Misplaced Pages:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions

< Misplaced Pages:WikiProject Chemicals | Chembox validation Browse history interactively ← Previous editContent deleted Content addedVisual WikitextInline

Revision as of 04:40, 17 February 2012 editBeetstra (talk \| contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 477287673 of page Sulfur_hexafluoride for the Chem/Drugbox validation project (updated: 'UNII', 'KEGG').← Previous edit		Latest revision as of 14:25, 29 January 2022 edit undo119.246.116.98 (talk)No edit summary
(512 intermediate revisions by 8 users not shown)
Line 1:		Line 1:
	{{ambox \| text = This page contains a copy of the infobox ({{tl\|~~chembox~~}}) taken from revid of page ] with values updated to verified values.}}		{{ambox \| text = This page contains a copy of the infobox ({{tl\|drugbox}}) taken from revid of page ] with values updated to verified values.}}
	{{~~Chembox~~		{{drugbox
			\| verifiedrevid = 477001424
	\| Verifiedfields = changed
			\| IUPAC_name = 2-Oxo-<small>L</small>-threo-hexono-1,4-lactone-2,3-enediol<br />''or''<br />(''R'')-3,4-dihydroxy-5-((''S'')- 1,2-dihydroxyethyl)furan-2(5''H'')-one
	\| verifiedrevid = 476994941
			\| image = L-Ascorbic_acid.svg
	\| ImageFileL1 = Sulfur-hexafluoride-2D-dimensions.png
			\| width = 200px
	\| ImageFileL1_Ref = {{chemboximage\|correct\|??}}
			\| image2 = Ascorbic-acid-from-xtal-1997-3D-balls.png
	\| ImageSizeL1 = 121
			\| width2 = 200px
	\| ImageNameL1 = Skeletal formula of sulfur hexafluoride with assorted dimensions

	\| ImageFileR1 = Sulfur-hexafluoride-3D-vdW.png
			<!--Clinical data-->
	\| ImageFileR1_Ref = {{chemboximage\|correct\|??}}
			\| Drugs.com = {{drugs.com\|MTM\|vitamin_c}}
	\| ImageSizeR1 = 121
			\| licence_EU = <!-- EMEA requires brand name -->
	\| ImageNameR1 = Spacefill model of sulfur hexafluoride
			\| licence_US = <!-- FDA may use generic name -->
	\| ImageFile2 = Sulfur-hexafluoride-3D-balls.png
			\| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
	\| ImageFile2_Ref = {{chemboximage\|correct\|??}}
			\| pregnancy_US = <!-- A / B / C / D / X -->
	\| ImageSize2 = 121
			\| pregnancy_category = A
	\| ImageName2 = Ball and stick model of sulfur hexafluoride
			\| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
	\| IUPACName = Sulfur hexafluoride
			\| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII -->
	\| SystematicName = Hexafluoro-λ<sup>6</sup>-sulfane<ref>{{Cite web\|title = Sulfur Hexafluoride - PubChem Public Chemical Database\|url = http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=17358\|work = The PubChem Project\|location = USA\|publisher = National Center for Biotechnology Information}}</ref>
			\| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C -->
	\| OtherNames = Elagas<br />
			\| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
	Esaflon<br />
			\| legal_status = general public availability
	Sulfur(VI) fluoride<br />
			\| routes_of_administration = oral
	Sulfuric fluoride

	\| Section1 = {{Chembox Identifiers
			<!--Pharmacokinetic data-->
	\| CASNo = 2551-62-4
			\| bioavailability = rapid & complete
	\| CASNo_Ref = {{cascite\|correct\|CAS}}
			\| protein_bound = negligible
	\| PubChem = 17358
			\| elimination_half-life = varies according to plasma concentration <!-- can be 30 min to weeks, depending on body stores -->
	\| PubChem_Ref = {{Pubchemcite}}
	\| ~~ChemSpiderID~~ = ~~16425~~		\| excretion = renal

	\| ChemSpiderID_Ref = {{chemspidercite\|correct\|chemspider}}
			<!--Identifiers-->
	\| UNII = <!-- blanked - oldvalue: WS7LR3I1D6 -->
	\| ~~UNII_Ref~~ = {{~~fdacite~~\|~~changed~~\|~~FDA~~}}		\| CASNo_Ref = {{cascite\|correct\|CAS}}
			\| CAS_number_Ref = {{cascite\|correct\|??}}
	\| EINECS = 219-854-2
	\| ~~UNNumber~~ = ~~1080~~		\| CAS_number = 50-81-7
			\| ATC_prefix = A
	\| KEGG = <!-- blanked - oldvalue: D05962 -->
			\| ATC_suffix = 11G
	\| KEGG_Ref = {{keggcite\|changed\|kegg}}
			\| ChEBI_Ref = {{ebicite\|correct\|EBI}}
	\| MeSHName = Sulfur+hexafluoride
			\| ChEBI = 29073
	\| ChEBI_Ref = {{ebicite\|correct\|EBI}}
	\| ~~ChEBI~~ = ~~30496~~		\| PubChem = 5785
			\| DrugBank_Ref = {{drugbankcite\|correct\|drugbank}}
	\| RTECS = WS4900000
			\| DrugBank = DB00126
	\| ATCCode_prefix = V08
			\| ChemSpiderID_Ref = {{chemspidercite\|correct\|chemspider}}
	\| ATCCode_suffix = DA05
			\| ChemSpiderID = 10189562
	\| Gmelin = 2752
			\| NIAID_ChemDB = 002072
	\| SMILES = FS(F)(F)(F)(F)F
	\| ~~StdInChI_Ref~~ = {{~~stdinchicite~~\|correct\|~~chemspider~~}}		\| UNII_Ref = {{fdacite\|correct\|FDA}}
			\| UNII = PQ6CK8PD0R
	\| StdInChI = 1S/F6S/c1-7(2,3,4,5)6
			\| KEGG_Ref = {{keggcite\|correct\|kegg}}
	\| StdInChIKey = SFZCNBIFKDRMGX-UHFFFAOYSA-N
			\| KEGG = D00018
	\| StdInChIKey_Ref = {{stdinchicite\|correct\|chemspider}}
			\| ChEMBL_Ref = {{ebicite\|correct\|EBI}}
	}}
			\| ChEMBL = 196
	\| Section2 = {{Chembox Properties

	\| F = 6
			<!--Chemical data-->
	\| S = 1
			\| chemical_formula =
	\| ExactMass = 145.962489920 g mol<sup>-1</sup>
			\| C=6 \| H=7 \| O=6
	\| Appearance = Colorless, odorless gas
			\| molecular_weight = 176.12 g/]
	\| Density = 6.17 g/l
			\| smiles = C((1C(=C(C(=O)O1)O)O)O)O
	\| BoilingPtK = 209
			\| InChI = 1/C6H8O6/c7-1-2(8)5-3(9)4(10)6(11)12-5/h2,5,7-10H,1H2/t2-,5+/m0/s1
	\| VaporPressure = 2.9 kPa (at 21.1°C)
			\| StdInChI_Ref = {{stdinchicite\|correct\|chemspider}}
	}}
			\| StdInChI = 1S/C6H8O6/c7-1-2(8)5-3(9)4(10)6(11)12-5/h2,5,7-10H,1H2/t2-,5+/m0/s1
	\| Section3 = {{Chembox Structure
			\| StdInChIKey_Ref = {{stdinchicite\|correct\|chemspider}}
	\| CrystalStruct = ], ]
			\| StdInChIKey = CIWBSHSKHKDKBQ-JLAZNSOCSA-N
	\| SpaceGroup = O<sub>''h''</sub>
			\| synonyms = <small>L</small>-ascorbic acid
	\| Coordination = Orthogonal hexagonal
	\| ~~MolShape~~ = ~~Octahedral~~		\| density = 1.694
	\| ~~Dipole~~ = ~~0 D~~		\| melting_point = 190
			\| boiling_point = 553
	}}
	\| Section4 = {{Chembox Thermochemistry
	\| DeltaHf = −1209 kJ·mol<sup>−1</sup><ref name=b1>{{cite book\| author = Zumdahl, Steven S.\|title =Chemical Principles 6th Ed.\| publisher = Houghton Mifflin Company\| year = 2009\| isbn = 061894690X\|page=A23}}</ref>
	\| Entropy = 292 J·mol<sup>−1</sup>·K<sup>−1</sup><ref name=b1/>
	}}
	\| Section5 = {{Chembox Hazards
	\| ExternalMSDS =
	\| SPhrases = {{S38}}
	\| NFPA-H = 0
	\| NFPA-F = 0
	\| NFPA-R = 0
	}}
	\| Section6 = {{Chembox Related
	\| OtherCations =
	\| Function = sulfur fluorides
	\| OtherFunctn = ]<br />
	]
	\| OtherCpds = ]<br />
	]<br />
	]
	}}
	}}		}}

Latest revision as of 14:25, 29 January 2022

This page contains a copy of the infobox ({{drugbox}}) taken from revid 477243833 of page Vitamin_C with values updated to verified values.

WikiProject Chemicals/Chembox validation/VerifiedDataSandbox
Clinical data


Other names	L-ascorbic acid
AHFS/Drugs.com	Multum Consumer Information
Pregnancy category	A
Routes of administration	oral
ATC code	A11G (WHO)
Legal status
Legal status	general public availability
Pharmacokinetic data
Bioavailability	rapid & complete
Protein binding	negligible
Elimination half-life	varies according to plasma concentration
Excretion	renal
Identifiers
IUPAC name 2-Oxo-L-threo-hexono-1,4-lactone-2,3-enediol or (R)-3,4-dihydroxy-5-((S)- 1,2-dihydroxyethyl)furan-2(5H)-one
CAS Number	50-81-7
PubChem CID	5785
DrugBank	DB00126
ChemSpider	10189562
UNII	PQ6CK8PD0R
KEGG	D00018
ChEBI	CHEBI:29073
ChEMBL	ChEMBL196
NIAID ChemDB	002072
Chemical and physical data
Formula	C₆H₇O₆
Molar mass	176.12 g/mole g·mol
3D model (JSmol)	Interactive image
Density	1.694 g/cm
Melting point	190 °C (374 °F)
Boiling point	553 °C (1,027 °F)
SMILES C((1C(=C(C(=O)O1)O)O)O)O
InChI InChI=1S/C6H8O6/c7-1-2(8)5-3(9)4(10)6(11)12-5/h2,5,7-10H,1H2/t2-,5+/m0/s1 Key:CIWBSHSKHKDKBQ-JLAZNSOCSA-N
(verify)