| Revision as of 10:39, 17 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,081 edits Saving copy of the {{chembox}} taken from revid 477049904 of page 7-Hydroxymitragynine for the Chem/Drugbox validation project (updated: 'CASNo').← Previous edit |
Latest revision as of 14:25, 29 January 2022 edit undo119.246.116.98 (talk)No edit summary |
| (338 intermediate revisions by 8 users not shown) |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{Chembox |
|
{{drugbox |
|
⚫ |
| verifiedrevid = 477001424 |
|
| Verifiedfields = changed |
|
|
|
| IUPAC_name = 2-Oxo-<small>L</small>-threo-hexono-1,4-lactone-2,3-enediol<br />''or''<br />(''R'')-3,4-dihydroxy-5-((''S'')- 1,2-dihydroxyethyl)furan-2(5''H'')-one |
|
| Watchedfields = changed |
|
|
|
| image = L-Ascorbic_acid.svg |
| ⚫ |
| verifiedrevid = 452532183 |
|
|
|
| width = 200px |
|
| ImageFile = 7-Hydroxymitragynine.svg |
|
|
|
| image2 = Ascorbic-acid-from-xtal-1997-3D-balls.png |
| ⚫ |
| ImageFile_Ref = {{chemboximage|correct|??}} |
|
|
|
| width2 = 200px |
|
| ImageName = Stereo, Kekulé, skeletal formula of 7-hydroxymitragynine with an explicit hydrogen added |
|
|
|
|
|
| IUPACName = (α''E'',2''S'',3''S'',7a''S'',12b''S'')-3-Ethyl-1,2,3,4,6,7,7a,12b-octahydro-7a-hydroxy-8-methoxy-α-(methoxymethylene)indoloquinolizine-2-acetic acid methyl ester{{Citation needed|date = November 2011}} |
|
|
|
<!--Clinical data--> |
|
| OtherNames = 7α-Hydroxy-7''H''-mitragynine;<ref name=CAS>]: Columbus, OH, 2004; RN 174418-82-7 (accessed via SciFinder Scholar, version 2007.3; November 30, 2011)</ref> |
|
|
|
| Drugs.com = {{drugs.com|MTM|vitamin_c}} |
|
9-Methoxycorynantheidine hydroxyindolenine<ref name=CAS/> |
|
|
|
| licence_EU = <!-- EMEA requires brand name --> |
|
| Section1 = {{Chembox Identifiers |
|
|
| CASNo = <!-- blanked - oldvalue: 174418-82-7 --> |
|
| licence_US = <!-- FDA may use generic name --> |
|
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
| ⚫ |
| CASNo_Ref = {{cascite|correct|??}} |
|
|
|
| pregnancy_US = <!-- A / B / C / D / X --> |
| ⚫ |
| PubChem = 44301524 |
|
|
|
| pregnancy_category = A |
|
| PubChem_Ref = {{Pubchemcite|correct|Pubchem}} |
|
|
|
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
| ⚫ |
| ChemSpiderID = 23152144 |
|
|
|
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
| ⚫ |
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
|
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> |
| ⚫ |
| ChEMBL = 61630 |
|
|
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
| ⚫ |
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
|
|
| legal_status = general public availability |
|
| SMILES = CC1CN2CC3(O)C(=Nc4cccc(OC)c34)2C1\C(=C/OC)C(=O)OC |
|
|
|
| routes_of_administration = oral |
|
| SMILES1 = CC1CN2CC3(O)C(=NC4=CC=CC(OC)=C34)2C1\C(=C/OC)C(=O)OC |
|
|
|
|
|
| StdInChI = 1S/C23H30N2O5/c1-5-14-12-25-10-9-23(27)20-17(7-6-8-19(20)29-3)24-21(23)18(25)11-15(14)16(13-28-2)22(26)30-4/h6-8,13-15,18,27H,5,9-12H2,1-4H3/b16-13+/t14-,15+,18+,23+/m1/s1 |
|
|
|
<!--Pharmacokinetic data--> |
| ⚫ |
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
|
| bioavailability = rapid & complete |
| ⚫ |
| StdInChIKey = RYENLSMHLCNXJT-CYXFISRXSA-N |
|
|
|
| protein_bound = negligible |
| ⚫ |
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
|
| elimination_half-life = varies according to plasma concentration <!-- can be 30 min to weeks, depending on body stores --> |
|
}} |
|
|
|
| excretion = renal |
|
| Section2 = {{Chembox Properties |
|
|
|
|
| ⚫ |
| C=23|N=2|H=30|O=5 |
|
|
|
<!--Identifiers--> |
|
| ExactMass = 414.215472080 g mol<sup>−1</sup> |
|
|
⚫ |
| CASNo_Ref = {{cascite|correct|CAS}} |
| ⚫ |
| LogP = 1.266 |
|
|
⚫ |
| CAS_number_Ref = {{cascite|correct|??}} |
|
| pKa = 12.203 |
|
|
| pKb = 1.794 |
|
| CAS_number = 50-81-7 |
|
|
| ATC_prefix = A |
|
}} |
|
|
|
| ATC_suffix = 11G |
|
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
|
| ChEBI = 29073 |
|
⚫ |
| PubChem = 5785 |
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
|
| DrugBank = DB00126 |
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
⚫ |
| ChemSpiderID = 10189562 |
|
|
| NIAID_ChemDB = 002072 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = PQ6CK8PD0R |
|
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
|
| KEGG = D00018 |
|
⚫ |
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
⚫ |
| ChEMBL = 196 |
|
|
|
|
|
<!--Chemical data--> |
|
|
| chemical_formula = |
|
⚫ |
| C=6 | H=7 | O=6 |
|
|
| molecular_weight = 176.12 g/] |
|
|
| smiles = C((1C(=C(C(=O)O1)O)O)O)O |
|
|
| InChI = 1/C6H8O6/c7-1-2(8)5-3(9)4(10)6(11)12-5/h2,5,7-10H,1H2/t2-,5+/m0/s1 |
|
⚫ |
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
|
| StdInChI = 1S/C6H8O6/c7-1-2(8)5-3(9)4(10)6(11)12-5/h2,5,7-10H,1H2/t2-,5+/m0/s1 |
|
⚫ |
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
⚫ |
| StdInChIKey = CIWBSHSKHKDKBQ-JLAZNSOCSA-N |
|
|
| synonyms = <small>L</small>-ascorbic acid |
|
⚫ |
| density = 1.694 |
|
|
| melting_point = 190 |
|
|
| boiling_point = 553 |
|
}} |
|
}} |
