Revision as of 12:38, 15 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 476320526 of page Boric_acid for the Chem/Drugbox validation project (updated: '').← Previous edit |
Latest revision as of 14:25, 29 January 2022 edit undo119.246.116.98 (talk)No edit summary |
Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{Chembox |
|
{{drugbox |
|
| verifiedrevid = 464184931 |
|
| verifiedrevid = 477001424 |
|
|
| IUPAC_name = 2-Oxo-<small>L</small>-threo-hexono-1,4-lactone-2,3-enediol<br />''or''<br />(''R'')-3,4-dihydroxy-5-((''S'')- 1,2-dihydroxyethyl)furan-2(5''H'')-one |
|
| ImageFileL1_Ref = {{chemboximage|correct|??}} |
|
|
|
| image = L-Ascorbic_acid.svg |
|
| ImageFileL1 = Boric-acid-2D.png |
|
|
| ImageSizeL1 = 100px |
|
| width = 200px |
|
|
| image2 = Ascorbic-acid-from-xtal-1997-3D-balls.png |
|
| ImageNameL1 = Structural formula |
|
|
|
| width2 = 200px |
|
| ImageFileR1 = Boric-acid-3D-vdW.png |
|
|
|
|
|
| ImageSizeR1 = 120px |
|
|
|
<!--Clinical data--> |
|
| ImageNameR1 = Space-filling model |
|
|
|
| Drugs.com = {{drugs.com|MTM|vitamin_c}} |
|
| ImageFile2 = Boric acid.jpg |
|
|
|
| licence_EU = <!-- EMEA requires brand name --> |
|
| ImageSize2 = 150px |
|
|
|
| licence_US = <!-- FDA may use generic name --> |
|
| ImageName2 = Boric acid crystals |
|
|
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| IUPACName = Boric acid<br />Trihydroxidoboron<!-- This second IUPAC name has not been validated --> |
|
|
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| OtherNames = Orthoboric acid,<br/>Boracic acid,<br/>Sassolite,<br/>Optibor,<br/>Borofax |
|
|
|
| pregnancy_category = A |
|
| Section1 = {{Chembox Identifiers |
|
|
|
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
|
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| ChemSpiderID = 7346 |
|
|
|
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> |
|
| PubChem = 7628 |
|
|
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| SMILES1 = B(O)(O)O |
|
|
|
| legal_status = general public availability |
|
|
| routes_of_administration = oral |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
|
| bioavailability = rapid & complete |
|
|
| protein_bound = negligible |
|
|
| elimination_half-life = varies according to plasma concentration <!-- can be 30 min to weeks, depending on body stores --> |
|
|
| excretion = renal |
|
|
|
|
|
<!--Identifiers--> |
|
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
|
| CAS_number = 50-81-7 |
|
|
| ATC_prefix = A |
|
|
| ATC_suffix = 11G |
|
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
|
| ChEBI = 29073 |
|
|
| PubChem = 5785 |
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
|
| DrugBank = DB00126 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
| ChemSpiderID = 10189562 |
|
|
| NIAID_ChemDB = 002072 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = PQ6CK8PD0R |
|
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
|
| KEGG = D00018 |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL = 42403 |
|
| ChEMBL = 196 |
|
|
|
|
|
<!--Chemical data--> |
|
|
| chemical_formula = |
|
|
| C=6 | H=7 | O=6 |
|
|
| molecular_weight = 176.12 g/] |
|
|
| smiles = C((1C(=C(C(=O)O1)O)O)O)O |
|
|
| InChI = 1/C6H8O6/c7-1-2(8)5-3(9)4(10)6(11)12-5/h2,5,7-10H,1H2/t2-,5+/m0/s1 |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/BH3O3/c2-1(3)4/h2-4H |
|
| StdInChI = 1S/C6H8O6/c7-1-2(8)5-3(9)4(10)6(11)12-5/h2,5,7-10H,1H2/t2-,5+/m0/s1 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = KGBXLFKZBHKPEV-UHFFFAOYSA-N |
|
| StdInChIKey = CIWBSHSKHKDKBQ-JLAZNSOCSA-N |
|
|
| synonyms = <small>L</small>-ascorbic acid |
|
| CASNo = 10043-35-3 |
|
|
|
| density = 1.694 |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
|
|
| melting_point = 190 |
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
|
| ChEBI = 33118 |
|
| boiling_point = 553 |
|
| SMILES = OB(O)O |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = R57ZHV85D4 |
|
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
|
| KEGG = D01089 |
|
|
| InChI=1/BH3O3/c2-1(3)4/h2-4H |
|
|
| InChIKey = KGBXLFKZBHKPEV-UHFFFAOYAI |
|
|
| EINECS = 233-139-2 |
|
|
}} |
|
|
| Section2 = {{Chembox Properties |
|
|
| H = 3 | B = 1 | O = 3 |
|
|
| Appearance = White crystalline solid |
|
|
| Density = 1.435 g/cm<sup>3</sup> |
|
|
| Solubility = 2.52 g/100 mL (0 °C) <br> 4.72 g/100 mL (20 °C) <br> 5.7 g/100 mL (25 °C) <br> 19.10 g/100 mL (80 °C) <br> 27.53 g/100 mL (100 °C) |
|
|
| SolubleOther = Soluble in lower ]s <br> moderately soluble in ] <br> very slightly soluble in ] |
|
|
| Solvent = other solvents |
|
|
| MeltingPtC = 170.9 |
|
|
| BoilingPtC = 300 |
|
|
| pKa = 9.24 (''see text'') |
|
|
}} |
|
|
| Section3 = {{Chembox Structure |
|
|
| MolShape = Trigonal planar |
|
|
| Dipole = Zero |
|
|
}} |
|
|
| Section7 = {{Chembox Hazards |
|
|
| EUClass = Harmful ('''Xn''')<br/>Repr. Cat. 2 |
|
|
| RPhrases = {{R60}} {{R61}} |
|
|
| SPhrases = {{S53}} {{S45}} |
|
|
| NFPA-H = 1 |
|
|
| NFPA-F = 0 |
|
|
| NFPA-R = 0 |
|
|
| FlashPt = Non-flammable. |
|
|
| LD50 = 2660 mg/kg, oral (rat) |
|
|
}} |
|
|
| Section8 = {{Chembox Related |
|
|
| OtherCpds = ]<br/>]}} |
|
|
}} |
|
}} |