Revision as of 11:39, 17 November 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,084 edits Saving copy of the {{drugbox}} taken from revid 447380566 of page Ethosuximide for the Chem/Drugbox validation project (updated: 'DrugBank').← Previous edit |
Revision as of 11:40, 17 November 2011 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,084 edits Saving copy of the {{drugbox}} taken from revid 447436081 of page Ethotoin for the Chem/Drugbox validation project (updated: 'DrugBank').Next edit → |
Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{Drugbox |
|
{{Drugbox |
|
| verifiedrevid = 443742615 |
|
| verifiedrevid = 443742864 |
|
| IUPAC_name = (''RS'')-3-ethyl-3-methyl-pyrrolidine-2,5-dione |
|
| IUPAC_name = 3-ethyl-5-phenyl-imidazolidine-2,4-dione |
|
| image = Ethosuximide.png |
|
| image = Ethotoin structure.png |
|
| width = 120px |
|
| width = 201 |
|
| imagename = 1 : 1 mixture (racemate) |
|
|
| drug_name = Ethosuximide |
|
|
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
| tradename = Zarontin |
|
| tradename = |
|
| Drugs.com = {{drugs.com|monograph|ethosuximide}} |
|
| Drugs.com = {{drugs.com|CDI|ethotoin}} |
|
| MedlinePlus = a682327 |
|
| MedlinePlus = a682022 |
|
| pregnancy_category = D <small>(Australia, United States)</small> |
|
| pregnancy_category = C |
|
| legal_status = ] <small>(U.S.)</small> |
|
| legal_status = |
|
| routes_of_administration = Oral |
|
| routes_of_administration = Oral |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
<!--Pharmacokinetic data--> |
|
| bioavailability = 93%{{ref|bioavailability}} |
|
| bioavailability = |
|
|
| protein_bound = |
|
| metabolism = ] (], ]) |
|
|
|
| metabolism = |
|
| elimination_half-life = 53 hours |
|
| elimination_half-life = 3 to 9 hours |
|
| excretion = ] (20%) |
|
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CAS_number = 77-67-8 |
|
| CAS_number = 86-35-1 |
|
| ATC_prefix = N03 |
|
| ATC_prefix = N03 |
|
| ATC_suffix = AD01 |
|
| ATC_suffix = AB01 |
|
|
| ATC_supplemental = |
|
| PubChem = 3291 |
|
| PubChem = 3292 |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank = DB00593 |
|
| DrugBank = DB00754 |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 3175 |
|
| ChemSpiderID = 3176 |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = 5SEH9X1D1D |
|
| UNII = 46QG38NC4U |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG = D00539 |
|
| KEGG = D00708 |
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| ChEBI = 4887 |
|
| ChEBI = 4888 |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL = 696 |
|
| ChEMBL = 1095 |
|
|
|
|
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=7 | H=11 | N=1 | O=2 |
|
| C=11 | H=12 | N=2 | O=2 |
|
| molecular_weight = 141.168 ]/] |
|
| molecular_weight = 204.225 g/mol |
|
| smiles = O=C1NC(=O)CC1(C)CC |
|
| smiles = O=C2NC(c1ccccc1)C(=O)N2CC |
|
| InChI = 1/C7H11NO2/c1-3-7(2)4-5(9)8-6(7)10/h3-4H2,1-2H3,(H,8,9,10) |
|
| InChI = 1/C11H12N2O2/c1-2-13-10(14)9(12-11(13)15)8-6-4-3-5-7-8/h3-7,9H,2H2,1H3,(H,12,15) |
|
| InChIKey = HAPOVYFOVVWLRS-UHFFFAOYAB |
|
| InChIKey = SZQIFWWUIBRPBZ-UHFFFAOYAG |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C7H11NO2/c1-3-7(2)4-5(9)8-6(7)10/h3-4H2,1-2H3,(H,8,9,10) |
|
| StdInChI = 1S/C11H12N2O2/c1-2-13-10(14)9(12-11(13)15)8-6-4-3-5-7-8/h3-7,9H,2H2,1H3,(H,12,15) |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = HAPOVYFOVVWLRS-UHFFFAOYSA-N |
|
| StdInChIKey = SZQIFWWUIBRPBZ-UHFFFAOYSA-N |
|
}} |
|
}} |