Revision as of 13:42, 22 November 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 460502754 of page Icodextrin for the Chem/Drugbox validation project (updated: 'ChEMBL', 'KEGG').← Previous edit |
Revision as of 13:43, 22 November 2011 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 447765362 of page Icatibant for the Chem/Drugbox validation project (updated: 'ChEMBL', 'CAS_number').Next edit → |
Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{Drugbox |
|
{{Drugbox |
|
|
| IUPAC_name = (2S)-2-<nowiki>amino]-5-(diaminomethylideneamino)pentanoyl]pyrrolidine-<BR/>2-carbonyl]-4-hydroxypyrrolidine-2-carbonyl]amino]acetyl]amino]-<BR/>3-thiophen-2-ylpropanoyl]amino]-3-hydroxypropanoyl]<BR/>3,4-dihydro-1H-isoquinoline-3-carbonyl]<BR/>2,3,3a,4,5,6,7,7a-octahydroindole-2-carbonyl]amino]-<BR/>5-(diaminomethylideneamino)pentanoic acid |
|
| Verifiedfields = changed |
|
|
|
| image = Icatibant.png |
|
| verifiedrevid = 419621102 |
|
|
| IUPAC_name = |
|
|
| image = Icodextrin skeletal.svg |
|
|
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
| tradename = |
|
| tradename = |
|
| Drugs.com = {{drugs.com|international|icodextrin}} |
|
| Drugs.com = {{drugs.com|international|icatibant}} |
|
|
| licence_EU = Firazyr |
|
|
| licence_US = Icatibant |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| pregnancy_US = C |
|
| pregnancy_US = C |
|
|
| pregnancy_category = |
|
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
|
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| legal_US = Rx-only |
|
| legal_status = Rx |
|
| legal_status = |
|
| routes_of_administration = ] |
|
| routes_of_administration = subcutaneous |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
<!--Pharmacokinetic data--> |
|
| bioavailability = 40% in 12 hours |
|
| bioavailability = |
|
| protein_bound = |
|
| protein_bound = |
|
| metabolism = ] |
|
| metabolism = |
|
| elimination_half-life = |
|
| elimination_half-life = |
|
| excretion = ] |
|
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
⚫ |
| CAS_number = <!-- blanked - oldvalue: 130308-48-4 --> |
⚫ |
| CAS_number_Ref = {{cascite|correct|??}} |
|
|
|
| ATC_prefix = C01 |
|
| CAS_number = 337376-15-5 |
|
|
| ATC_prefix = B05 |
|
| ATC_suffix = EB19 |
|
| ATC_suffix = DA |
|
|
| ATC_supplemental = |
|
| ATC_supplemental = |
|
|
| PubChem = 71364 |
|
| PubChemSubstance = 17397419 |
|
|
|
| IUPHAR_ligand = 667 |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
|
| DrugBank = DB00702 |
|
| DrugBank = DB06196 |
|
⚫ |
| ChemSpiderID = 16736634 |
|
| UNII_Ref = {{fdacite|changed|FDA}} |
|
|
⚫ |
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = 2NX48Z0A9G |
|
| UNII = 7PG89G35Q7 |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
|
| KEGG = <!-- blanked - oldvalue: D03266 --> |
|
| ChEMBL = <!-- blanked - oldvalue: 375218 --> |
|
|
| C=59 | H=89 | N=19 | O=13 | S=1 |
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
|
⚫ |
| molecular_weight = 1304.52 g/mol |
⚫ |
| ChEMBL = <!-- blanked - oldvalue: 1201472 --> |
|
|
|
| smiles = C1CC2(C1)CC(N2C(=O)C3CC4=CC=CC=C4CN3C(=O)(CO)NC(=O)(CC5=CC=CS5)NC(=O)CNC(=O)C6C(CN6C(=O)C7CCCN7C(=O)C(CCCN=C(N)N)NC(=O)(CCCN=C(N)N)N)O)C(=O)N(CCCN=C(N)N)C(=O)O |
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
|
| StdInChI = 1S/C59H89N19O13S/c60-37(14-5-19-67-57(61)62)48(82)72-38(15-6-20-68-58(63)64)52(86)75-22-8-18-43(75)54(88)77-30-35(80)26-44(77)50(84)70-28-47(81)71-40(27-36-13-9-23-92-36)49(83)74-41(31-79)53(87)76-29-34-12-2-1-10-32(34)24-46(76)55(89)78-42-17-4-3-11-33(42)25-45(78)51(85)73-39(56(90)91)16-7-21-69-59(65)66/h1-2,9-10,12-13,23,33,35,37-46,79-80H,3-8,11,14-22,24-31,60H2,(H,70,84)(H,71,81)(H,72,82)(H,73,85)(H,74,83)(H,90,91)(H4,61,62,67)(H4,63,64,68)(H4,65,66,69)/t33-,35+,37+,38-,39-,40-,41-,42-,43-,44-,45?,46+/m0/s1 |
⚫ |
| ChemSpiderID = NA |
|
|
|
| StdInChIKey = QURWXBZNHXJZBE-OVZQYVDUSA-N |
|
|
|
|
<!--Chemical data--> |
|
|
| chemical_formula = (C<sub>6</sub>H<sub>10</sub>O<sub>5</sub>)<sub>n</sub> |
|
|
|
|
⚫ |
| molecular_weight = 13–19 ] |
|
|
| smiles = |
|
|
| synonyms = |
|
|
}} |
|
}} |