Misplaced Pages

:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions - Misplaced Pages

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
< Misplaced Pages:WikiProject Chemicals | Chembox validation Browse history interactively← Previous editContent deleted Content addedVisualWikitext
Revision as of 12:54, 15 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 472883278 of page Barium_sulfate for the Chem/Drugbox validation project (updated: '').← Previous edit Latest revision as of 14:25, 29 January 2022 edit undo119.246.116.98 (talk)No edit summary 
Line 1: Line 1:
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} {{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}}
{{chembox {{drugbox
| verifiedrevid = 477001424
| Watchedfields = changed
| IUPAC_name = 2-Oxo-<small>L</small>-threo-hexono-1,4-lactone-2,3-enediol<br />''or''<br />(''R'')-3,4-dihydroxy-5-((''S'')- 1,2-dihydroxyethyl)furan-2(5''H'')-one
| verifiedrevid = 443637235
| image = L-Ascorbic_acid.svg
| ImageFile = Barium-sulfate-2D.png
| ImageSize = 225px | width = 200px
| image2 = Ascorbic-acid-from-xtal-1997-3D-balls.png
| ImageName = Chemical structure of barium sulfate
| width2 = 200px
| ImageFileL2 = Barite-unit-cell-3D-vdW.png

| ImageSizeL2 = 120px
<!--Clinical data-->
| ImageNameL2 = 3D model of barium sulfate
| Drugs.com = {{drugs.com|MTM|vitamin_c}}
| ImageFileR2 = Bariumsulfatpulver.png
| licence_EU = <!-- EMEA requires brand name -->
| ImageSizeR2 = 120px
| licence_US = <!-- FDA may use generic name -->
| IUPACName =
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| OtherNames =
| pregnancy_US = <!-- A / B / C / D / X -->
| Section1 = {{Chembox Identifiers
| Abbreviations = | pregnancy_category = A
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C -->
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
| legal_status = general public availability
| routes_of_administration = oral

<!--Pharmacokinetic data-->
| bioavailability = rapid & complete
| protein_bound = negligible
| elimination_half-life = varies according to plasma concentration <!-- can be 30 min to weeks, depending on body stores -->
| excretion = renal

<!--Identifiers-->
| CASNo_Ref = {{cascite|correct|CAS}}
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 50-81-7
| ATC_prefix = A
| ATC_suffix = 11G
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 29073
| PubChem = 5785
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB00126
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 10189562
| NIAID_ChemDB = 002072
| UNII_Ref = {{fdacite|correct|FDA}} | UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 25BB7EKE2E | UNII = PQ6CK8PD0R
| KEGG_Ref = {{keggcite|correct|kegg}}
| InChIKey = TZCXTZWJZNENPQ-NUQVWONBAD
| KEGG = D00018
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 196

<!--Chemical data-->
| chemical_formula =
| C=6 | H=7 | O=6
| molecular_weight = 176.12 g/]
| smiles = C((1C(=C(C(=O)O1)O)O)O)O
| InChI = 1/C6H8O6/c7-1-2(8)5-3(9)4(10)6(11)12-5/h2,5,7-10H,1H2/t2-,5+/m0/s1
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/Ba.H2O4S/c;1-5(2,3)4/h;(H2,1,2,3,4)/q+2;/p-2 | StdInChI = 1S/C6H8O6/c7-1-2(8)5-3(9)4(10)6(11)12-5/h2,5,7-10H,1H2/t2-,5+/m0/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = TZCXTZWJZNENPQ-UHFFFAOYSA-L | StdInChIKey = CIWBSHSKHKDKBQ-JLAZNSOCSA-N
| synonyms = <small>L</small>-ascorbic acid
| CASNo = 7727-43-7
| density = 1.694
| CASNo_Ref = {{cascite|correct|CAS}}
| melting_point = 190
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| boiling_point = 553
| ChemSpiderID=22823
| EINECS =
| PubChem = 24414
| SMILES = .S()(=O)=O
| InChI = 1/Ba.H2O4S/c;1-5(2,3)4/h;(H2,1,2,3,4)/q+2;/p-2
| RTECS = CR060000
| MeSHName =
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI =
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG =
| ATCCode_prefix = V08
| ATCCode_suffix = BA01
| ATC_Supplemental =}}
| Section2 = {{Chembox Properties
| Formula = BaSO<sub>4</sub>
| MolarMass = 233.43 g/mol
| Appearance = white crystalline
| Odor = odorless
| Density = 4.5 g/cm<sup>3</sup>
| MeltingPt = 1345 °C
| Melting_notes =
| BoilingPt = 1600 °C (decomp)
| Boiling_notes =
| Solubility = 0.0002448 g/100 mL (20 °C) <br> 0.000285 g/100 mL (30 °C)
| SolubilityProduct = 1.0842 × 10<sup>-10</sup> (25 °C)
| SolubleOther = insoluble in ],<ref>{{cite book
| title = CRC Handbook of Chemistry and Physics
| publisher = CRC Press
| date = 2004,85th Edition
| pages = 4–45
| isbn = 0-8493-0485-7}}</ref> soluble in concentrated ]
| Solvent =
| pKa =
| pKb =
| RefractIndex = 1.64
}}
| Section4 = {{Chembox Thermochemistry
| DeltaHf = −1465&nbsp;kJ·mol<sup>−1</sup><ref>{{cite book| author = Zumdahl, Steven S.|title =Chemical Principles 6th Ed.| publisher = Houghton Mifflin Company| year = 2009| isbn = 061894690X}}</ref>
| Entropy = 132&nbsp;J·mol<sup>−1</sup>·K<sup>−1</sup><ref>{{cite book| author = Zumdahl, Steven S.|title =Chemical Principles 6th Ed.| publisher = Houghton Mifflin Company| year = 2009| isbn = 061894690X}}</ref>
}}
| Section5 = {{Chembox Pharmacology
| AdminRoutes =
| Bioavail = negligible orally
| Metabolism =
| HalfLife =
| ProteinBound =
| Excretion =
| Legal_status =
| Legal_US =
| Legal_UK =
| Legal_AU =
| Legal_CA =
| PregCat =
| PregCat_AU =
| PregCat_US = }}
| Section7 = {{Chembox Hazards
| EUClass = not listed
| EUIndex =
| MainHazards =
| NFPA-H = 0
| NFPA-F = 0
| NFPA-R = 0
| NFPA-O =
| RPhrases =
| SPhrases =
| RSPhrases =
| FlashPt =
| Autoignition =
| ExploLimits =
| PEL = }}
}} }}

Latest revision as of 14:25, 29 January 2022

This page contains a copy of the infobox ({{drugbox}}) taken from revid 477243833 of page Vitamin_C with values updated to verified values.
WikiProject Chemicals/Chembox validation/VerifiedDataSandbox
Clinical data
Other namesL-ascorbic acid
AHFS/Drugs.comMultum Consumer Information
Pregnancy
category
  • A
Routes of
administration		oral
ATC code
Legal status
Legal status
  • general public availability
Pharmacokinetic data
Bioavailabilityrapid & complete
Protein bindingnegligible
Elimination half-lifevaries according to plasma concentration
Excretionrenal
Identifiers
IUPAC name
  • 2-Oxo-L-threo-hexono-1,4-lactone-2,3-enediol
    or
    (R)-3,4-dihydroxy-5-((S)- 1,2-dihydroxyethyl)furan-2(5H)-one
CAS Number
PubChem CID
DrugBank
ChemSpider
UNII
KEGG
ChEBI
ChEMBL
NIAID ChemDB
Chemical and physical data
FormulaC6H7O6
Molar mass176.12 g/mole g·mol
3D model (JSmol)
Density1.694 g/cm
Melting point190 °C (374 °F)
Boiling point553 °C (1,027 °F)
SMILES
  • C((1C(=C(C(=O)O1)O)O)O)O
InChI
  • InChI=1S/C6H8O6/c7-1-2(8)5-3(9)4(10)6(11)12-5/h2,5,7-10H,1H2/t2-,5+/m0/s1
  • Key:CIWBSHSKHKDKBQ-JLAZNSOCSA-N
  (verify)