Misplaced Pages

:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions - Misplaced Pages

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
< Misplaced Pages:WikiProject Chemicals | Chembox validation Browse history interactively← Previous editNext edit →Content deleted Content addedVisualWikitext
Revision as of 12:36, 24 November 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 447616004 of page Miglitol for the Chem/Drugbox validation project (updated: 'DrugBank').← Previous edit Revision as of 12:36, 24 November 2011 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 456758129 of page Miglustat for the Chem/Drugbox validation project (updated: 'DrugBank').Next edit →
Line 1: Line 1:
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} {{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}}
{{Drugbox {{Drugbox
| Verifiedfields = changed
| verifiedrevid = 411550118 | verifiedrevid = 400312895
| IUPAC_name = (2''R'',3''R'',4''R'',5''S'')-1-(2-hydroxyethyl)-2-(hydroxymethyl)<br>piperidine-3,4,5-triol | IUPAC_name = (2''R'',3''R'',4''R'',5''S'')-1-butyl-2-(hydroxymethyl)piperidine-3,4,5-triol
| image = Miglitol structure.svg
| width = 200 | image = Miglustat.svg


<!--Clinical data--> <!--Clinical data-->
| tradename = Glyset | tradename =
| Drugs.com = {{drugs.com|monograph|miglitol}} | Drugs.com = {{drugs.com|monograph|miglustat}}
| MedlinePlus = a601079 | MedlinePlus = a604015
| licence_US = Miglitol | licence_US = Miglustat
| pregnancy_AU = B3 | pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US = B | pregnancy_US = X
| pregnancy_category = | pregnancy_category =
| legal_AU = <!-- Unscheduled / S2 / S4 / S8 --> | legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
| legal_UK = <!-- GSL / P / POM / CD --> | legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C -->
| legal_US = Rx-only | legal_US = Rx-only
| legal_status = | legal_status =
Line 21: Line 22:


<!--Pharmacokinetic data--> <!--Pharmacokinetic data-->
| bioavailability = Dose-dependent | bioavailability = 97%
| protein_bound = Negligible (<4.0%) | protein_bound = Nil
| metabolism = Nil | metabolism = Nil
| elimination_half-life = 2 hours | elimination_half-life = 6–7 hours
| excretion = ] (95%) | excretion = ], unchanged


<!--Identifiers--> <!--Identifiers-->
| CASNo_Ref = {{cascite|correct|CAS}} | CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 72432-03-2 | CAS_number = 72599-27-0
| ATC_prefix = A10 | ATC_prefix = A16
| ATC_suffix = BF02 | ATC_suffix = AX06
⚫ | PubChem = 51634
| ATC_supplemental =
⚫ | PubChem = 441314
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} | DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB00491 | DrugBank = DB00419
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 390074 | ChemSpiderID = 46764
| UNII_Ref = {{fdacite|correct|FDA}} | UNII_Ref = {{fdacite|changed|FDA}}
| UNII = 0V5436JAQW | UNII = ADN3S497AZ
| KEGG_Ref = {{keggcite|correct|kegg}} | ChEBI_Ref = {{ebicite|changed|EBI}}
| KEGG = D00625 | ChEBI = 50381
| ChEMBL_Ref = {{ebicite|correct|EBI}} | ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 1561 | ChEMBL = 1029


<!--Chemical data--> <!--Chemical data-->
| C=8 | H=17 | N=1 | O=5 | C=10 | H=21 | N=1 | O=4
| molecular_weight = 207.224 g/mol | molecular_weight = 219.28 g/mol
| smiles = OCCN1((O)(O)(O)C1)CO | smiles = OC1N(CCCC)C(O)(O)1O
| InChI = 1/C8H17NO5/c10-2-1-9-3-6(12)8(14)7(13)5(9)4-11/h5-8,10-14H,1-4H2/t5-,6+,7-,8-/m1/s1 | InChI = 1/C10H21NO4/c1-2-3-4-11-5-8(13)10(15)9(14)7(11)6-12/h7-10,12-15H,2-6H2,1H3/t7-,8+,9-,10-/m1/s1
| InChIKey = IBAQFPQHRJAVAV-ULAWRXDQBK | InChIKey = UQRORFVVSGFNRO-UTINFBMNBD
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C8H17NO5/c10-2-1-9-3-6(12)8(14)7(13)5(9)4-11/h5-8,10-14H,1-4H2/t5-,6+,7-,8-/m1/s1 | StdInChI = 1S/C10H21NO4/c1-2-3-4-11-5-8(13)10(15)9(14)7(11)6-12/h7-10,12-15H,2-6H2,1H3/t7-,8+,9-,10-/m1/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = IBAQFPQHRJAVAV-ULAWRXDQSA-N | StdInChIKey = UQRORFVVSGFNRO-UTINFBMNSA-N
| synonyms = 1,5-(butylimino)-1,5-dideoxy-D-glucitol
| density = 1.458
| melting_point = 114
}} }}

Revision as of 12:36, 24 November 2011

This page contains a copy of the infobox ({{drugbox}}) taken from revid 456758129 of page Miglustat with values updated to verified values.
WikiProject Chemicals/Chembox validation/VerifiedDataSandbox
Clinical data
Other names1,5-(butylimino)-1,5-dideoxy-D-glucitol
AHFS/Drugs.comMonograph
MedlinePlusa604015
License data
Routes of
administration		Oral
ATC code
Legal status
Legal status
Pharmacokinetic data
Bioavailability97%
Protein bindingNil
MetabolismNil
Elimination half-life6–7 hours
ExcretionRenal, unchanged
Identifiers
IUPAC name
  • (2R,3R,4R,5S)-1-butyl-2-(hydroxymethyl)piperidine-3,4,5-triol
CAS Number
PubChem CID
DrugBank
ChemSpider
UNII
ChEBI
ChEMBL
Chemical and physical data
FormulaC10H21NO4
Molar mass219.28 g/mol g·mol
3D model (JSmol)
SMILES
  • OC1N(CCCC)C(O)(O)1O
InChI
  • InChI=1S/C10H21NO4/c1-2-3-4-11-5-8(13)10(15)9(14)7(11)6-12/h7-10,12-15H,2-6H2,1H3/t7-,8+,9-,10-/m1/s1
  • Key:UQRORFVVSGFNRO-UTINFBMNSA-N
  (what is this?)  (verify)