| Revision as of 10:12, 21 November 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 461587796 of page Bombesin for the Chem/Drugbox validation project (updated: 'ChEMBL', 'CASNo').← Previous edit |
Revision as of 10:15, 21 November 2011 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 461583394 of page Bemiparin_sodium for the Chem/Drugbox validation project (updated: 'CAS_number').Next edit → |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{Chembox |
|
{{Drugbox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 461586545 |
|
|
|
| Watchedfields = changed |
|
|ImageFile=Bombesin_full.png |
|
|
⚫ |
| verifiedrevid = 447909945 |
|
|ImageSize=400px |
|
|
|
| IUPAC_name = |
|
|IUPACName= |
|
|
|
| image = |
|
|OtherNames= Pyr-Gln-Arg-Leu-Gly-Asn-Gln-Trp-Ala-Val-Gly-His-Leu-Met-NH2 |
|
|
|
|
|
|Section1= {{Chembox Identifiers |
|
|
|
<!--Clinical data--> |
| ⚫ |
| CASNo_Ref = {{cascite|correct|??}} |
|
|
|
| tradename = |
| ⚫ |
| CASNo = <!-- blanked - oldvalue: 31362-50-2 --> |
|
|
|
| Drugs.com = {{drugs.com|international|bemiparin-sodium}} |
| ⚫ |
| PubChem=16133891 |
|
|
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
|
| ChEMBL = <!-- blanked - oldvalue: 437027 --> |
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
|
| pregnancy_category = |
|
| IUPHAR_ligand = 616 |
|
|
|
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
| ⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
|
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
| ⚫ |
| ChemSpiderID = 26286924 |
|
|
|
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> |
|
| SMILES = C(C(=O)N(C(C)C)C(=O)NCC(=O)N(Cc1cnc1)C(=O)N(CC(C)C)C(=O)N(CCSC)C(=O)N)NC(=O)(Cc2cc3ccccc32)NC(=O)(CCC(=O)N)NC(=O)(CC(=O)N)NC(=O)CNC(=O)(CC(C)C)NC(=O)(CCCNC(=N)N)NC(=O)(CCC(=O)N)NC(=O)4CCC(=O)N4 |
|
|
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| InChI = 1/C71H110N24O18S/c1-34(2)24-47(92-62(105)43(14-11-22-79-71(76)77)89-64(107)45(15-18-52(72)96)90-63(106)44-17-20-55(99)85-44)61(104)80-31-56(100)87-51(29-54(74)98)69(112)91-46(16-19-53(73)97)65(108)94-50(27-39-26-38-12-9-10-13-41(38)84-39)66(109)83-37(7)60(103)95-58(36(5)6)70(113)81-32-57(101)86-49(28-40-30-78-33-82-40)68(111)93-48(25-35(3)4)67(110)88-42(59(75)102)21-23-114-8/h9-10,12-13,26,30,33-37,42-51,58,84H,11,14-25,27-29,31-32H2,1-8H3,(H2,72,96)(H2,73,97)(H2,74,98)(H2,75,102)(H,78,82)(H,80,104)(H,81,113)(H,83,109)(H,85,99)(H,86,101)(H,87,100)(H,88,110)(H,89,107)(H,90,106)(H,91,112)(H,92,105)(H,93,111)(H,94,108)(H,95,103)(H4,76,77,79)/t37-,42-,43-,44-,45-,46-,47-,48-,49-,50-,51-,58-/m0/s1 |
|
|
|
| legal_status = |
|
| InChIKey = DNDCVAGJPBKION-DOPDSADYBW |
|
|
|
| routes_of_administration = |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
|
|
|
|
| StdInChI = 1S/C71H110N24O18S/c1-34(2)24-47(92-62(105)43(14-11-22-79-71(76)77)89-64(107)45(15-18-52(72)96)90-63(106)44-17-20-55(99)85-44)61(104)80-31-56(100)87-51(29-54(74)98)69(112)91-46(16-19-53(73)97)65(108)94-50(27-39-26-38-12-9-10-13-41(38)84-39)66(109)83-37(7)60(103)95-58(36(5)6)70(113)81-32-57(101)86-49(28-40-30-78-33-82-40)68(111)93-48(25-35(3)4)67(110)88-42(59(75)102)21-23-114-8/h9-10,12-13,26,30,33-37,42-51,58,84H,11,14-25,27-29,31-32H2,1-8H3,(H2,72,96)(H2,73,97)(H2,74,98)(H2,75,102)(H,78,82)(H,80,104)(H,81,113)(H,83,109)(H,85,99)(H,86,101)(H,87,100)(H,88,110)(H,89,107)(H,90,106)(H,91,112)(H,92,105)(H,93,111)(H,94,108)(H,95,103)(H4,76,77,79)/t37-,42-,43-,44-,45-,46-,47-,48-,49-,50-,51-,58-/m0/s1 |
|
|
|
<!--Pharmacokinetic data--> |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
|
|
| bioavailability = |
|
| StdInChIKey = DNDCVAGJPBKION-DOPDSADYSA-N |
|
|
|
| protein_bound = |
|
}} |
|
|
|
| metabolism = |
|
|Section2= {{Chembox Properties |
|
|
|
| elimination_half-life = |
|
| Formula=C<sub>71</sub>H<sub>110</sub>N<sub>24</sub>O<sub>18</sub>S |
|
|
|
| excretion = |
|
| MolarMass=1619.85 |
|
|
|
|
|
| Appearance= |
|
|
|
<!--Identifiers--> |
|
| Density= |
|
|
⚫ |
| CAS_number_Ref = {{cascite|correct|??}} |
|
| MeltingPt= |
|
|
⚫ |
| CAS_number = <!-- blanked - oldvalue: 91449-79-5 --> |
|
| BoilingPt= |
|
|
|
| ATC_prefix = B01 |
|
| Solubility= |
|
|
|
| ATC_suffix = AB12 |
|
}} |
|
|
⚫ |
| PubChem = |
|
|Section3= {{Chembox Hazards |
|
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| MainHazards= |
|
|
|
| DrugBank = |
|
| FlashPt= |
|
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
| Autoignition= |
|
|
⚫ |
| ChemSpiderID = NA |
|
}} |
|
|
|
|
|
|
<!--Chemical data--> |
|
|
| chemical_formula = |
|
|
| molecular_weight = 3600 ] (average) |
|
}} |
|
}} |
