Revision as of 13:22, 24 November 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 453515484 of page N-Acetylserotonin for the Chem/Drugbox validation project (updated: 'ChEMBL', 'ChEBI', 'CASNo').← Previous edit |
Revision as of 13:25, 24 November 2011 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 457106706 of page N-Methyltryptamine for the Chem/Drugbox validation project (updated: 'CAS_number').Next edit → |
Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{Chembox |
|
{{Drugbox |
|
|
| Verifiedfields = changed |
|
| verifiedrevid = 453514473 |
|
| verifiedrevid = 415855795 |
|
| Name = ''N''-Acetylserotonin |
|
|
|
| IUPAC_name = 2-(1H-Indol-3-yl)-''N''-methylethanamine |
|
| ImageFile = N-Acetylserotonin.png |
|
|
|
| image = Methyltryptamine.png |
|
| ImageSize = |
|
|
|
| width = 140 |
|
| ImageFile2 = N-Acetylserotonin-3D-sticks.png |
|
|
|
| drug_name = ''N''-Methyltryptamine |
|
| IUPACName = ''N''-acetamide |
|
|
|
|
|
| OtherNames = ''N''-acetyl-5-hydroxytryptamine, ''N''-acetyl-5-HT |
|
|
|
<!--Clinical data--> |
|
| Section1 = {{Chembox Identifiers |
|
|
|
| tradename = |
⚫ |
| CASNo = <!-- blanked - oldvalue: 1210-83-9 --> |
|
|
|
|
⚫ |
| ChEMBL = 33103 |
|
|
|
<!--Identifiers--> |
⚫ |
| ChEBI = 17697 |
|
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
⚫ |
| PubChem = 903 |
|
|
⚫ |
| CAS_number = <!-- blanked - oldvalue: 61-49-4 --> |
|
| SMILES = CC(=O)NCCC1=CNC2=C1C=C(C=C2)O |
|
|
⚫ |
| PubChem = 6088 |
|
| MeSHName = ''N''-Acetylserotonin |
|
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 879 |
|
| ChemSpiderID = 5863 |
|
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
⚫ |
| InChI = 1/C12H14N2O2/c1-8(15)13-5-4-9-7-14-12-3-2-10(16)6-11(9)12/h2-3,6-7,14,16H,4-5H2,1H3,(H,13,15) |
|
|
|
| KEGG = C06213 |
|
| InChIKey = MVAWJSIDNICKHF-UHFFFAOYAX |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
⚫ |
| ChEBI = 28136 |
⚫ |
| StdInChI = 1S/C12H14N2O2/c1-8(15)13-5-4-9-7-14-12-3-2-10(16)6-11(9)12/h2-3,6-7,14,16H,4-5H2,1H3,(H,13,15) |
|
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
⚫ |
| ChEMBL = 348588 |
⚫ |
| StdInChIKey = MVAWJSIDNICKHF-UHFFFAOYSA-N |
|
|
|
|
|
}} |
|
|
|
<!--Chemical data--> |
|
| Section2 = {{Chembox Properties |
|
|
|
| C=11 | H=14 | N=2 |
|
| Formula = C<sub>12</sub>H<sub>14</sub>N<sub>2</sub>O<sub>2</sub> |
|
|
| MolarMass = 218.252 g/mol |
|
| molecular_weight = 174.245 g/mol |
|
|
| smiles = c1cccc2c1c(cn2)CCNC |
|
| Appearance = |
|
|
⚫ |
| InChI = 1/C11H14N2/c1-12-7-6-9-8-13-11-5-3-2-4-10(9)11/h2-5,8,12-13H,6-7H2,1H3 |
|
| Density = |
|
|
|
| InChIKey = NCIKQJBVUNUXLW-UHFFFAOYAC |
|
| MeltingPt = |
|
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| BoilingPt = |
|
|
⚫ |
| StdInChI = 1S/C11H14N2/c1-12-7-6-9-8-13-11-5-3-2-4-10(9)11/h2-5,8,12-13H,6-7H2,1H3 |
|
| Solubility = |
|
|
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
}} |
|
|
⚫ |
| StdInChIKey = NCIKQJBVUNUXLW-UHFFFAOYSA-N |
|
| Section3 = {{Chembox Hazards |
|
|
| MainHazards = |
|
| melting_point = 87 |
|
| FlashPt = |
|
| melting_high = 89 |
|
| Autoignition = |
|
|
}} |
|
|
}} |
|
}} |