Chembox Related |
|
|
| OtherAnions = |
|
|
| OtherCations = |
|
|
| OtherFunctn = |
|
|
| Function = |
|
|
| OtherCpds = }} |
|
|
}} |
|
}} |