Revision as of 14:33, 21 November 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,084 edits Saving copy of the {{chembox}} taken from revid 455922307 of page Homoserine for the Chem/Drugbox validation project (updated: 'ChEMBL').← Previous edit |
Revision as of 14:36, 21 November 2011 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,084 edits Saving copy of the {{chembox}} taken from revid 443860316 of page Humulene for the Chem/Drugbox validation project (updated: 'ChEMBL').Next edit → |
Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{chembox |
|
{{chembox |
|
⚫ |
| verifiedrevid = 443859131 |
|
| Verifiedfields = changed |
|
|
|
| Name = Humulene |
⚫ |
| verifiedrevid = 402148997 |
|
|
⚫ |
| ImageFile = Humulene.png |
|
| Name = <small>L</small>-Homoserine |
|
|
⚫ |
| ImageSize = 150px |
|
| ImageFile_Ref = {{chemboximage|correct|??}} |
|
|
⚫ |
| ImageName = Humulene |
⚫ |
| ImageFile = L-Homoserin.svg |
|
|
|
| ImageFile2 = Humulene3DModel.png |
⚫ |
| ImageSize = 180px |
|
|
|
| ImageSize = 150px |
⚫ |
| ImageName = Skeletal formula |
|
|
|
| IUPACName = 2,6,6,9-Tetramethyl-1,4-8-cycloundecatriene |
|
| ImageFile1 = L-Homoserine-zwitterion-3D-balls.png |
|
|
|
| OtherNames = alpha-Caryophyllene; 3,7,10-Humulatriene<ref>{{ChEMBL = 251280 |
|
| ImageSize1 = 120px |
|
|
|
| PubChem|5281520}}</ref> |
|
| ImageName1 = Ball-and-stick model of the zwitterion |
|
|
| IUPACName = (''S'')-2-Amino-4-hydroxybutanoic acid |
|
|
| Section1 = {{Chembox Identifiers |
|
| Section1 = {{Chembox Identifiers |
|
| InChI = 1/C4H9NO3/c5-3(1-2-6)4(7)8/h3,6H,1-2,5H2,(H,7,8) |
|
⚫ |
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
⚫ |
| ChEBI = 30653 |
|
|
| SMILES = O=C(O)C(N)CCO |
|
|
| InChIKey = UKAUYVFTDYCKQA-UHFFFAOYAZ |
|
⚫ |
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
|
| StdInChI = 1S/C4H9NO3/c5-3(1-2-6)4(7)8/h3,6H,1-2,5H2,(H,7,8) |
|
⚫ |
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
⚫ |
| StdInChIKey = UKAUYVFTDYCKQA-UHFFFAOYSA-N |
|
⚫ |
| CASNo = 672-15-1 |
|
⚫ |
| CASNo_Ref = {{cascite|correct|CAS}} |
|
|
| EC-number = 211-590-6 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 758 |
|
| ChemSpiderID = 4444853 |
|
| PubChem = 779 |
|
| ChEMBL = 251280 |
|
|
| PubChem = 5281520 |
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
|
|
| InChI = 1/C15H24/c1-13-7-5-8-14(2)10-12-15(3,4)11-6-9-13/h6-7,10-11H,5,8-9,12H2,1-4H3/b11-6+,13-7+,14-10+ |
|
| ChEMBL = <!-- blanked - oldvalue: 11722 --> |
|
|
|
| InChIKey = FAMPSKZZVDUYOS-HRGUGZIWBF |
⚫ |
}} |
|
|
⚫ |
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
|
| StdInChI = 1S/C15H24/c1-13-7-5-8-14(2)10-12-15(3,4)11-6-9-13/h6-7,10-11H,5,8-9,12H2,1-4H3/b11-6+,13-7+,14-10+ |
|
⚫ |
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
⚫ |
| StdInChIKey = FAMPSKZZVDUYOS-HRGUGZIWSA-N |
|
⚫ |
| CASNo_Ref = {{cascite|correct|CAS}} |
|
⚫ |
| CASNo = 6753-98-6 |
|
⚫ |
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
⚫ |
| ChEBI = 5768 |
|
|
| SMILES = C\1=C/C(C)(C)C/C=C(/CC/C=C(/C/1)C)C}} |
|
| Section2 = {{Chembox Properties |
|
| Section2 = {{Chembox Properties |
|
|
| Reference = <ref>'']'', 12th Edition, '''4789'''</ref> |
|
| Formula = C<sub>4</sub>H<sub>9</sub>NO<sub>3</sub> |
|
|
|
| C=15|H=24 |
|
| MolarMass = 119.12 g/mol |
|
|
|
| Density = 0.886 g/cm<sup>3</sup> |
|
}} |
|
|
|
| Appearance = Pale yellowish green clear liquid |
|
|
| Melting Pt = <25 °C |
|
|
| BoilingPt = 106-107 °C at 5 mmHg |
|
⚫ |
}} |
|
|
| Section3 = {{Chembox Hazards |
|
|
| ExternalMSDS = |
|
|
| LD50 = >48 mg/kg}} |
|
}} |
|
}} |