| Revision as of 08:17, 3 November 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{drugbox}} (changes to verified fields - added verified revid - updated 'ChemSpiderID_Ref', 'DrugBank_Ref', 'UNII_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'KEGG_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'CAS_number_Ref') per [[WP:CHEMVALID|Chem/D...← Previous edit | Revision as of 09:01, 3 November 2011 edit undoAnypodetos (talk | contribs)Autopatrolled, Extended confirmed users, Pending changes reviewers, Rollbackers39,350 edits See also; categoriesNext edit → | ||
| Line 1: | Line 1: | ||
| {{Drugbox | {{Drugbox | ||
| | Verifiedfields = changed | |||
| | verifiedrevid = 458773847 | |||
| | IUPAC_name = 3-{6-{amino}-3-methylpyridin-2-yl}benzoic acid | | IUPAC_name = 3-{6-{amino}-3-methylpyridin-2-yl}benzoic acid | ||
| | image = VX-807 skeletal.svg | | image = VX-807 skeletal.svg | ||
| Line 29: | Line 27: | ||
| <!--Identifiers--> | <!--Identifiers--> | ||
| | CAS_number_Ref = {{cascite|changed|??}} | |||
| | CAS_number = 936727-05-8 | | CAS_number = 936727-05-8 | ||
| | ATCvet = | | ATCvet = | ||
| Line 35: | Line 32: | ||
| | ATC_suffix = | | ATC_suffix = | ||
| | PubChem = 16678941 | | PubChem = 16678941 | ||
| | DrugBank_Ref = {{drugbankcite|correct|drugbank}} | |||
| | DrugBank = | | DrugBank = | ||
| Line 42: | Line 38: | ||
| | molecular_weight = 452.407 g/mol | | molecular_weight = 452.407 g/mol | ||
| | smiles = CC1=C(N=C(C=C1)NC(=O)C2(CC2)C3=CC4=C(C=C3)OC(O4)(F)F)C5=CC(=CC=C5)C(=O)O | | smiles = CC1=C(N=C(C=C1)NC(=O)C2(CC2)C3=CC4=C(C=C3)OC(O4)(F)F)C5=CC(=CC=C5)C(=O)O | ||
| | StdInChI_Ref = {{stdinchicite|changed|chemspider}} | |||
| | StdInChI = 1S/C24H18F2N2O5/c1-13-5-8-19(27-20(13)14-3-2-4-15(11-14)21(29)30)28-22(31)23(9-10-23)16-6-7-17-18(12-16)33-24(25,26)32-17h2-8,11-12H,9-10H2,1H3,(H,29,30)(H,27,28,31) | | StdInChI = 1S/C24H18F2N2O5/c1-13-5-8-19(27-20(13)14-3-2-4-15(11-14)21(29)30)28-22(31)23(9-10-23)16-6-7-17-18(12-16)33-24(25,26)32-17h2-8,11-12H,9-10H2,1H3,(H,29,30)(H,27,28,31) | ||
| | StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} | |||
| | StdInChIKey = UFSKUSARDNFIRC-UHFFFAOYSA-N | | StdInChIKey = UFSKUSARDNFIRC-UHFFFAOYSA-N | ||
| }} | }} | ||
| '''VX-807''' is an experimental drug for the treatment of ]. The drug is designed to be effective in patients that have the F508del mutation in the ] (CFTR), the defective protein that causes the disease. F508del, meaning that the amino acid ] in position 508 is missing, is found in about 90% of cystic fibrosis patients.<ref>{{cite journal|journal=Pharmazeutische Zeitung|language=German|authors=Merk; Schubert-Zsilavecz|volume=156|issue=37|pages=24–27}}</ref> | '''VX-807''' is an experimental drug for the treatment of ]. The drug is designed to be effective in patients that have the F508del mutation in the ] (CFTR), the defective protein that causes the disease. F508del, meaning that the amino acid ] in position 508 is missing, is found in about 90% of cystic fibrosis patients.<ref>{{cite journal|journal=Pharmazeutische Zeitung|language=German|authors=Merk; Schubert-Zsilavecz|volume=156|issue=37|pages=24–27}}</ref> | ||
| ==See also== | |||
| * ], targeting nonsense mutations | |||
| * ], targeting the G551D mutation | |||
| ==References== | ==References== | ||
| {{Reflist}} | {{Reflist}} | ||
| ] | |||
| {{Uncategorized stub|date=November 2011}} | |||
| ] | |||
Revision as of 09:01, 3 November 2011
{{Drugbox | IUPAC_name = 3-{6-{amino}-3-methylpyridin-2-yl}benzoic acid | image = VX-807 skeletal.svg | alt = | caption =
| tradename = | Drugs.com = | MedlinePlus = | pregnancy_AU = | pregnancy_US = | pregnancy_category= | legal_AU = | legal_CA = | legal_UK = | legal_US = | legal_status = Investigational | routes_of_administration =
| bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion =
| CAS_number = 936727-05-8 | ATCvet = | ATC_prefix = None | ATC_suffix = | PubChem = 16678941 | DrugBank =
| C=24|H=18|F=2|N=2|O=5 | molecular_weight = 452.407 g/mol | smiles = CC1=C(N=C(C=C1)NC(=O)C2(CC2)C3=CC4=C(C=C3)OC(O4)(F)F)C5=CC(=CC=C5)C(=O)O | StdInChI = 1S/C24H18F2N2O5/c1-13-5-8-19(27-20(13)14-3-2-4-15(11-14)21(29)30)28-22(31)23(9-10-23)16-6-7-17-18(12-16)33-24(25,26)32-17h2-8,11-12H,9-10H2,1H3,(H,29,30)(H,27,28,31) | StdInChIKey = UFSKUSARDNFIRC-UHFFFAOYSA-N }}
VX-807 is an experimental drug for the treatment of cystic fibrosis. The drug is designed to be effective in patients that have the F508del mutation in the cystic fibrosis transmembrane conductance regulator (CFTR), the defective protein that causes the disease. F508del, meaning that the amino acid phenylalanin in position 508 is missing, is found in about 90% of cystic fibrosis patients.
See also
References
- Pharmazeutische Zeitung (in German). 156 (37): 24–27.
{{cite journal}}: Missing or empty|title=(help); Unknown parameter|authors=ignored (help)
 | This pharmacology-related article is a stub. You can help Misplaced Pages by expanding it. |