| Revision as of 12:38, 24 November 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,084 edits Saving copy of the {{drugbox}} taken from revid 460463385 of page Milrinone for the Chem/Drugbox validation project (updated: 'DrugBank').← Previous edit |
Revision as of 12:38, 24 November 2011 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,084 edits Saving copy of the {{drugbox}} taken from revid 456816569 of page Miltefosine for the Chem/Drugbox validation project (updated: 'CAS_number').Next edit → |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{Drugbox |
|
{{Drugbox |
|
| Verifiedfields = changed |
|
| Verifiedfields = changed |
|
| verifiedrevid = 414088890 |
|
| verifiedrevid = 415848483 |
|
| IUPAC_name = 2-methyl-6-oxo-1,6-dihydro-3,4'-bipyridine-5-carbonitrile |
|
| IUPAC_name = 2-(hexadecoxy-oxido-phosphoryl)oxyethyl-trimethyl-azanium |
|
| image = Milrinone.svg |
|
| image = Miltefosine.svg |
|
|
| width = 300 |
|
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
| tradename = |
|
| tradename = |
|
| Drugs.com = {{drugs.com|monograph|milrinone-lactate}} |
|
| Drugs.com = {{drugs.com|international|miltefosine}} |
|
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| MedlinePlus = a601020 |
|
|
| pregnancy_US = C |
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
|
| pregnancy_category = |
| ⚫ |
| legal_status = Rx-only |
|
|
|
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S8 --> |
| ⚫ |
| routes_of_administration = IV only |
|
|
|
| legal_UK = <!-- GSL / P / POM / CD --> |
|
|
| legal_US = <!-- OTC / Rx-only --> |
|
⚫ |
| legal_status = |
|
⚫ |
| routes_of_administration = Oral |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
<!--Pharmacokinetic data--> |
|
| bioavailability = 100% (as IV bolus, infusion) |
|
| bioavailability = High |
|
| protein_bound = 70 to 80% |
|
| protein_bound = |
|
| metabolism = Hepatic (12%) |
|
| metabolism = |
|
|
| elimination_half-life = 6 to 8 days and 31 days <ref name=Dorlo2008>{{cite journal | author = Dorlo TP, van Thiel PP, Huitema AD, Keizer RJ, de Vries HJ, Beijnen JH, de Vries PJ | title = Pharmacokinetics of miltefosine in Old World cutaneous leishmaniasis patients. | journal = Antimicrob Agents Chemother | volume = 52 | issue = 8 | pages = 2855–60 | year = 2008 | pmid = 18519729 | doi = 10.1128/AAC.00014-08 | pmc = 2493105}}</ref> |
|
| elimination_half-life = 2.3 hours (mean, in CHF) |
|
|
| excretion = Urine (85% as unchanged drug) within 24 hours |
|
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number = 78415-72-2 |
|
| CAS_number = <!-- blanked - oldvalue: 58066-85-6 --> |
|
| ATC_prefix = C01 |
|
| ATC_prefix = L01 |
|
| ATC_suffix = CE02 |
|
| ATC_suffix = XX09 |
|
⚫ |
| PubChem = 3599 |
|
| ATC_supplemental = |
|
| ⚫ |
| PubChem = 4197 |
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank = DB00235 |
|
| DrugBank = |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 4052 |
|
| ChemSpiderID = 3473 |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII_Ref = {{fdacite|changed|FDA}} |
|
| UNII = JU9YAX04C7 |
|
| UNII = 53EY29W7EC |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG = D00417 |
|
| KEGG = D02494 |
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEBI = 50693 |
|
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL = 189 |
|
| ChEMBL = 125 |
|
|
|
|
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=12 | H=9 | N=3 | O=1 |
|
| C=21 | H=46 | N=1 | O=4 | P=1 |
|
| molecular_weight = 211.219 g/mol |
|
| molecular_weight = 407.568 g/mol |
|
| smiles = Cc1c(cc(c(=O)1)C#N)c2ccncc2 |
|
| smiles = P(=O)(OCCCCCCCCCCCCCCCC)OCC(C)(C)C |
|
| InChI = 1/C12H9N3O/c1-8-11(9-2-4-14-5-3-9)6-10(7-13)12(16)15-8/h2-6H,1H3,(H,15,16) |
|
| InChI = 1/C21H46NO4P/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-20-25-27(23,24)26-21-19-22(2,3)4/h5-21H2,1-4H3 |
|
| InChIKey = PZRHRDRVRGEVNW-UHFFFAOYAY |
|
| InChIKey = PQLXHQMOHUQAKB-UHFFFAOYAN |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C12H9N3O/c1-8-11(9-2-4-14-5-3-9)6-10(7-13)12(16)15-8/h2-6H,1H3,(H,15,16) |
|
| StdInChI = 1S/C21H46NO4P/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-20-25-27(23,24)26-21-19-22(2,3)4/h5-21H2,1-4H3 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = PZRHRDRVRGEVNW-UHFFFAOYSA-N |
|
| StdInChIKey = PQLXHQMOHUQAKB-UHFFFAOYSA-N |
|
| density = 1.344 |
|
|
| melting_point = 315 |
|
|
| boiling_point = 449 |
|
|
}} |
|
}} |
