| Revision as of 10:22, 21 November 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 461572631 of page Ardeparin_sodium for the Chem/Drugbox validation project (updated: 'DrugBank', 'UNII', 'ChEMBL').← Previous edit |
Revision as of 10:29, 21 November 2011 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 461556719 of page Tacrolimus for the Chem/Drugbox validation project (updated: 'UNII', 'ChEMBL').Next edit → |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{Drugbox |
|
{{drugbox |
|
| Verifiedfields = changed |
|
| Verifiedfields = changed |
|
| Watchedfields = changed |
|
| ⚫ |
| verifiedrevid = 457813015 |
|
|
| IUPAC_name = 6-oxy-3-[5-(6- |
|
|
| image = Ardeparin.png |
|
| ⚫ |
| width = 450 |
|
|
|
|
|
<!--Clinical data--> |
|
|
| tradename = |
|
|
| Drugs.com = {{drugs.com|MTM|ardeparin_sodium}} |
|
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
|
| pregnancy_US = C |
|
| ⚫ |
| pregnancy_category = |
|
|
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
|
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
|
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> |
|
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| ⚫ |
| legal_status = Withdrawn |
|
| ⚫ |
| routes_of_administration = |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
|
| bioavailability = 92% |
|
| ⚫ |
| protein_bound = |
|
| ⚫ |
| metabolism = |
|
| ⚫ |
| elimination_half-life = |
|
| ⚫ |
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
| ⚫ |
| CAS_number_Ref = {{cascite|correct|??}} |
|
| ⚫ |
| CAS_number = |
|
| ⚫ |
| ATC_prefix = none |
|
| ⚫ |
| ATC_suffix = |
|
| ⚫ |
| PubChem = |
|
| ⚫ |
| DrugBank_Ref = {{drugbankcite|changed|drugbank}} |
|
|
| DrugBank = <!-- blanked - oldvalue: DB00407 --> |
|
|
| UNII_Ref = {{fdacite|changed|FDA}} |
|
| UNII_Ref = {{fdacite|changed|FDA}} |
|
|
| UNII = WM0HAQ4WNM |
|
| UNII = <!-- blanked - oldvalue: N3927D01PB --> |
|
|
⚫ |
| verifiedrevid = 401617043 |
|
|
| IUPAC_name = 3S-<br> |
|
|
,4S<sup>*</sup>,5R<sup>*</sup>,8S<sup>*</sup>,9E,12R<sup>*</sup>,14R<sup>*</sup>,15S<sup>*</sup>,16R<sup>*</sup>,18S<sup>*</sup>,19S<sup>*</sup>,26aR<sup>*</sup><br> |
|
|
-5,6,8,11,12,13,14,15,16,17,18,19,24,25,26,26a<br> |
|
|
-hexadecahydro-5, 19-dihydroxy<br> |
|
|
-3-[2-(4-hydroxy-3-methoxycyclohexyl)<br> |
|
|
-1-methylethenyl]-14,16-dimethoxy<br> |
|
|
-4,10,12,18-tetramethyl-8-(2-propenyl)<br> |
|
|
-15,19-epoxy-3H-pyrido oxaazacyclotricosine-1,7,20,21(4H,23H)<br> |
|
|
-tetrone, monohydrate |
|
|
| image = Tacrolimus-Armistead-2D-skeletal.png |
|
⚫ |
| width = 250px |
|
|
| image2 = Tacrolimus-3D-sticks.png |
|
|
| width2 = 250px |
|
|
| InChI = 1/C44H69NO12/c1-10-13-31-19-25(2)18-26(3)20-37(54-8)40-38(55-9)22-28(5)44(52,57-40)41(49)42(50)45-17-12-11-14-32(45)43(51)56-39(29(6)34(47)24-35(31)48)27(4)21-30-15-16-33(46)36(23-30)53-7/h10,19,21,26,28-34,36-40,46-47,52H,1,11-18,20,22-24H2,2-9H3/b25-19-,27-21+/t26-,28+,29+,30-,31+,32-,33+,34-,36+,37-,38-,39+,40+,44+/m0/s1 |
|
|
| InChIKey = QJJXYPPXXYFBGM-LJIGMGMYBJ |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
|
| StdInChI = 1S/C44H69NO12/c1-10-13-31-19-25(2)18-26(3)20-37(54-8)40-38(55-9)22-28(5)44(52,57-40)41(49)42(50)45-17-12-11-14-32(45)43(51)56-39(29(6)34(47)24-35(31)48)27(4)21-30-15-16-33(46)36(23-30)53-7/h10,19,21,26,28-34,36-40,46-47,52H,1,11-18,20,22-24H2,2-9H3/b25-19-,27-21+/t26-,28+,29+,30-,31+,32-,33+,34-,36+,37-,38-,39+,40+,44+/m0/s1 |
|
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
|
| StdInChIKey = QJJXYPPXXYFBGM-LJIGMGMYSA-N |
|
⚫ |
| CAS_number_Ref = {{cascite|correct|??}} |
|
⚫ |
| CAS_number = 104987-11-3 |
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
| ChemSpiderID = 4976056 |
|
⚫ |
| ATC_prefix = D11 |
|
⚫ |
| ATC_suffix = AH01 |
|
|
| ATC_supplemental= {{ATC|L04|AD02}} |
|
⚫ |
| PubChem = 6473866 |
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
| ChEMBL = <!-- blanked - oldvalue: 1201448 --> |
|
| ChEMBL = <!-- blanked - oldvalue: 1200738 --> |
|
⚫ |
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
| ⚫ |
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = NA |
|
| DrugBank = DB00864 |
|
|
| C=44 | H=69 | N=1 | O=12 |
|
|
|
|
|
| molecular_weight = 804.018 g/mol |
|
<!--Chemical data--> |
|
|
|
| smiles = O=C3C(=O)N1CCCC1C(=O)O(C(=C/2CC(O)(OC)C2)/C)(C)(O)CC(=O)(/C=C(/C(C(OC)4O3(O)(C)C4OC)C)C)C\C=C |
|
| chemical_formula = (C<sub>26</sub>H<sub>40</sub>N<sub>2</sub>O<sub>36</sub>S<sub>5</sub>)<sub>n</sub> |
|
|
|
| bioavailability = 20%, less after eating food rich in fat |
|
| molecular_weight = 5500–6500 ] (average) |
|
|
⚫ |
| protein_bound =75-99% |
|
⚫ |
| metabolism = Hepatic ] |
|
⚫ |
| elimination_half-life = 11.3 h (range 3.5-40.6 h) |
|
⚫ |
| excretion = Mostly faecal |
|
⚫ |
| pregnancy_category = C |
|
⚫ |
| legal_status = |
|
⚫ |
| routes_of_administration = Topical, oral, ] |
|
}} |
|
}} |
