Revision as of 12:09, 17 November 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 447435911 of page Felbamate for the Chem/Drugbox validation project (updated: 'DrugBank').← Previous edit |
Revision as of 12:09, 17 November 2011 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 447131021 of page Felodipine for the Chem/Drugbox validation project (updated: 'DrugBank').Next edit → |
Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{Drugbox |
|
{{Drugbox |
|
| verifiedrevid = 443752184 |
|
| verifiedrevid = 411546831 |
|
|
| IUPAC_name = 3-ethyl 5-methyl 4-(2,3-dichlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate |
|
| IUPAC_name = ''(3-carbamoyloxy-2-phenylpropyl) carbamate'' |
|
|
| image = Felbamate.svg |
|
| image = Felodipine.png |
|
|
| image2 = Felodipine-from-xtal-1989-3D-balls.png |
|
| width = 150px |
|
|
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
| tradename = Felbatol |
|
| tradename = Plendil |
|
| Drugs.com = {{drugs.com|monograph|felbamate}} |
|
| Drugs.com = {{drugs.com|monograph|felodipine}} |
|
| MedlinePlus = a606011 |
|
| MedlinePlus = a692016 |
|
|
| pregnancy_US = C |
|
| pregnancy_category = C (]) |
|
|
| legal_status = Unscheduled |
|
| legal_status = Rx-only |
|
| routes_of_administration = Oral |
|
| routes_of_administration = ] |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
<!--Pharmacokinetic data--> |
|
| bioavailability = > 90% |
|
| bioavailability = 15% <ref>AstraZeneca MI Department, 16th April 2010</ref> |
|
| metabolism = ] |
|
| metabolism = ] |
|
| elimination_half-life = 20-23 hours |
|
| elimination_half-life = ?? |
|
| excretion = ? |
|
| excretion = ] |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CAS_number = 25451-15-4 |
|
| CAS_number = 72509-76-3 |
|
| ATC_prefix = N03 |
|
| ATC_prefix = C08 |
|
| ATC_suffix = AX10 |
|
| ATC_suffix = CA02 |
|
| PubChem = 3331 |
|
| PubChem = 3333 |
|
⚫ |
| DrugBank = DB01023 |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
⚫ |
| DrugBank = DB00949 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 3214 |
|
| ChemSpiderID = 3216 |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = X72RBB02N8 |
|
| UNII = OL961R6O2C |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG = D00536 |
|
| KEGG = D00319 |
|
⚫ |
| ChEBI = 585948 |
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
⚫ |
| ChEBI = 4995 |
|
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL = 1094 |
|
| ChEMBL = 1480 |
|
|
|
|
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=11 | H=14 | N=2 | O=4 |
|
| C=18 | H=19 | Cl=2 | N=1 | O=4 |
|
| molecular_weight = 238.24 |
|
| molecular_weight = 384.259 g/mol |
|
| smiles = O=C(OCC(c1ccccc1)COC(=O)N)N |
|
| smiles = O=C(OCC)\C1=C(\N/C(=C(/C(=O)OC)C1c2cccc(Cl)c2Cl)C)C |
|
| InChI = 1/C11H14N2O4/c12-10(14)16-6-9(7-17-11(13)15)8-4-2-1-3-5-8/h1-5,9H,6-7H2,(H2,12,14)(H2,13,15) |
|
| InChI = 1/C18H19Cl2NO4/c1-5-25-18(23)14-10(3)21-9(2)13(17(22)24-4)15(14)11-7-6-8-12(19)16(11)20/h6-8,15,21H,5H2,1-4H3 |
|
| InChIKey = WKGXYQFOCVYPAC-UHFFFAOYAJ |
|
| InChIKey = RZTAMFZIAATZDJ-UHFFFAOYAS |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C11H14N2O4/c12-10(14)16-6-9(7-17-11(13)15)8-4-2-1-3-5-8/h1-5,9H,6-7H2,(H2,12,14)(H2,13,15) |
|
| StdInChI = 1S/C18H19Cl2NO4/c1-5-25-18(23)14-10(3)21-9(2)13(17(22)24-4)15(14)11-7-6-8-12(19)16(11)20/h6-8,15,21H,5H2,1-4H3 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = WKGXYQFOCVYPAC-UHFFFAOYSA-N |
|
| StdInChIKey = RZTAMFZIAATZDJ-UHFFFAOYSA-N |
|
}} |
|
}} |