| Revision as of 14:34, 24 November 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 454236703 of page Olaparib for the Chem/Drugbox validation project (updated: 'ChEMBL', 'CAS_number').← Previous edit |
Revision as of 14:35, 24 November 2011 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 454735245 of page Oleandrin for the Chem/Drugbox validation project (updated: 'ChEMBL', 'CASNo').Next edit → |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{Drugbox |
|
{{chembox |
|
|
|ImageFile=Oleandrin.png |
|
| verifiedrevid = 454235249 |
|
|
|
|ImageSize=200px |
|
| IUPAC_name = 4-carbonyl) -4-fluorophenyl]methyl(2H)phthalazin-1-one |
|
|
|
|IUPACName= <small>acetic acid [(3''S'',5''R'',10''S'',13''R'',14''S'',16''S'',17'''R'')-14-hydroxy-3-<nowiki>[[</nowiki>(2''R'',4''S'',5''S'',6''S'')-5-hydroxy-4-methoxy-6-methyl- |
|
| image = Olaparib.png |
|
|
|
2-tetrahydropyranyl]oxy]-10,13-dimethyl-17-(5-oxo-2H-furan-3-yl)-1,2,3,4,5,6,7,8,9,11,12,15,16,17- |
|
| width = 200 |
|
|
|
tetradecahydrocyclopentaphenanthren-16-yl] ester</small> |
|
|
|
|
|
|OtherNames= |
|
<!--Clinical data--> |
|
|
|
|Section1={{Chembox Identifiers |
|
| tradename = |
|
|
⚫ |
| ChemSpiderID = 9716290 |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| ChEMBL = <!-- blanked - oldvalue: 109718 --> |
|
|
| InChI1 = 1/C32H48O9/c1-17-29(35)24(37-5)14-27(39-17)41-21-8-10-30(3)20(13-21)6-7-23-22(30)9-11-31(4)28(19-12-26(34)38-16-19)25(40-18(2)33)15-32(23,31)36/h12,17,20-25,27-29,35-36H,6-11,13-16H2,1-5H3/t17-,20+,21-,22-,23+,24-,25-,27-,28-,29-,30-,31+,32-/m0/s1 |
|
| pregnancy_category = |
|
|
|
| InChIKey1 = JLPDBLFIVFSOCC-XYXFTTADBR |
|
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
|
|
| StdInChI = 1S/C32H48O9/c1-17-29(35)24(37-5)14-27(39-17)41-21-8-10-30(3)20(13-21)6-7-23-22(30)9-11-31(4)28(19-12-26(34)38-16-19)25(40-18(2)33)15-32(23,31)36/h12,17,20-25,27-29,35-36H,6-11,13-16H2,1-5H3/t17-,20+,21-,22-,23+,24-,25-,27-,28-,29-,30-,31+,32-/m0/s1 |
|
| legal_CA = <!-- Schedule I --> |
|
|
⚫ |
| StdInChIKey = JLPDBLFIVFSOCC-XYXFTTADSA-N |
|
| legal_UK = <!-- Class A --> |
|
|
| legal_US = <!-- Schedule I --> |
|
| CASNo = <!-- blanked - oldvalue: 465-16-7 --> |
|
⚫ |
| PubChem = 11541511 |
|
| legal_status = Investigational |
|
|
|
| SMILES = O=C\1OC/C(=C/1)2(OC(=O)C)C6(O)2(C)CC46CC5C(O3O((O)(OC)C3)C)CC45C |
|
| routes_of_administration = Oral |
|
|
|
}} |
|
|
|
|
|
|Section2={{Chembox Properties |
|
<!--Pharmacokinetic data--> |
|
|
|
| Formula=C<sub>32</sub>H<sub>48</sub>O<sub>9</sub> |
|
| bioavailability = |
|
|
|
| MolarMass=576.72 g/mol |
|
| protein_bound = |
|
|
|
| Appearance= Oleandrin forms colourless, odourless, acicular crystals that are very bitter |
|
| metabolism = |
|
|
|
| Density= |
|
| elimination_half-life = |
|
|
|
| MeltingPtC = 250.0 |
|
| excretion = |
|
|
|
| BoilingPtc= |
|
|
|
|
|
| Solubility= |
|
<!--Identifiers--> |
|
|
|
}} |
|
| CAS_number = <!-- blanked - oldvalue: 763113-22-0 --> |
|
|
|
|Section3={{Chembox Hazards |
|
| ATC_prefix = none |
|
|
|
| MainHazards= |
|
| ATC_suffix = |
|
|
|
| FlashPt= |
|
| ChEMBL = 521686 |
|
|
|
| Autoignition= |
| ⚫ |
| PubChem = 23725625 |
|
|
|
}} |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
|
| DrugBank = |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = WOH1JD9AR8 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ⚫ |
| ChemSpiderID = 23343272 |
|
|
| InChI = 1/C24H23FN4O3/c25-20-8-5-15(14-21-17-3-1-2-4-18(17)22(30)27-26-21)13-19(20)24(32)29-11-9-28(10-12-29)23(31)16-6-7-16/h1-5,8,13,16H,6-7,9-12,14H2,(H,27,30) |
|
|
| InChIKey = FDLYAMZZIXQODN-UHFFFAOYAF |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
|
| StdInChI = 1S/C24H23FN4O3/c25-20-8-5-15(14-21-17-3-1-2-4-18(17)22(30)27-26-21)13-19(20)24(32)29-11-9-28(10-12-29)23(31)16-6-7-16/h1-5,8,13,16H,6-7,9-12,14H2,(H,27,30) |
|
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| ⚫ |
| StdInChIKey = FDLYAMZZIXQODN-UHFFFAOYSA-N |
|
|
|
|
|
<!--Chemical data--> |
|
|
| C=24 | H=23 | F=1 | N=4 | O=3 |
|
|
| molecular_weight = 435.08 g/mol |
|
|
| smiles = c4cccc2c4c(nnc2=O)Cc(ccc1F)cc1C(=O)N3CCN(CC3)C(=O)C5CC5 |
|
|
}} |
|
}} |
