Misplaced Pages

:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions - Misplaced Pages

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
< Misplaced Pages:WikiProject Chemicals | Chembox validation Browse history interactively← Previous editNext edit →Content deleted Content addedVisualWikitext
Revision as of 13:39, 23 November 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 456660424 of page Medetomidine for the Chem/Drugbox validation project (updated: 'CAS_number').← Previous edit Revision as of 13:40, 23 November 2011 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 456776502 of page Medronic_acid for the Chem/Drugbox validation project (updated: 'UNII', 'CASNo').Next edit →
Line 1: Line 1:
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} {{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}}
{{Drugbox {{chembox
| Verifiedfields = changed | Verifiedfields = changed
⚫ | verifiedrevid = 408583997
| IUPAC_name = (''RS'')-4--3''H''-imidazole
| image = Medetomidine.svg
| imagename = 1 : 1 mixture (racemate)
| drug_name = Medetomidine

<!--Clinical data-->
| tradename =
| Drugs.com = {{drugs.com|monograph|dexmedetomidine-hydrochloride}}
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US = <!-- A / B / C / D / X -->
| pregnancy_category =
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C -->
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
| legal_status = Veterinary use only
| routes_of_administration =

<!--Pharmacokinetic data-->
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =

<!--Identifiers-->
⚫ | CAS_number_Ref = {{cascite|correct|??}}
⚫ | CAS_number = <!-- blanked - oldvalue: 86347-14-0 -->
| ATCvet = yes
| ATC_prefix = N05
| ATC_suffix = CM91
| ATC_supplemental =
⚫ | PubChem = 68602
| DrugBank_Ref = {{drugbankcite|changed|drugbank}}
| DrugBank = DB00633
⚫ | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
⚫ | ChemSpiderID = 61868
| UNII_Ref = {{fdacite|changed|FDA}} | UNII_Ref = {{fdacite|changed|FDA}}
| UNII = <!-- blanked - oldvalue: 73OS0QIN3O -->
| UNII = MR15E85MQM
⚫ | verifiedrevid = 400325784
⚫ | KEGG_Ref = {{keggcite|correct|kegg}}
| ImageFile = Medronic acid.png
⚫ | KEGG = D08165
| ImageSize = 150px
⚫ | ChEBI_Ref = {{ebicite|changed|EBI}}
| IUPACName = Methanediylbis(phosphonic acid)
| ChEBI = 48552
| OtherNames = Methanediphosphonic acid; Methylenebis(phosphonic acid); Methylene diphosphonate; Medronate; Phosphonomethylphosphonic acid; MDP
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| Section1 = {{Chembox Identifiers
⚫ | ChEMBL = 77921
⚫ | ChEMBL_Ref = {{ebicite|changed|EBI}}

⚫ | ChEMBL = 180570
<!--Chemical data-->
| chemical_formula =
⚫ | C=13 | H=16 | N=2
| molecular_weight = 200.279 g/mol
| smiles = n1cc(nc1)C(c2c(c(ccc2)C)C)C
| InChI = 1/C13H16N2/c1-9-5-4-6-12(10(9)2)11(3)13-7-14-8-15-13/h4-8,11H,1-3H3,(H,14,15)
| InChIKey = CUHVIMMYOGQXCV-UHFFFAOYAH
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C13H16N2/c1-9-5-4-6-12(10(9)2)11(3)13-7-14-8-15-13/h4-8,11H,1-3H3,(H,14,15) | StdInChI =1S/CH6O6P2/c2-8(3,4)1-9(5,6)7/h1H2,(H2,2,3,4)(H2,5,6,7)
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = CUHVIMMYOGQXCV-UHFFFAOYSA-N | StdInChIKey = MBKDYNNUVRNNRF-UHFFFAOYSA-N
⚫ | CASNo_Ref = {{cascite|correct|??}}
⚫ | CASNo = <!-- blanked - oldvalue: 1984-15-2 -->
⚫ | PubChem = 16124
⚫ | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
⚫ | ChemSpiderID = 15308
⚫ | KEGG_Ref = {{keggcite|changed|kegg}}
⚫ | KEGG = D04887
| SMILES = O=P(O)(O)CP(=O)(O)O
}}
| Section2 = {{Chembox Properties
⚫ | C=1|H=6|O=6|P=2
| Appearance =
| Density =
| MeltingPt = 199-200 °C<ref name=Merck>{{Merck12th}}</ref>
| BoilingPt =
| Solubility =
}}
| Section3 = {{Chembox Hazards
| MainHazards =
| FlashPt =
| Autoignition =
| LD50 = 45-50 mg/kg (i.v., mice, rabbits)<ref name=Merck/>
}}
}} }}

Revision as of 13:40, 23 November 2011

This page contains a copy of the infobox ({{chembox}}) taken from revid 456776502 of page Medronic_acid with values updated to verified values.
WikiProject Chemicals/Chembox validation/VerifiedDataSandbox
Names
IUPAC name Methanediylbis(phosphonic acid)
Other names Methanediphosphonic acid; Methylenebis(phosphonic acid); Methylene diphosphonate; Medronate; Phosphonomethylphosphonic acid; MDP
Identifiers
3D model (JSmol)
ChEMBL
ChemSpider
KEGG
PubChem CID
InChI
  • InChI=1S/CH6O6P2/c2-8(3,4)1-9(5,6)7/h1H2,(H2,2,3,4)(H2,5,6,7)Key: MBKDYNNUVRNNRF-UHFFFAOYSA-N
SMILES
  • O=P(O)(O)CP(=O)(O)O
Properties
Chemical formula CH6O6P2
Molar mass 176.001 g·mol
Melting point 199-200 °C
Hazards
Lethal dose or concentration (LD, LC):
LD50 (median dose) 45-50 mg/kg (i.v., mice, rabbits)
Except where otherwise noted, data are given for materials in their standard state (at 25 °C , 100 kPa). ☒N verify (what is  ?) Infobox references
Tracking categories (test):
Chemical compound
  1. ^ Budavari, Susan, ed. (1996). The Merck Index: An Encyclopedia of Chemicals, Drugs, and Biologicals (12th ed.). Merck. ISBN 0911910123.