Misplaced Pages:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions

< Misplaced Pages:WikiProject Chemicals | Chembox validation Browse history interactively ← Previous edit Next edit →Content deleted Content addedVisual WikitextInline

Revision as of 14:29, 21 November 2011 editBeetstra (talk \| contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 456533638 of page Homatropine for the Chem/Drugbox validation project (updated: 'DrugBank', 'ChEMBL', 'CAS_number').← Previous edit		Revision as of 14:33, 21 November 2011 edit undoBeetstra (talk \| contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 455922307 of page Homoserine for the Chem/Drugbox validation project (updated: 'ChEMBL').Next edit →
Line 1:		Line 1:
	{{ambox \| text = This page contains a copy of the infobox ({{tl\|~~drugbox~~}}) taken from revid of page ] with values updated to verified values.}}		{{ambox \| text = This page contains a copy of the infobox ({{tl\|chembox}}) taken from revid of page ] with values updated to verified values.}}
	{{~~Drugbox~~		{{chembox
	\| Verifiedfields = changed		\| Verifiedfields = changed
		⚫	\| verifiedrevid = 402148997
	\| Watchedfields = changed
			\| Name = <small>L</small>-Homoserine
⚫	\| verifiedrevid = ~~402148773~~
			\| ImageFile_Ref = {{chemboximage\|correct\|??}}
	\| IUPAC_name = (''N''-methyl-8-azabicyclooct-3-yl) 2-hydroxy-2-phenylacetate
			\| ImageFile = L-Homoserin.svg
	\| image = HomatropineNEW.png
			\| ImageSize = 180px
	\| drug_name = Homatropine
			\| ImageName = Skeletal formula

			\| ImageFile1 = L-Homoserine-zwitterion-3D-balls.png
	<!--Clinical data-->
	\| ~~tradename~~ =		\| ImageSize1 = 120px
			\| ImageName1 = Ball-and-stick model of the zwitterion
	\| Drugs.com = {{drugs.com\|monograph\|glycopyrrolate}}
			\| IUPACName = (''S'')-2-Amino-4-hydroxybutanoic acid
	\| MedlinePlus = a601006
			\| Section1 = {{Chembox Identifiers
	\| pregnancy_category =
			\| InChI = 1/C4H9NO3/c5-3(1-2-6)4(7)8/h3,6H,1-2,5H2,(H,7,8)
	\| legal_status =
		⚫	\| ChEBI_Ref = {{ebicite\|changed\|EBI}}
	\| routes_of_administration =
			\| ChEBI = 30653

			\| SMILES = O=C(O)C(N)CCO
	<!--Pharmacokinetic data-->
			\| InChIKey = UKAUYVFTDYCKQA-UHFFFAOYAZ
	\| bioavailability =
	\| protein_bound =
	\| metabolism =
	\| elimination_half-life =

	<!--Identifiers-->
⚫	\| CASNo_Ref = {{cascite\|correct\|CAS}}
	\| CAS_number_Ref = {{cascite\|changed\|??}}
	\| CAS_number = 80-49-9
	\| ATC_prefix = A02
	\| ATC_suffix = BX03
	\| ATC_supplemental = {{ATC\|S01\|FA05}}
⚫	\| PubChem = ~~6321423~~
	\| DrugBank_Ref = {{drugbankcite\|correct\|drugbank}}
⚫	\| ~~DrugBank~~ = <!-- blanked - oldvalue: ~~APRD01017~~ -->
⚫	\| ChemSpiderID_Ref = {{chemspidercite\|correct\|chemspider}}
⚫	\| ChemSpiderID = ~~16498795~~
	\| UNII_Ref = {{fdacite\|changed\|FDA}}
	\| UNII = 8QS6WCL55Z
⚫	\| ~~ChEMBL_Ref~~ = {{ebicite\|changed\|EBI}}
	\| ChEMBL = <!-- blanked - oldvalue: 1233442 -->
	\| C=16 \| H=21 \| N=1 \| O=3
	\| molecular_weight = 356.26 g/mol
	\| smiles = CN31CC3C(C1)OC(=O)C(O)c2ccccc2
	\| InChI = 1/C16H21NO3/c1-17-12-7-8-13(17)10-14(9-12)20-16(19)15(18)11-5-3-2-4-6-11/h2-6,12-15,18H,7-10H2,1H3/t12-,13+,14+,15?
	\| InChIKey = ZTVIKZXZYLEVOL-HCYNLOQUSA-N
	\| StdInChI_Ref = {{stdinchicite\|correct\|chemspider}}		\| StdInChI_Ref = {{stdinchicite\|correct\|chemspider}}
	\| StdInChI = 1S/~~C16H21NO3~~/c1-~~17-12-7-8-13~~(~~17)10~~-~~14(9~~-12)~~20-16~~(19)~~15(18)11-5-3-2-4-6-11~~/~~h2-6~~,~~12-15~~,~~18H,7~~-~~10H2~~,~~1H3/t12-~~,~~13+~~,~~14+~~,~~15?~~		\| StdInChI = 1S/C4H9NO3/c5-3(1-2-6)4(7)8/h3,6H,1-2,5H2,(H,7,8)
	\| StdInChIKey_Ref = {{stdinchicite\|correct\|chemspider}}		\| StdInChIKey_Ref = {{stdinchicite\|correct\|chemspider}}
	\| StdInChIKey = ~~ZTVIKZXZYLEVOL~~-~~MCOXGKPRSA~~-N		\| StdInChIKey = UKAUYVFTDYCKQA-UHFFFAOYSA-N
			\| CASNo = 672-15-1
		⚫	\| CASNo_Ref = {{cascite\|correct\|CAS}}
			\| EC-number = 211-590-6
		⚫	\| ChemSpiderID_Ref = {{chemspidercite\|correct\|chemspider}}
		⚫	\| ChemSpiderID = 758
		⚫	\| PubChem = 779
		⚫	\| ChEMBL_Ref = {{ebicite\|changed\|EBI}}
		⚫	\| ChEMBL = <!-- blanked - oldvalue: 11722 -->
			}}
			\| Section2 = {{Chembox Properties
			\| Formula = C<sub>4</sub>H<sub>9</sub>NO<sub>3</sub>
			\| MolarMass = 119.12 g/mol
			}}
	}}		}}

Revision as of 14:33, 21 November 2011

This page contains a copy of the infobox ({{chembox}}) taken from revid 455922307 of page Homoserine with values updated to verified values.

L-Homoserine
Names


IUPAC name (S)-2-Amino-4-hydroxybutanoic acid
Identifiers
CAS Number	672-15-1
3D model (JSmol)	Interactive image
ChEBI	CHEBI:30653
ChemSpider	758
PubChem CID	779
InChI InChI=1S/C4H9NO3/c5-3(1-2-6)4(7)8/h3,6H,1-2,5H2,(H,7,8)Key: UKAUYVFTDYCKQA-UHFFFAOYSA-N InChI=1/C4H9NO3/c5-3(1-2-6)4(7)8/h3,6H,1-2,5H2,(H,7,8)Key: UKAUYVFTDYCKQA-UHFFFAOYAZ
SMILES O=C(O)C(N)CCO
Properties
Chemical formula	C₄H₉NO₃
Molar mass	119.12 g/mol
Except where otherwise noted, data are given for materials in their standard state (at 25 °C , 100 kPa). N verify (what is ?) Infobox references

Tracking categories (test):

SizeSet

Chemical compound