Misplaced Pages

:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions - Misplaced Pages

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
< Misplaced Pages:WikiProject Chemicals | Chembox validation Browse history interactively← Previous editNext edit →Content deleted Content addedVisualWikitext
Revision as of 14:12, 24 November 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 456521956 of page Nomifensine for the Chem/Drugbox validation project (updated: 'CAS_number').← Previous edit Revision as of 14:13, 24 November 2011 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 444029078 of page Nonadecylic_acid for the Chem/Drugbox validation project (updated: 'ChEMBL').Next edit →
Line 1: Line 1:
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} {{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}}
{{Drugbox {{Chembox
⚫ | verifiedrevid = 444027847
| Verifiedfields = changed
| Name = Nonadecylic acid
⚫ | verifiedrevid = 408777829
| ImageFile = Nonadecylic acid.png
| IUPAC_name = (±)-2-methyl-4-phenyl-1,2,3,4-tetrahydroisoquinolin-8-amine
| ImageSize = 250px
| image = (±)-Nomifensine Enantiomers Structural Formulae.png
| ImageAlt =

| ImageName =
<!--Clinical data-->
| IUPACName = Nonadecanoic acid
| tradename =
| SystematicName =
| pregnancy_category =
| legal_status = Rx-only | OtherNames =
| Section1 = {{Chembox Identifiers
| routes_of_administration = Oral
| Abbreviations =

| CASNo = 646-30-0
<!--Pharmacokinetic data-->
| CASNo_Ref =
| bioavailability =
| metabolism = | CASNos =
⚫ | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| elimination_half-life = 1.5-4 hours
| excretion = | ChemSpiderID = 12071
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =
<!--Identifiers-->
| EC-number = 211-472-4
| CAS_number_Ref = {{cascite|correct|??}}
⚫ | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| CAS_number = <!-- blanked - oldvalue: 24526-64-5 -->
⚫ | StdInChIKey = ISYWECDDZWTKFF-UHFFFAOYSA-N
| ATC_prefix = N06
| ATC_suffix = AX04 | ChEMBL = 1169674
| PubChem = 4528 | PubChem = 12591
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} | ChEBI_Ref = {{ebicite|correct|EBI}}
| DrugBank = DB04821 | ChEBI = 39246
| SMILES = O=C(O)CCCCCCCCCCCCCCCCCC
⚫ | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
⚫ | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| ChemSpiderID = 4371
⚫ | StdInChI = 1S/C19H38O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(20)21/h2-18H2,1H3,(H,20,21)
| UNII_Ref = {{fdacite|changed|FDA}}
}}
| UNII = 1LGS5JRP31
| Section2 = {{Chembox Properties
| ChEBI_Ref = {{ebicite|changed|EBI}}
| Appearance = White flakes or powder
| ChEBI = 116225
| BoilingPt = 236°C (10 mmHg) </br> 297°C (100 mmHg)
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 273575 | Density =
| Formula = CH<sub>3</sub>(CH<sub>2</sub>)<sub>18</sub>COOH

| MolarMass = 298.50382 g/mol
<!--Chemical data-->
| MeltingPt = 68-70°C
| C=16 | H=18 | N=2
| Solubility = Insoluble
| molecular_weight = 238.328 g/mol
| SolubleOther =
| smiles = c1ccc2c(c1N)CN(CC2c3ccccc3)C
| Solvent = }}
| InChI = 1/C16H18N2/c1-18-10-14(12-6-3-2-4-7-12)13-8-5-9-16(17)15(13)11-18/h2-9,14H,10-11,17H2,1H3
| Section7 = {{Chembox Hazards
| InChIKey = XXPANQJNYNUNES-UHFFFAOYAL
| ExternalMSDS =
⚫ | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| FlashPt =
⚫ | StdInChI = 1S/C16H18N2/c1-18-10-14(12-6-3-2-4-7-12)13-8-5-9-16(17)15(13)11-18/h2-9,14H,10-11,17H2,1H3
| LD50 =
⚫ | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| MainHazards = Irritant ('''Xi''')
⚫ | StdInChIKey = XXPANQJNYNUNES-UHFFFAOYSA-N
| NFPA-H =
| NFPA-F =
| NFPA-R =
| NFPA-O =
| RPhrases = {{R36/37/38}}
| SPhrases = {{S26}}
}}
| Section8 = {{Chembox Related
| Function =
| OtherAnions =
| OtherCations =
| OtherCpds =
| OtherFunctn = }}
}} }}

Revision as of 14:13, 24 November 2011

This page contains a copy of the infobox ({{chembox}}) taken from revid 444029078 of page Nonadecylic_acid with values updated to verified values.
Nonadecylic acid
Names
IUPAC name Nonadecanoic acid
Identifiers
CAS Number
3D model (JSmol)
ChEBI
ChEMBL
ChemSpider
PubChem CID
InChI
  • InChI=1S/C19H38O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(20)21/h2-18H2,1H3,(H,20,21)Key: ISYWECDDZWTKFF-UHFFFAOYSA-N
SMILES
  • O=C(O)CCCCCCCCCCCCCCCCCC
Properties
Chemical formula CH3(CH2)18COOH
Molar mass 298.50382 g/mol
Appearance White flakes or powder
Melting point 68-70°C
Boiling point 236°C (10 mmHg)
297°C (100 mmHg)
Solubility in water Insoluble
Hazards
Occupational safety and health (OHS/OSH):
Main hazards Irritant (Xi)
Except where otherwise noted, data are given for materials in their standard state (at 25 °C , 100 kPa). checkY verify (what is  ?) Infobox references
Tracking categories (test):
Chemical compound