Misplaced Pages

:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions - Misplaced Pages

Article snapshot taken from[REDACTED] with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
< Misplaced Pages:WikiProject Chemicals | Chembox validation Browse history interactively← Previous editContent deleted Content addedVisualWikitext
Revision as of 13:50, 15 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,084 edits Saving copy of the {{chembox}} taken from revid 476333817 of page Ammonium_chloride for the Chem/Drugbox validation project (updated: 'ChEMBL').← Previous edit Latest revision as of 14:25, 29 January 2022 edit undo119.246.116.98 (talk)No edit summary 
Line 1: Line 1:
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} {{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}}
{{chembox {{drugbox
| verifiedrevid = 477001424
| Verifiedfields = changed
| IUPAC_name = 2-Oxo-<small>L</small>-threo-hexono-1,4-lactone-2,3-enediol<br />''or''<br />(''R'')-3,4-dihydroxy-5-((''S'')- 1,2-dihydroxyethyl)furan-2(5''H'')-one
| verifiedrevid = 464362661
| image = L-Ascorbic_acid.svg
| ImageFile = Ammonium chloride.jpg
| ImageFile1 = NH4Cl.png | width = 200px
| image2 = Ascorbic-acid-from-xtal-1997-3D-balls.png
| ImageSize =
| width2 = 200px
| IUPACName = Ammonium chloride

| OtherNames = Sal ammoniac, salmiac, nushadir salt, sal armagnac, salt armoniack
<!--Clinical data-->
| Section1 = {{Chembox Identifiers
| Drugs.com = {{drugs.com|MTM|vitamin_c}}
| licence_EU = <!-- EMEA requires brand name -->
| licence_US = <!-- FDA may use generic name -->
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US = <!-- A / B / C / D / X -->
| pregnancy_category = A
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C -->
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
| legal_status = general public availability
| routes_of_administration = oral

<!--Pharmacokinetic data-->
| bioavailability = rapid & complete
| protein_bound = negligible
| elimination_half-life = varies according to plasma concentration <!-- can be 30 min to weeks, depending on body stores -->
| excretion = renal

<!--Identifiers-->
| CASNo_Ref = {{cascite|correct|CAS}}
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 50-81-7
| ATC_prefix = A
| ATC_suffix = 11G
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 29073
| PubChem = 5785
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB00126
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 10189562
| NIAID_ChemDB = 002072
| UNII_Ref = {{fdacite|correct|FDA}} | UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 01Q9PC255D | UNII = PQ6CK8PD0R
| KEGG_Ref = {{keggcite|correct|kegg}} | KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D01139 | KEGG = D00018
| ChEMBL_Ref = {{ebicite|changed|EBI}} | ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = <!-- blanked - oldvalue: 1200939 --> | ChEMBL = 196

| InChI = 1/ClH.H3N/h1H;1H3
<!--Chemical data-->
| ChEBI_Ref = {{ebicite|correct|EBI}}
| chemical_formula =
| ChEBI = 31206
| C=6 | H=7 | O=6
| SMILES = .
| molecular_weight = 176.12 g/]
| InChIKey = NLXLAEXVIDQMFP-UHFFFAOYAI
| smiles = C((1C(=C(C(=O)O1)O)O)O)O
| InChI = 1/C6H8O6/c7-1-2(8)5-3(9)4(10)6(11)12-5/h2,5,7-10H,1H2/t2-,5+/m0/s1
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/ClH.H3N/h1H;1H3 | StdInChI = 1S/C6H8O6/c7-1-2(8)5-3(9)4(10)6(11)12-5/h2,5,7-10H,1H2/t2-,5+/m0/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = NLXLAEXVIDQMFP-UHFFFAOYSA-N | StdInChIKey = CIWBSHSKHKDKBQ-JLAZNSOCSA-N
| synonyms = <small>L</small>-ascorbic acid
| CASNo = 12125-02-9
| density = 1.694
| CASNo_Ref = {{cascite|correct|CAS}}
| melting_point = 190
| PubChem =
| boiling_point = 553
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID=23807
| RTECS = BP4550000
| EINECS = 235-186-4
| ATCCode_prefix = B05
| ATCCode_suffix = XA04
| ATC_Supplemental = {{ATC|G04|BA01}}
}}
| Section2 = {{Chembox Properties
| Formula = NH<sub>4</sub>Cl
| MolarMass = 53.491 g/mol
| Appearance = White solid <br> ]
| Odor = odorless
| Density = 1.5274 g/cm<sup>3</sup>
| MeltingPt = 338 °C (decomposes)
| Solubility = 297 g/L (0 °C) <br> 372 g/L (20 °C) <br> 773 g/L (100 °C)
| SolubleOther = 6 g/L (19 °C)
| Solvent = alcohol
| RefractIndex = 1.642
| pKa = 9.245
}}
| Section3 = {{Chembox Thermochemistry
| DeltaHf = −314.55 kJ/mol<ref name="NIST">Solid state data from {{nist|name=Ammonium chloride |id=C12125029 |accessdate=2008-10-22 |mask=1F |units=SI}}</ref>
| Entropy = 94.85 J&thinsp;K<sup>−1</sup>&thinsp;mol<sup>−1</sup> <ref name="NIST" />
}}
| Section4 = {{Chembox Hazards
| GHSPictograms = {{GHSp|GHS07}}<ref name="sigma">{{SigmaLink
| Productgroup = Fluka
| Productcode = 09718
| Accessdate = June 16, 2011
}}</ref>
| HPhrases = {{H-phrases|302|319}}<ref name="sigma" />
| PPhrases = {{P-phrases|305+351+338}}<ref name="sigma" />
| ExternalMSDS =
| EUClass = Harmful ('''Xn''')<br/>Irritant ('''Xi''')
| EUIndex = 017-014-00-8
| RPhrases = {{R22}}, {{R36}}
| SPhrases = {{S2}}, {{S22}}
| NFPA-H = 1
| NFPA-F = 0
| NFPA-R = 0
| NFPA-O =
| FlashPt = Non-flammable
| LD50 = 1650 mg/kg, oral (rat)
}}
| Section8 = {{Chembox Related
| OtherAnions = ]<br/>]<br/>]
| OtherCations = ]<br/>]<br/>]
}}
}} }}

Latest revision as of 14:25, 29 January 2022

This page contains a copy of the infobox ({{drugbox}}) taken from revid 477243833 of page Vitamin_C with values updated to verified values.
WikiProject Chemicals/Chembox validation/VerifiedDataSandbox
Clinical data
Other namesL-ascorbic acid
AHFS/Drugs.comMultum Consumer Information
Pregnancy
category
  • A
Routes of
administration		oral
ATC code
Legal status
Legal status
  • general public availability
Pharmacokinetic data
Bioavailabilityrapid & complete
Protein bindingnegligible
Elimination half-lifevaries according to plasma concentration
Excretionrenal
Identifiers
IUPAC name
  • 2-Oxo-L-threo-hexono-1,4-lactone-2,3-enediol
    or
    (R)-3,4-dihydroxy-5-((S)- 1,2-dihydroxyethyl)furan-2(5H)-one
CAS Number
PubChem CID
DrugBank
ChemSpider
UNII
KEGG
ChEBI
ChEMBL
NIAID ChemDB
Chemical and physical data
FormulaC6H7O6
Molar mass176.12 g/mole g·mol
3D model (JSmol)
Density1.694 g/cm
Melting point190 °C (374 °F)
Boiling point553 °C (1,027 °F)
SMILES
  • C((1C(=C(C(=O)O1)O)O)O)O
InChI
  • InChI=1S/C6H8O6/c7-1-2(8)5-3(9)4(10)6(11)12-5/h2,5,7-10H,1H2/t2-,5+/m0/s1
  • Key:CIWBSHSKHKDKBQ-JLAZNSOCSA-N
  (verify)
Misplaced Pages:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions Add topic