Misplaced Pages

:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions - Misplaced Pages

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
< Misplaced Pages:WikiProject Chemicals | Chembox validation Browse history interactively← Previous editNext edit →Content deleted Content addedVisualWikitext
Revision as of 15:30, 17 November 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 455561019 of page Glucono_delta-lactone for the Chem/Drugbox validation project (updated: 'ChEMBL').← Previous edit Revision as of 15:31, 17 November 2011 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 454169010 of page Glucosamine for the Chem/Drugbox validation project (updated: 'ChemSpiderID', 'ChEMBL', 'ChEBI', 'KEGG', 'StdInChI', 'StdInChIKe...Next edit →
Line 1: Line 1:
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} {{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}}
{{chembox {{Chembox
| Verifiedfields = changed | Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 396144453 | verifiedrevid = 399902425
| Reference = <ref>{{Merck13th|4469}}.</ref><ref>Beil. '''18''', V, 5, 11</ref>
| ImageFileL1 = Alpha-D-glucosamine.png
| Name = <small>D</small>-Gluconic acid δ-lactone
| ImageFileL1_Ref = {{Chemboximage|correct|??}}
| ImageFileL1 = Glucono-delta-lactone-2D-skeletal.png
| ImageSizeL1 = 120px | ImageSizeL1 = 121
| ImageNameL1 = Stereo structural formula of glucosamine ((2S,6R)-6-meth,-2-ol)
| ImageFileR1 = D-glucono-delta-lactone-3D-balls.png | ImageFileR1 = beta-D-glucosamine-3D-balls.png
| ImageSizeR1 = 120px
| ImageFileR1_Ref = {{Chemboximage|correct|??}}
| IUPACName = (3''R'',4''S'',5''S'',6''R'')-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydro-2''H''-pyran-2-one
| ImageSizeR1 = 121
| OtherNames=<small>D</small>-Glucono-1,5-lactone
| ImageNameR1 = Ball and stick model of glucosamine ((2R,6R)-6-meth,-2-ol)
| IUPACName = (3''R'',4''R'',5''S'')-3-Amino-6-(hydroxymethyl)oxane-2,4,5-triol
| OtherNames = 2-Amino-2-deoxy-glucose<br />
Chitosamine
| Section1 = {{Chembox Identifiers | Section1 = {{Chembox Identifiers
| CASNo = 3416-24-8
| CASNo_Ref = {{cascite|correct|CAS}}
| PubChem = 439213
| PubChem_Ref = {{Pubchemcite|correct|PubChem}}
| ChemSpiderID = 390201
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| UNII = N08U5BOQ1K
| UNII_Ref = {{fdacite|correct|FDA}} | UNII_Ref = {{fdacite|correct|FDA}}
| EINECS = 222-311-2
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| DrugBank_Ref = {{drugbankcite|changed|drugbank}}
| ChEMBL = <!-- blanked - oldvalue: 1200829 -->
| UNII = WQ29KQ9POT | DrugBank = DB01296
| KEGG = <!-- blanked - oldvalue: D04334 -->
| KEGG_Ref = {{keggcite|changed|kegg}} | KEGG_Ref = {{keggcite|changed|kegg}}
| KEGG = D04332
| MeSHName = Glucosamine
| InChI = 1/C6H10O6/c7-1-2-3(8)4(9)5(10)6(11)12-2/h2-5,7-10H,1H2/t2-,3-,4+,5-/m1/s1
| ChEBI_Ref = {{ebicite|changed|EBI}}
| InChIKey = PHOQVHQSTUBQQK-SQOUGZDYBO
| ChEBI = 28393
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| StdInChI = 1S/C6H10O6/c7-1-2-3(8)4(9)5(10)6(11)12-2/h2-5,7-10H,1H2/t2-,3-,4+,5-/m1/s1
| ChEMBL = <!-- blanked - oldvalue: 181132 -->
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| ATCCode_prefix = M01
| StdInChIKey = PHOQVHQSTUBQQK-SQOUGZDYSA-N
| ATCCode_suffix = AX05
| CASNo = 90-80-2
| Beilstein = 1723616
| CASNo_Ref = {{cascite|correct|CAS}}
| EC-number = 202-016-5 | Gmelin = 720725
| SMILES = N1C(O)OC(CO)(O)1O
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| StdInChI = 1S/C6H13NO5/c7-3-5(10)4(9)2(1-8)12-6(3)11/h2-6,8-11H,1,7H2/t2-,3-,4-,5-,6-/m1/s1
| ChemSpiderID = 6760
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| PubChem = 736
| StdInChIKey = MSWZFWKMSRAUBD-QZABAPFNSA-N
| DrugBank_Ref = {{drugbankcite|changed|drugbank}}
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| DrugBank = DB04564
| ChEBI_Ref = {{ebicite|changed|EBI}}
| ChEBI = 16217
| SMILES = C(1(((C(=O)O1)O)O)O)O
}} }}
| Section2 = {{Chembox Properties | Section2 = {{Chembox Properties
| C=6|H=10|O=6 | C = 6
| Appearance = | H = 13
| Density = | N = 1
| MeltingPt = | O = 5
| ExactMass = 179.079372531 g mol<sup>-1</sup>
| BoilingPt =
| Solubility = | MeltingPtC = 150
| LogP = -2.175
}}
| pKa = 12.273
| Section3 = {{Chembox Hazards
| MainHazards = | pKb = 1.724
}}
| FlashPt =
| Autoignition =
}}
}} }}

Revision as of 15:31, 17 November 2011

This page contains a copy of the infobox ({{chembox}}) taken from revid 454169010 of page Glucosamine with values updated to verified values.
WikiProject Chemicals/Chembox validation/VerifiedDataSandbox
Stereo structural formula of glucosamine ((2S,6R)-6-meth,-2-ol)
Stereo structural formula of glucosamine ((2S,6R)-6-meth,-2-ol)
Ball and stick model of glucosamine ((2R,6R)-6-meth,-2-ol)
Ball and stick model of glucosamine ((2R,6R)-6-meth,-2-ol)
Names
IUPAC name (3R,4R,5S)-3-Amino-6-(hydroxymethyl)oxane-2,4,5-triol
Other names 2-Amino-2-deoxy-glucose
Chitosamine
Identifiers
CAS Number
3D model (JSmol)
Beilstein Reference 1723616
ChEBI
ChemSpider
DrugBank
EC Number
  • 222-311-2
Gmelin Reference 720725
MeSH Glucosamine
PubChem CID
UNII
InChI
  • InChI=1S/C6H13NO5/c7-3-5(10)4(9)2(1-8)12-6(3)11/h2-6,8-11H,1,7H2/t2-,3-,4-,5-,6-/m1/s1Key: MSWZFWKMSRAUBD-QZABAPFNSA-N
SMILES
  • N1C(O)OC(CO)(O)1O
Properties
Chemical formula C6H13NO5
Molar mass 179.172 g·mol
Melting point 150 °C (302 °F; 423 K)
log P -2.175
Acidity (pKa) 12.273
Basicity (pKb) 1.724
Except where otherwise noted, data are given for materials in their standard state (at 25 °C , 100 kPa). ☒verify (what is  ?) Infobox references
Tracking categories (test):
Chemical compound