| Revision as of 19:30, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 446117849 of page ABCN for the Chem/Drugbox validation project (updated: 'CASNo').← Previous edit |
Latest revision as of 14:25, 29 January 2022 edit undo119.246.116.98 (talk)No edit summary |
| (859 intermediate revisions by 8 users not shown) |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{Chembox |
|
{{drugbox |
|
|
| verifiedrevid = 477001424 |
|
| Watchedfields = changed |
|
|
|
| IUPAC_name = 2-Oxo-<small>L</small>-threo-hexono-1,4-lactone-2,3-enediol<br />''or''<br />(''R'')-3,4-dihydroxy-5-((''S'')- 1,2-dihydroxyethyl)furan-2(5''H'')-one |
|
| verifiedrevid = 415292881 |
|
|
|
| image = L-Ascorbic_acid.svg |
|
| ImageFile1 = ABCN-2D-skeletal.png |
|
|
|
| width = 200px |
|
| ImageFile1_Ref = {{chemboximage|correct|??}} |
|
|
|
| image2 = Ascorbic-acid-from-xtal-1997-3D-balls.png |
|
| ImageSize1 = |
|
|
|
| width2 = 200px |
|
| ImageName1 = Stereo, skeletal formula of ABCN |
|
|
|
|
|
| ImageFile2 = ABCN-3D-sticks.png |
|
|
|
<!--Clinical data--> |
|
| ImageFile2_Ref = {{chemboximage|correct|??}} |
|
|
|
| Drugs.com = {{drugs.com|MTM|vitamin_c}} |
|
| ImageSize2 = |
|
|
|
| licence_EU = <!-- EMEA requires brand name --> |
|
| ImageName2 = Stick model of ABCN |
|
|
|
| licence_US = <!-- FDA may use generic name --> |
|
| ImageFile3 = ABCN-3D-vdW.png |
|
|
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| ImageFile3_Ref = {{chemboximage|correct|??}} |
|
|
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| ImageSize3 = |
|
|
|
| pregnancy_category = A |
|
| ImageName3 = Spacefill model of ABCN |
|
|
|
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
| IUPACName = 1,1'-diazene-1,2-diyldicyclohexanecarbonitrile{{Citation needed|date = June 2011}} |
|
|
|
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| Section1 = {{Chembox Identifiers |
|
|
|
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> |
|
| Abbreviations = ABCN |
|
|
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| CASNo = <!-- blanked - oldvalue: 2094-98-6 --> |
|
|
|
| legal_status = general public availability |
|
| PubChem = 74978 |
|
|
|
| routes_of_administration = oral |
|
| PubChem_Ref = {{Pubchemcite|correct|pubchem}} |
|
|
|
|
|
| ChemSpiderID = 21159585 |
|
|
|
<!--Pharmacokinetic data--> |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
|
| bioavailability = rapid & complete |
|
| ChemSpiderID2 = 21427655 |
|
|
|
| protein_bound = negligible |
|
| ChemSpiderID2_Ref = {{chemspidercite|correct|chemspider}} |
|
|
|
| elimination_half-life = varies according to plasma concentration <!-- can be 30 min to weeks, depending on body stores --> |
|
| ChemSpiderID2_Comment = <small></small> |
|
|
| ChemSpiderID1 = 67533 |
|
| excretion = renal |
|
|
|
|
| ChemSpiderID1_Ref = {{chemspidercite|correct|chemspider}} |
|
|
|
<!--Identifiers--> |
|
| ChemSpiderID1_Comment = <small></small> |
|
|
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| EINECS = 218-254-8 |
|
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| UNNumber = 3226 |
|
|
| Beilstein = 960744 |
|
| CAS_number = 50-81-7 |
|
|
| ATC_prefix = A |
|
| SMILES = N#CC1(CCCCC1)N=NC1(CCCCC1)C#N |
|
|
|
| ATC_suffix = 11G |
|
| StdInChI = 1S/C14H20N4/c15-11-13(7-3-1-4-8-13)17-18-14(12-16)9-5-2-6-10-14/h1-10H2 |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
|
| ChEBI = 29073 |
|
| InChI = 1/C14H20N4/c15-11-13(7-3-1-4-8-13)17-18-14(12-16)9-5-2-6-10-14/h1-10H2 |
|
|
|
| PubChem = 5785 |
|
| StdInChIKey = KYIKRXIYLAGAKQ-UHFFFAOYSA-N |
|
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
|
| DrugBank = DB00126 |
|
| InChIKey = KYIKRXIYLAGAKQ-UHFFFAOYAM |
|
|
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
}} |
|
|
|
| ChemSpiderID = 10189562 |
|
| Section2 = {{Chembox Properties |
|
|
|
| NIAID_ChemDB = 002072 |
|
| Formula = {{Chem|C|14|N|4|H|20}} |
|
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| MolarMass = 244.3354 g mol<sup>−1</sup> |
|
|
|
| UNII = PQ6CK8PD0R |
|
| ExactMass = 244.168796660 g mol<sup>−1</sup> |
|
|
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| MeltingPtCL = 114 |
|
|
| MeltingPtCH = 118 |
|
| KEGG = D00018 |
|
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
}} |
|
|
|
| ChEMBL = 196 |
|
| Section3 = {{Chembox Hazards |
|
|
|
|
|
| GHSPictograms = {{GHS flame}} {{GHS exclamation mark}} |
|
|
|
<!--Chemical data--> |
|
| GHSSignalWord = Danger |
|
|
|
| chemical_formula = |
|
| HPhrases = {{H-phrases|242|315|319|335}} |
|
|
|
| C=6 | H=7 | O=6 |
|
| PPhrases = {{P-phrases|261|305+351+338}} |
|
|
|
| molecular_weight = 176.12 g/] |
|
| EUClass = {{Hazchem F}} {{Hazchem Xi}} |
|
|
|
| smiles = C((1C(=C(C(=O)O1)O)O)O)O |
|
| RPhrases = {{R11}}, {{R36/37/38}} |
|
|
|
| InChI = 1/C6H8O6/c7-1-2(8)5-3(9)4(10)6(11)12-5/h2,5,7-10H,1H2/t2-,5+/m0/s1 |
|
| SPhrases = {{S26}} |
|
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
}} |
|
|
|
| StdInChI = 1S/C6H8O6/c7-1-2(8)5-3(9)4(10)6(11)12-5/h2,5,7-10H,1H2/t2-,5+/m0/s1 |
|
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
|
| StdInChIKey = CIWBSHSKHKDKBQ-JLAZNSOCSA-N |
|
|
| synonyms = <small>L</small>-ascorbic acid |
|
|
| density = 1.694 |
|
|
| melting_point = 190 |
|
|
| boiling_point = 553 |
|
}} |
|
}} |
