Formothion: Difference between revisions

Browse history interactively ← Previous editContent deleted Content addedVisual WikitextInline

Revision as of 20:45, 22 January 2019 editJzG (talk \| contribs)Edit filter managers, Autopatrolled, Extended confirmed users, Page movers, New page reviewers, Pending changes reviewers, Rollbackers155,091 edits Remove personal website, added stub tagTag: AWB ← Previous edit		Latest revision as of 15:11, 29 February 2024 edit undoMarbletan (talk \| contribs)Extended confirmed users5,530 edits ref
(5 intermediate revisions by 5 users not shown)
Line 2:		Line 2:
	\| ImageFile = Formothion.svg		\| ImageFile = Formothion.svg
	\| ImageSize = 200px		\| ImageSize = 200px
	\| ~~IUPACName~~ = ''S''-~~<nowiki/>{2--2-oxoethyl}~~ ''O'',''O''-~~dimethyl~~ phosphorodithioate		\| PIN = ''O'',''O''-Dimethyl ''S''- phosphorodithioate
	\| OtherNames =		\| OtherNames =
	\|Section1={{Chembox Identifiers		\|Section1={{Chembox Identifiers
	\| CASNo = 2540-82-1		\| CASNo = 2540-82-1
			\| CASNo_Ref = {{cascite\|correct\|CAS}}
			\| UNII_Ref = {{fdacite\|correct\|FDA}}
			\| UNII = 7O9EWV477R
	\| PubChem = 17345		\| PubChem = 17345
	\| ChemSpiderID = 16412		\| ChemSpiderID = 16412
Line 26:		Line 29:
	\| FlashPt =		\| FlashPt =
	\| AutoignitionPt =		\| AutoignitionPt =
			}}
			\| Section6 = {{Chembox Pharmacology
			\| Pharmacology_ref =
			\| ATCCode_prefix =
			\| ATCCode_suffix =
			\| ATC_Supplemental =
			\| ATCvet =
			\| Licence_EU =
			\| INN =
			\| INN_EMA =
			\| Licence_US =
			\| Legal_status =
			\| Legal_AU = S6
			\| Legal_AU_comment =
			\| Legal_CA =
			\| Legal_CA_comment =
			\| Legal_NZ =
			\| Legal_NZ_comment =
			\| Legal_UK =
			\| Legal_UK_comment =
			\| Legal_US =
			\| Legal_US_comment =
			\| Legal_EU =
			\| Legal_EU_comment =
			\| Legal_UN =
			\| Legal_UN_comment =
			\| Pregnancy_category =
			\| Pregnancy_AU =
			\| Pregnancy_AU_comment =
			\| Dependence_liability =
			\| AdminRoutes =
			\| Bioavail =
			\| ProteinBound =
			\| Metabolism =
			\| Metabolites =
			\| OnsetOfAction =
			\| HalfLife =
			\| DurationOfAction =
			\| Excretion =
	}}		}}
	}}		}}

	'''Formothion''' (]: C<sub>6</sub>H<sub>12</sub>NO<sub>4</sub>PS<sub>2</sub>) is a ] ~~used~~ in ]s and ].		'''Formothion''' (]: C<sub>6</sub>H<sub>12</sub>NO<sub>4</sub>PS<sub>2</sub>) is a ] with obsolete uses in ]s and ].<ref>{{cite web \| url = http://sitem.herts.ac.uk/aeru/ppdb/en/Reports/361.htm \| title = Formothion \| work = Pesticide Properties DataBase \| publisher = University of Hertfordshire }}</ref>

	==References==		==References==
Line 44:		Line 86:


	{{stub}}		{{organic-compound-stub}}

Latest revision as of 15:11, 29 February 2024

Formothion
Names

Preferred IUPAC name O,O-Dimethyl S- phosphorodithioate
Identifiers
CAS Number	2540-82-1
3D model (JSmol)	Interactive image
ChemSpider	16412
ECHA InfoCard	100.018.017
PubChem CID	17345
UNII	7O9EWV477R
CompTox Dashboard (EPA)	DTXSID4041991
InChI InChI=1S/C6H12NO4PS2/c1-7(5-8)6(9)4-14-12(13,10-2)11-3/h5H,4H2,1-3H3Key: AIKKULXCBHRFOS-UHFFFAOYSA-N InChI=1/C6H12NO4PS2/c1-7(5-8)6(9)4-14-12(13,10-2)11-3/h5H,4H2,1-3H3Key: AIKKULXCBHRFOS-UHFFFAOYAD
SMILES O=C(N(C=O)C)CSP(=S)(OC)OC
Properties
Chemical formula	C₆H₁₂NO₄PS₂
Molar mass	257.26 g·mol
Pharmacology
Legal status	AU: S6 (Poison)
Except where otherwise noted, data are given for materials in their standard state (at 25 °C , 100 kPa). Infobox references

Chemical compound

Formothion (chemical formula: C₆H₁₂NO₄PS₂) is a chemical compound with obsolete uses in acaricides and insecticides.

References

"Formothion". Pesticide Properties DataBase. University of Hertfordshire.

v t e Pest control: Insecticides
Carbamates	Aldicarb Aminocarb Bendiocarb Butocarboxim Carbaryl Carbofuran Carbosulfan m-Cumenyl methylcarbamate Ethienocarb Fenobucarb Isoprocarb Methomyl Metolcarb Oxamyl Promecarb Propoxur
Inorganic compounds	Aluminium phosphide Boric acid Chromated copper arsenate Copper(II) arsenate Copper(I) cyanide Cryolite Diatomaceous earth Lead hydrogen arsenate Paris Green Scheele's Green
Insect growth regulators	Benzoylureas (Bistrifluron, Diflubenzuron, Flufenoxuron, Lufenuron, Noviflumuron) Hydroprene Methoprene Pyriproxyfen
Neonicotinoids	Acetamiprid Clothianidin Dinotefuran Imidacloprid Imidaclothiz Nitenpyram Nithiazine Paichongding Thiacloprid Thiamethoxam
Organochlorides	Aldrin Beta-HCH Carbon tetrachloride Chlordane Cyclodiene 1,2-DCB 1,4-DCB 1,1-DCE 1,2-DCE DDD DDE DDT DFDT Dicofol Dieldrin Endosulfan Endrin Heptachlor Kepone Lindane Methoxychlor Mirex Tetradifon Toxaphene
Organophosphorus	Acephate Azamethiphos Azinphos-methyl Bensulide Chlorethoxyfos Chlorfenvinphos Chlorpyrifos Chlorpyrifos-methyl Coumaphos Demeton-S-methyl Diazinon Dichlorvos Dicrotophos Diisopropyl fluorophosphate Dimefox Dimethoate Dioxathion Disulfoton Ethion Ethoprop Fenamiphos Fenitrothion Fenthion Fosthiazate Isoxathion Malathion Methamidophos Methidathion Mevinphos Mipafox Monocrotophos Naled Omethoate Oxydemeton-methyl Parathion Parathion-methyl Phenthoate Phorate Phosalone Phosmet Phoxim Pirimiphos-methyl Quinalphos R-16661 Schradan Temefos Tebupirimfos Terbufos Tetrachlorvinphos Tribufos Trichlorfon
Pyrethroids	Acrinathrin Allethrins Bifenthrin Bioallethrin Cyfluthrin Cyhalothrin Cypermethrin Cyphenothrin Deltamethrin Empenthrin Esfenvalerate Etofenprox Fenpropathrin Fenvalerate Flumethrin Fluvalinate Imiprothrin Metofluthrin Permethrin Phenothrin Prallethrin Pyrethrin (I, II; chrysanthemic acid) Pyrethrum Resmethrin Silafluofen Tefluthrin Tetramethrin Tralomethrin Transfluthrin
Diamides	Chlorantraniliprole Cyantraniliprole Flubendiamide
Other chemicals	Afoxolaner Amitraz Azadirachtin Bensultap Buprofezin Cartap Chlordimeform Chlorfenapyr Cyromazine Fenazaquin Fenoxycarb Fipronil Fluralaner Hydramethylnon Indoxacarb Limonene Lotilaner (+milbemycin oxime) Pyridaben Pyriprole Sarolaner Adjuvants (Piperonyl butoxide, Sesamex) Spinosad Sulfluramid Tebufenozide Tebufenpyrad Veracevine Xanthone Metaflumizone Ryanodine Ryanodol
Metabolites	Oxon Malaoxon Paraoxon TCPy
Biopesticides	Bacillus thuringiensis Baculovirus Beauveria bassiana Beauveria brongniartii Isaria fumosorosea Metarhizium acridum Metarhizium anisopliae Nomuraea rileyi Lecanicillium lecanii Paenibacillus popilliae Purpureocillium lilacinum Spinosad