Revision as of 13:33, 24 November 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 456637530 of page Nalidixic_acid for the Chem/Drugbox validation project (updated: 'DrugBank').← Previous edit |
Revision as of 13:34, 24 November 2011 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 456793717 of page Nalmefene for the Chem/Drugbox validation project (updated: 'CAS_number').Next edit → |
Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{Drugbox |
|
{{Drugbox |
|
| Verifiedfields = changed |
|
| Verifiedfields = changed |
|
| verifiedrevid = 394787048 |
|
| verifiedrevid = 400321814 |
|
| IUPAC_name = 1-ethyl-7-methyl-4-oxo-naphthyridine-3-carboxylic acid |
|
| IUPAC_name = 17-cyclopropylmethyl-4,5α-epoxy-6-methylenemorphinan-3,14-diol |
|
| image = Nalidixic acid.png |
|
| image = nalmefene.svg |
|
|
| width = 240 |
|
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
| tradename = |
|
| tradename = |
|
| Drugs.com = {{drugs.com|CDI|nalidixic_acid}} |
|
| Drugs.com = {{drugs.com|monograph|nalmefene-hydrochloride}} |
|
|
| MedlinePlus = a605043 |
|
| pregnancy_category = B <small>]</small> |
|
|
| legal_status = |
|
| legal_AU = |
|
|
| legal_CA = |
⚫ |
| routes_of_administration = Oral |
|
|
|
| legal_UK = |
|
|
| legal_US = |
|
|
| legal_status = Prescription Only Medicine |
|
⚫ |
| routes_of_administration = Oral, Intravenous |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
<!--Pharmacokinetic data--> |
|
| bioavailability = |
|
| bioavailability = |
|
| protein_bound = 90% |
|
| protein_bound = 45% |
|
| metabolism = Partially Hepatic |
|
| metabolism = hepatic |
|
| elimination_half-life = 6-7 hours, significantly longer in ] impairment |
|
| elimination_half-life = 10.8 ± 5.2 hours |
|
|
| excretion = renal |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number = 389-08-2 |
|
| CAS_number = <!-- blanked - oldvalue: 55096-26-9 --> |
|
|
| CAS_supplemental = <br />{{CAS|58895-64-0}} (]) |
|
| ATC_prefix = J01 |
|
|
| ATC_suffix = MB02 |
|
| ATC_prefix = none |
|
⚫ |
| PubChem = 5284594 |
|
| ATC_supplemental = |
|
⚫ |
| PubChem = 4421 |
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
|
| DrugBank = DB00779 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 4268 |
|
| ChemSpiderID = 4447642 |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII_Ref = {{fdacite|changed|FDA}} |
|
| UNII = 3B91HWA56M |
|
| UNII = TOV02TDP9I |
|
| KEGG_Ref = {{keggcite|changed|kegg}} |
|
|
| KEGG = D00183 |
|
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEBI = 100147 |
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
| ChEMBL = 5 |
|
| ChEMBL = 982 |
|
|
|
|
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=12 | H=12 | N=2 | O=3 |
|
| C=21 | H=25 | N=1 | O=3 |
|
| molecular_weight = 232.235 g/mol |
|
| molecular_weight = 375.9 g/mol (hydrochloride) |
|
| smiles = O=C\2c1c(nc(cc1)C)N(/C=C/2C(=O)O)CC |
|
| smiles = Oc2c1O5\C(=C)CC4(O)3N(CC45c1c(cc2)C3)CC6CC6 |
|
|
| InChI = 1/C21H25NO3/c1-12-6-7-21(24)16-10-14-4-5-15(23)18-17(14)20(21,19(12)25-18)8-9-22(16)11-13-2-3-13/h4-5,13,16,19,23-24H,1-3,6-11H2/t16-,19+,20+,21-/m1/s1 |
⚫ |
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
|
| InChIKey = WJBLNOPPDWQMCH-MBPVOVBZBG |
|
| StdInChI = 1S/C12H12N2O3/c1-3-14-6-9(12(16)17)10(15)8-5-4-7(2)13-11(8)14/h4-6H,3H2,1-2H3,(H,16,17) |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
|
| StdInChI = 1S/C21H25NO3/c1-12-6-7-21(24)16-10-14-4-5-15(23)18-17(14)20(21,19(12)25-18)8-9-22(16)11-13-2-3-13/h4-5,13,16,19,23-24H,1-3,6-11H2/t16-,19+,20+,21-/m1/s1 |
⚫ |
| StdInChIKey = MHWLWQUZZRMNGJ-UHFFFAOYSA-N |
|
|
⚫ |
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
⚫ |
| StdInChIKey = WJBLNOPPDWQMCH-MBPVOVBZSA-N |
|
}} |
|
}} |