Revision as of 14:14, 21 November 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 444432840 of page Hexamethylphosphoramide for the Chem/Drugbox validation project (updated: 'KEGG').← Previous edit |
Revision as of 14:22, 21 November 2011 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 447559415 of page Hexylcaine for the Chem/Drugbox validation project (updated: 'DrugBank').Next edit → |
Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{chembox |
|
{{Drugbox |
|
⚫ |
| verifiedrevid = 415529194 |
|
| Verifiedfields = changed |
|
|
|
| IUPAC_name = 1-cyclohexylaminopropan-2-yl benzoate |
|
| Watchedfields = changed |
|
|
|
| image = Hexylcaine.PNG |
⚫ |
| verifiedrevid = 400104650 |
|
|
|
|
|
| Name = Hexamethylphosphoramide |
|
|
|
<!--Clinical data--> |
|
| ImageFile = HMPA-2D-skeletal.png |
|
|
|
| tradename = |
|
| ImageName = Chemical structure of HMPA |
|
|
|
| pregnancy_category = |
|
| ImageFile1 = Hexamethylphosphoramide-from-xtal-3D-balls.png |
|
|
|
| legal_status = |
|
| ImageName1 = 3D stick model of HMPA |
|
|
|
| routes_of_administration = |
|
| PIN=Hexamethylphosphoric triamide |
|
|
|
|
|
| IUPACName = Hexamethylphosphoramide |
|
|
|
<!--Pharmacokinetic data--> |
|
| OtherNames = Hexametapol<br /> HMPA |
|
|
|
| bioavailability = |
|
| Section1 = {{Chembox Identifiers |
|
|
|
| protein_bound = |
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
| ChemSpiderID = 12158 |
|
| metabolism = |
|
|
| elimination_half-life = <10 minutes |
⚫ |
| PubChem = 12679 |
|
|
|
|
|
| InChI = 1/C6H18N3OP/c1-7(2)11(10,8(3)4)9(5)6/h1-6H3 |
|
|
|
<!--Identifiers--> |
|
| InChIKey = GNOIPBMMFNIUFM-UHFFFAOYAP |
|
|
⚫ |
| CASNo_Ref = {{cascite|correct|CAS}} |
|
|
| CAS_number = 532-77-4 |
|
|
| ATC_prefix = none |
|
|
| ATC_suffix = |
|
|
| ATC_supplemental = |
|
⚫ |
| PubChem = 10770 |
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
|
| DrugBank = DB00473 |
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
| ChemSpiderID = 10315 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = 511IU0826Z |
|
⚫ |
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
|
| KEGG = C14172 |
|
⚫ |
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
|
| ChEMBL = 1197 |
|
|
|
|
|
<!--Chemical data--> |
|
⚫ |
| C=16 | H=23 | N=1 | O=2 |
|
|
| molecular_weight = 261.359 g/mol |
|
|
| smiles = O=C(OC(CNC1CCCCC1)C)c2ccccc2 |
|
|
| InChI = 1/C16H23NO2/c1-13(12-17-15-10-6-3-7-11-15)19-16(18)14-8-4-2-5-9-14/h2,4-5,8-9,13,15,17H,3,6-7,10-12H2,1H3 |
|
|
| InChIKey = DKLKMKYDWHYZTD-UHFFFAOYAY |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C6H18N3OP/c1-7(2)11(10,8(3)4)9(5)6/h1-6H3 |
|
| StdInChI = 1S/C16H23NO2/c1-13(12-17-15-10-6-3-7-11-15)19-16(18)14-8-4-2-5-9-14/h2,4-5,8-9,13,15,17H,3,6-7,10-12H2,1H3 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = GNOIPBMMFNIUFM-UHFFFAOYSA-N |
|
| StdInChIKey = DKLKMKYDWHYZTD-UHFFFAOYSA-N |
⚫ |
| CASNo_Ref = {{cascite|correct|CAS}} |
|
|
| CASNo = 680-31-9 |
|
⚫ |
| KEGG_Ref = {{keggcite|changed|kegg}} |
|
|
| KEGG = <!-- blanked - oldvalue: C19250 --> |
|
⚫ |
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEBI = 24565 |
|
|
| SMILES = O=P(N(C)C)(N(C)C)N(C)C |
|
|
}} |
|
|
| Section2 = {{Chembox Properties |
|
⚫ |
| C = 6 | H = 18 | N = 3 | O = 1 | P = 1 |
|
|
| MolarMass = 179.20 g/mol |
|
|
| Density = 1.03 g/cm<sup>3</sup> |
|
|
| MeltingPtC = 7.20 |
|
|
| BoilingPtC = 232.5 |
|
|
| Boiling_notes = CRC<ref>{{CRC91|page=3-280}}</ref> |
|
|
}} |
|
|
| Section7 = {{Chembox Hazards |
|
|
| ExternalMSDS = |
|
|
| EUClass = {{Hazchem Xn}} |
|
|
}} |
|
|
}} |
|
}} |