Revision as of 14:41, 24 November 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 456535398 of page Orbifloxacin for the Chem/Drugbox validation project (updated: 'CAS_number').← Previous edit |
Revision as of 14:42, 24 November 2011 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 451606390 of page Org_12,962 for the Chem/Drugbox validation project (updated: 'ChEMBL', 'CAS_number').Next edit → |
Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{Drugbox |
|
{{Drugbox |
|
⚫ |
| verifiedrevid = 442985811 |
|
| Verifiedfields = changed |
|
|
|
| IUPAC_name = 1-(5-trifluoromethyl-6-chloropyridin-2-yl)piperazine |
⚫ |
| verifiedrevid = 408780687 |
|
|
⚫ |
| image = Org12962_structure.png |
|
| IUPAC_name = 1-Cyclopropyl-7--5,6,8-trifluoro-4-oxo-1,4-dihydroquinoline-3-carboxylic acid |
|
|
|
| width = 240 |
⚫ |
| image = orbifloxacin.png |
|
|
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
| tradename = |
|
| tradename = |
|
| Drugs.com = {{drugs.com|international|orbifloxacin}} |
|
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
|
| pregnancy_category = |
|
| pregnancy_category = |
|
⚫ |
| legal_status = Uncontrolled |
|
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
|
⚫ |
| routes_of_administration = |
|
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
|
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> |
|
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
⚫ |
| legal_status = veterinary use only |
|
⚫ |
| routes_of_administration = Oral |
|
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
<!--Pharmacokinetic data--> |
Line 27: |
Line 20: |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
⚫ |
| CAS_number = <!-- blanked - oldvalue: 210821-63-9 --> |
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
|
|
| ATC_prefix = |
⚫ |
| CAS_number = <!-- blanked - oldvalue: 113617-63-3 --> |
|
|
| ATCvet = yes |
|
| ATC_suffix = |
|
| ATC_prefix = J01 |
|
| ChEMBL = 506999 |
|
| ATC_suffix = MA95 |
|
| PubChem = 9796408 |
|
| PubChem = 60605 |
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
|
| DrugBank = |
|
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 54631 |
|
| ChemSpiderID = 7972174 |
|
| UNII_Ref = {{fdacite|changed|FDA}} |
|
|
| UNII = 660932TPY6 |
|
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
|
| KEGG = D08299 |
|
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
|
| ChEMBL = 295433 |
|
|
|
|
|
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=19 | H=20 | F=3 | N=3 | O=3 |
|
| C=10 | H=11 | Cl=1 | F=3 | N=3 |
|
| molecular_weight = 395.37 g/mol |
|
| molecular_weight = 265.662 g/mol |
|
|
| smiles = C2CNCCN2c(nc1Cl)ccc1C(F)(F)F |
|
| smiles = Fc1c(c(F)c2c(c1F)C(=O)C(\C(=O)O)=C/N2C3CC3)N4C(N(C4)C)C |
|
|
| InChI = 1/C19H20F3N3O3/c1-8-5-24(6-9(2)23-8)17-14(21)13(20)12-16(15(17)22)25(10-3-4-10)7-11(18(12)26)19(27)28/h7-10,23H,3-6H2,1-2H3,(H,27,28)/t8-,9+ |
|
|
| InChIKey = QIPQASLPWJVQMH-DTORHVGOBR |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C19H20F3N3O3/c1-8-5-24(6-9(2)23-8)17-14(21)13(20)12-16(15(17)22)25(10-3-4-10)7-11(18(12)26)19(27)28/h7-10,23H,3-6H2,1-2H3,(H,27,28)/t8-,9+ |
|
| StdInChI = 1S/C10H11ClF3N3/c11-9-7(10(12,13)14)1-2-8(16-9)17-5-3-15-4-6-17/h1-2,15H,3-6H2 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = QIPQASLPWJVQMH-DTORHVGOSA-N |
|
| StdInChIKey = QZYYPQAYSFBKPW-UHFFFAOYSA-N |
|
}} |
|
}} |