Revision as of 13:51, 21 November 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 449554015 of page Gyrophoric_acid for the Chem/Drugbox validation project (updated: 'ChEMBL', 'CASNo').← Previous edit |
Revision as of 13:56, 21 November 2011 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 456726650 of page Halichondrin_B for the Chem/Drugbox validation project (updated: 'StdInChI').Next edit → |
Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{chembox |
|
{{Chembox |
|
⚫ |
| ImageFile = Halichondrin B.svg |
|
| verifiedrevid = 439364730 |
|
|
⚫ |
| ImageSize = 250px |
|
| Name = Gyrophoric acid |
|
|
|
| IUPACName = (1''S'',2''S'',2′''S'',3''S'',3a''S'',3a′''S'',5''R'',6''S'',7''S'',7′''S'',7a''S'',7a′''S'',9''S'',12''S'',14''R'',16''R'',18''S'',20''S'',22''R'',26''R'',28''S'',29''S'',30''R'',34''R'',37''S'',39''R'',40''S'',41''R'',43''R'',44''S'')-7,7′,14′′,29′′-tetramethyl-8′′,15′′-dimethylidene-2-(1,3,4-trihydroxybutyl)decahydro-3′''H'',32′′''H''-dispiropyran-5,5′-furopyran-2′,24′′-undecaoxaundecacyclo[32.9.2.1~3,40~.1~3,41~.1~6,9~.1~12,16 |
⚫ |
| ImageFile = Gyrophoric acid.PNG |
|
|
|
~.0~18,30~.0~20,28~.0~22,26~.0~37,44~.0~39,43~]nonatetracontan]-32′′-one |
⚫ |
| ImageSize = 200px |
|
|
|
| IUPACName_hidden=yes |
|
| ImageName = Chemical structure of gyrophoric acid |
|
|
⚫ |
| OtherNames = |
|
| ImageAlt = Chemical structure of gyrophoric acid |
|
|
⚫ |
| Section1 = {{Chembox Identifiers |
|
| IUPACName = 4-oxy-2-hydroxy-6-methylbenzoic acid |
|
|
|
| InChI = 1S/C60H86O19/c1-26-13-33-7-9-37-27(2)14-35(65-37)11-12-58-23-46-54(78-58)55-56(72-46)57(79-58)53-38(69-55)10-8-34(67-53)16-48(64)73-52-31(6)51-43(68-42(52)17-39(66-33)30(26)5)19-41-45(71-51)22-60(74-41)24-47-50(77-60)29(4)21-59(76-47)20-28(3)49-44(75-59)18-40(70-49)36(63)15-32(62)25-61/h26,28-29,31-47,49-57,61-63H,2,5,7-25H2,1,3-4,6H3/t26-,28+,29+,31+,32?,33+,34-,35+,36?,37+,38+,39-,40+,41-,42+,43+,44+,45-,46-,47+,49+,50+,51+,52-,53+,54+,55+,56-,57+,58+,59-,60+/m1/s1 |
⚫ |
| OtherNames = <!-- <br> --> |
|
|
|
| InChIKey1 = FXNFULJVOQMBCW-CGIYHSFGSA-N |
⚫ |
|Section1= {{Chembox Identifiers |
|
|
|
| InChI1 = 1S/C60H86O19/c1-26-13-33-7-9-37-27(2)14-35(65-37)11-12-58-23-46-54(78-58)55-56(72-46)57(79-58)53-38(69-55)10-8-34(67-53)16-48(64)73-52-31(6)51-43(68-42(52)17-39(66-33)30(26)5)19-41-45(71-51)22-60(74-41)24-47-50(77-60)29(4)21-59(76-47)20-28(3)49-44(75-59)18-40(70-49)36(63)15-32(62)25-61/h26,28-29,31-47,49-57,61-63H,2,5,7-25H2,1,3-4,6H3/t26-,28+,29+,31+,32?,33+,34-,35+,36?,37+,38+,39-,40+,41-,42+,43+,44+,45-,46-,47+,49+,50+,51+,52-,53+,54+,55+,56-,57+,58+,59-,60+/m1/s1 |
|
| CASNo = <!-- blanked - oldvalue: 548-89-0 --> |
|
|
| CASNo_Ref = |
|
| CASNo = |
|
| CASOther = |
|
| PubChem = |
|
⚫ |
| ChemSpiderID = 10256208 |
|
| ChEMBL = 470648 |
|
|
⚫ |
| StdInChIKey = FXNFULJVOQMBCW-CGIYHSFGSA-N |
|
| PubChem = 135728 |
|
|
|
| SMILES = OCC(O)CC(O)1C2O3(C(C)2O1)C(C)4O%10(C4O3)C%11O%12(C)%13OC(=O)C8CC9O76O5(O(7O6C5)9O8)C |
|
| ChEMBL = 470648 |
|
|
|
C%15C/C(=C)(CC%14C(C)\C(=C)(C%13O%12C%11O%10)O%14)O%15 |
|
| PubChem = 135728 |
|
|
|
| StdInChI = 1S/C60H86O19/c1-26-13-33-7-9-37-27(2)14-35(65-37)11-12-58-23-46-54(78-58)55-56(72-46)57(79-58)53-38(69-55)10-8-34(67-53)16-48(64)73-52-31(6)51-43(68-42(52)17-39(66-33)30(26)5)19-41-45(71-51)22-60(74-41)24-47-50(77-60)29(4)21-59(76-47)20-28(3)49-44(75-59)18-40(70-49)36(63)15-32(62)25-61/h26,28-29,31-47,49-57,61-63H,2,5,7-25H2,1,3-4,6H3/t26-,28+,29+,31+,32?,33+,34-,35+,36?,37+,38+,39-,40+,41-,42+,43+,44+,45-,46-,47+,49+,50+,51+,52-,53+,54+,55+,56-,57+,58+,59-,60+/m1/s1 |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
⚫ |
| ChemSpiderID = 119550 |
|
|
| SMILES = O=C(Oc1cc(c(C(=O)O)c(O)c1)C)c3c(cc(OC(=O)c2c(cc(O)cc2O)C)cc3O)C |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
|
| StdInChI=1S/C24H20O10/c1-10-4-13(25)7-16(26)20(10)23(31)34-15-6-12(3)21(18(28)9-15)24(32)33-14-5-11(2)19(22(29)30)17(27)8-14/h4-9,25-28H,1-3H3,(H,29,30) |
|
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
⚫ |
| StdInChIKey = ATQPZSQVWCPVGV-UHFFFAOYSA-N |
|
|
| MeSHName = |
|
⚫ |
}} |
|
⚫ |
|Section2= {{Chembox Properties |
|
|
| Formula = C<sub>24</sub>H<sub>20</sub>O<sub>10</sub> |
|
|
| MolarMass = 468.40 g/mol |
|
|
| ExactMass = 468.105647 u |
|
⚫ |
| Appearance = |
|
⚫ |
| Density = |
|
⚫ |
| MeltingPt = <!-- °C --> |
|
⚫ |
| BoilingPt = <!-- °C --> |
|
⚫ |
| Solubility = |
|
|
}} |
|
}} |
|
⚫ |
| Section2 = {{Chembox Properties |
|
|
| C=60|H=86|O=19 |
|
⚫ |
| Appearance = |
|
⚫ |
| Density = |
|
⚫ |
| MeltingPt = |
|
⚫ |
| BoilingPt = |
|
⚫ |
| Solubility = |
|
⚫ |
}} |
|
|
| Section3 = {{Chembox Hazards |
|
|
| MainHazards = |
|
|
| FlashPt = |
|
|
| Autoignition = |
|
|
}} |
|
}} |
|
}} |