Revision as of 12:41, 24 November 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,074 edits Saving copy of the {{drugbox}} taken from revid 457167034 of page Mitoxantrone for the Chem/Drugbox validation project (updated: 'DrugBank').← Previous edit |
Revision as of 12:41, 24 November 2011 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,074 edits Saving copy of the {{chembox}} taken from revid 431019204 of page Mitragynine for the Chem/Drugbox validation project (updated: 'ChEMBL', 'CASNo').Next edit → |
Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{Drugbox |
|
{{chembox |
|
⚫ |
| verifiedrevid = 400314315 |
|
| Verifiedfields = changed |
|
|
|
| ImageFile = Mitragynine.png |
⚫ |
| verifiedrevid = 414758221 |
|
|
|
| ImageSize = |
|
| IUPAC_name = 1,4-dihydroxy-5,8-bis-anthracene-9,10-dione |
|
|
|
| IUPACName = (E)-2-quinolizin-2-yl]-3- methoxyprop-2-enoic acid methyl ester |
|
| image = Mitoxantrone skeletal.svg |
|
|
|
| OtherNames = |
|
|
|
|
|
| Section1 = {{Chembox Identifiers |
|
<!--Clinical data--> |
|
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| tradename = Novantrone |
|
|
⚫ |
| ChemSpiderID = 2298865 |
|
| Drugs.com = {{drugs.com|monograph|mitoxantrone-hydrochloride}} |
|
|
|
| InChI = 1/C23H30N2O4/c1-5-14-12-25-10-9-15-21-18(7-6-8-20(21)28-3)24-22(15)19(25)11-16(14)17(13-27-2)23(26)29-4/h6-8,13-14,16,19,24H,5,9-12H2,1-4H3/b17-13+/t14-,16+,19+/m1/s1 |
|
| MedlinePlus = a608019 |
|
|
|
| InChIKey = LELBFTMXCIIKKX-QVRQZEMUBK |
|
| pregnancy_US = D |
|
|
| legal_status = Rx-only |
|
|
| routes_of_administration = '''Exclusively''' ] |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
|
| bioavailability = n/a |
|
|
| protein_bound = 78% |
|
|
| metabolism = ] (]) |
|
|
| elimination_half-life = 75 hours |
|
|
| excretion = ] |
|
|
|
|
|
<!--Identifiers--> |
|
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
|
| CAS_number = 65271-80-9 |
|
|
| ATC_prefix = L01 |
|
|
| ATC_suffix = DB07 |
|
⚫ |
| PubChem = 4212 |
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
|
| DrugBank = DB01204 |
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
⚫ |
| ChemSpiderID = 4067 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = BZ114NVM5P |
|
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
|
| KEGG = D08224 |
|
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEBI = 50729 |
|
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
⚫ |
| ChEMBL = 58 |
|
|
|
|
|
<!--Chemical data--> |
|
|
| C=22 | H=28 | N=4 | O=6 |
|
|
| molecular_weight = 444.481 ]/] |
|
|
| smiles = O=C2c1c(c(NCCNCCO)ccc1NCCNCCO)C(=O)c3c2c(O)ccc3O |
|
|
| InChI = 1/C22H28N4O6/c27-11-9-23-5-7-25-13-1-2-14(26-8-6-24-10-12-28)18-17(13)21(31)19-15(29)3-4-16(30)20(19)22(18)32/h1-4,23-30H,5-12H2 |
|
|
| InChIKey = KKZJGLLVHKMTCM-UHFFFAOYAS |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C22H28N4O6/c27-11-9-23-5-7-25-13-1-2-14(26-8-6-24-10-12-28)18-17(13)21(31)19-15(29)3-4-16(30)20(19)22(18)32/h1-4,23-30H,5-12H2 |
|
| StdInChI = 1S/C23H30N2O4/c1-5-14-12-25-10-9-15-21-18(7-6-8-20(21)28-3)24-22(15)19(25)11-16(14)17(13-27-2)23(26)29-4/h6-8,13-14,16,19,24H,5,9-12H2,1-4H3/b17-13+/t14-,16+,19+/m1/s1 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = KKZJGLLVHKMTCM-UHFFFAOYSA-N |
|
| StdInChIKey = LELBFTMXCIIKKX-QVRQZEMUSA-N |
|
|
| CASNo = <!-- blanked - oldvalue: 6202-22-8 --> |
|
⚫ |
| ChEMBL = 299031 |
|
⚫ |
| PubChem = 3034396 |
|
|
| SMILES = O=C(OC)\C(=C\OC)4C3c2nc1cccc(OC)c1c2CCN3C4CC |
|
|
}} |
|
|
| Section2 = {{Chembox Properties |
|
|
| Formula=C<sub>23</sub>H<sub>30</sub>N<sub>2</sub>O<sub>4</sub> |
|
|
| MolarMass=398.4953 |
|
|
| Appearance= |
|
|
| Density= |
|
|
| MeltingPt= |
|
|
| BoilingPt= |
|
|
| Solubility= |
|
|
}} |
|
|
| Section3 = {{Chembox Hazards |
|
|
| MainHazards= |
|
|
| FlashPt= |
|
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |