Misplaced Pages:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions

< Misplaced Pages:WikiProject Chemicals | Chembox validation Browse history interactively ← Previous edit Next edit →Content deleted Content addedVisual WikitextInline

Revision as of 14:27, 21 November 2011 editBeetstra (talk \| contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 456785472 of page Histrelin for the Chem/Drugbox validation project (updated: 'ChEMBL', 'CAS_number').← Previous edit		Revision as of 14:29, 21 November 2011 edit undoBeetstra (talk \| contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 456533638 of page Homatropine for the Chem/Drugbox validation project (updated: 'DrugBank', 'ChEMBL', 'CAS_number').Next edit →
Line 1:		Line 1:
	{{ambox \| text = This page contains a copy of the infobox ({{tl\|drugbox}}) taken from revid of page ] with values updated to verified values.}}		{{ambox \| text = This page contains a copy of the infobox ({{tl\|drugbox}}) taken from revid of page ] with values updated to verified values.}}
	{{Drugbox		{{Drugbox
	\| Verifiedfields = changed		\| Verifiedfields = changed
			\| Watchedfields = changed
	\| verifiedrevid = ~~400110408~~		\| verifiedrevid = 402148773
	\| IUPAC_name = 5-oxo-<small>L</small>-prolyl-<small>L</small>-histidyl-<small>L</small>-tryptophyl-<small>L</small>-seryl-<small>L</small>-tyrosyl-1-benzyl-<small>D</small>-histidyl-<small>L</small>-leucyl-''N''<sup>5</sup>-(diaminomethylene)-<small>L</small>-ornithyl-''N''-ethyl-<small>L</small>-prolinamide
			\| IUPAC_name = (''N''-methyl-8-azabicyclooct-3-yl) 2-hydroxy-2-phenylacetate
	\| image = Histrelin.svg
			\| image = HomatropineNEW.png
			\| drug_name = Homatropine

	<!--Clinical data-->		<!--Clinical data-->
	\| tradename =		\| tradename =
	\| Drugs.com = {{drugs.com\|monograph\|~~histrelin~~}}		\| Drugs.com = {{drugs.com\|monograph\|glycopyrrolate}}
	\| MedlinePlus = ~~a601146~~		\| MedlinePlus = a601006
	\| ~~pregnancy_US~~ = X		\| pregnancy_category =
	\| ~~legal_US~~ = ~~Rx-only~~		\| legal_status =
	\| routes_of_administration = ~~Subcutaneous~~ ]		\| routes_of_administration =

	<!--Pharmacokinetic data-->		<!--Pharmacokinetic data-->
	\| bioavailability = ~~92%~~		\| bioavailability =
	\| protein_bound = ~~70%~~		\| protein_bound =
	\| metabolism = ]		\| metabolism =
	\| elimination_half-life = 4 ~~hours~~		\| elimination_half-life =
	\| excretion = Undetermined

	<!--Identifiers-->		<!--Identifiers-->
	\| ~~CAS_number_Ref~~ = {{cascite\|correct\|??}}		\| CASNo_Ref = {{cascite\|correct\|CAS}}
		⚫	\| CAS_number_Ref = {{cascite\|changed\|??}}
	\| CAS_number = <!-- blanked - oldvalue: 76712-82-8 -->
	\| ~~ATC_prefix~~ = ~~H01~~		\| CAS_number = 80-49-9
	\| ~~ATC_suffix~~ = ~~CA03~~		\| ATC_prefix = A02
	\| ~~PubChem~~ = ~~25077993~~		\| ATC_suffix = BX03
			\| ATC_supplemental = {{ATC\|S01\|FA05}}
			\| PubChem = 6321423
	\| DrugBank_Ref = {{drugbankcite\|correct\|drugbank}}		\| DrugBank_Ref = {{drugbankcite\|correct\|drugbank}}
	\| DrugBank =		\| DrugBank = <!-- blanked - oldvalue: APRD01017 -->
	\| ChemSpiderID_Ref = {{chemspidercite\|correct\|chemspider}}		\| ChemSpiderID_Ref = {{chemspidercite\|correct\|chemspider}}
	\| ChemSpiderID = ~~10482012~~		\| ChemSpiderID = 16498795
	\| UNII_Ref = {{fdacite\|changed\|FDA}}		\| UNII_Ref = {{fdacite\|changed\|FDA}}
	\| UNII = ~~H50H3S3W74~~		\| UNII = 8QS6WCL55Z
⚫	\| ~~KEGG_Ref~~ = {{~~keggcite~~\|changed\|~~kegg~~}}
	\| KEGG = D02369
	\| ChEMBL_Ref = {{ebicite\|changed\|EBI}}		\| ChEMBL_Ref = {{ebicite\|changed\|EBI}}
	\| ChEMBL = <!-- blanked - oldvalue: ~~1201255~~ -->		\| ChEMBL = <!-- blanked - oldvalue: 1233442 -->
	\| C=66 \| H=86 \| N=18 \| O=12		\| C=16 \| H=21 \| N=1 \| O=3
	\| molecular_weight = ~~1323~~.5 g/mol		\| molecular_weight = 356.26 g/mol
			\| smiles = CN31CC3C(C1)OC(=O)C(O)c2ccccc2
	\| InChI = 1/C66H86N18O12/c1-4-70-64(95)55-17-11-25-84(55)65(96)48(16-10-24-71-66(67)68)76-58(89)49(26-38(2)3)77-62(93)53(30-43-34-83(37-74-43)33-40-12-6-5-7-13-40)81-59(90)50(27-39-18-20-44(86)21-19-39)78-63(94)54(35-85)82-60(91)51(28-41-31-72-46-15-9-8-14-45(41)46)79-61(92)52(29-42-32-69-36-73-42)80-57(88)47-22-23-56(87)75-47/h5-9,12-15,18-21,31-32,34,36-38,47-55,72,85-86H,4,10-11,16-17,22-30,33,35H2,1-3H3,(H,69,73)(H,70,95)(H,75,87)(H,76,89)(H,77,93)(H,78,94)(H,79,92)(H,80,88)(H,81,90)(H,82,91)(H4,67,68,71)/t47-,48-,49-,50-,51-,52-,53+,54-,55-/m0/s1
			\| InChI = 1/C16H21NO3/c1-17-12-7-8-13(17)10-14(9-12)20-16(19)15(18)11-5-3-2-4-6-11/h2-6,12-15,18H,7-10H2,1H3/t12-,13+,14+,15?
	\| InChIKey = HHXHVIJIIXKSOE-QILQGKCVBR
			\| InChIKey = ZTVIKZXZYLEVOL-HCYNLOQUSA-N
	\| StdInChI_Ref = {{stdinchicite\|correct\|chemspider}}		\| StdInChI_Ref = {{stdinchicite\|correct\|chemspider}}
			\| StdInChI = 1S/C16H21NO3/c1-17-12-7-8-13(17)10-14(9-12)20-16(19)15(18)11-5-3-2-4-6-11/h2-6,12-15,18H,7-10H2,1H3/t12-,13+,14+,15?
	\| StdInChI = 1S/C66H86N18O12/c1-4-70-64(95)55-17-11-25-84(55)65(96)48(16-10-24-71-66(67)68)76-58(89)49(26-38(2)3)77-62(93)53(30-43-34-83(37-74-43)33-40-12-6-5-7-13-40)81-59(90)50(27-39-18-20-44(86)21-19-39)78-63(94)54(35-85)82-60(91)51(28-41-31-72-46-15-9-8-14-45(41)46)79-61(92)52(29-42-32-69-36-73-42)80-57(88)47-22-23-56(87)75-47/h5-9,12-15,18-21,31-32,34,36-38,47-55,72,85-86H,4,10-11,16-17,22-30,33,35H2,1-3H3,(H,69,73)(H,70,95)(H,75,87)(H,76,89)(H,77,93)(H,78,94)(H,79,92)(H,80,88)(H,81,90)(H,82,91)(H4,67,68,71)/t47-,48-,49-,50-,51-,52-,53+,54-,55-/m0/s1
	\| StdInChIKey_Ref = {{stdinchicite\|correct\|chemspider}}		\| StdInChIKey_Ref = {{stdinchicite\|correct\|chemspider}}
	\| StdInChIKey = ~~HHXHVIJIIXKSOE~~-~~QILQGKCVSA~~-N		\| StdInChIKey = ZTVIKZXZYLEVOL-MCOXGKPRSA-N
	}}		}}

Revision as of 14:29, 21 November 2011

This page contains a copy of the infobox ({{drugbox}}) taken from revid 456533638 of page Homatropine with values updated to verified values.

Homatropine
Clinical data

AHFS/Drugs.com	Monograph
MedlinePlus	a601006
ATC code	A02BX03 (WHO) S01FA05 (WHO)
Identifiers
IUPAC name (N-methyl-8-azabicyclooct-3-yl) 2-hydroxy-2-phenylacetate
CAS Number	80-49-9
PubChem CID	6321423
ChemSpider	16498795
UNII	8QS6WCL55Z
Chemical and physical data
Formula	C₁₆H₂₁NO₃
Molar mass	356.26 g/mol g·mol
3D model (JSmol)	Interactive image
SMILES CN31CC3C(C1)OC(=O)C(O)c2ccccc2
InChI InChI=1S/C16H21NO3/c1-17-12-7-8-13(17)10-14(9-12)20-16(19)15(18)11-5-3-2-4-6-11/h2-6,12-15,18H,7-10H2,1H3/t12-,13+,14+,15? Key:ZTVIKZXZYLEVOL-MCOXGKPRSA-N
(what is this?) (verify)